Revision as of 08:02, 23 July 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm cleanup← Previous edit |
Latest revision as of 13:59, 22 August 2022 edit undoFswitzer4 (talk | contribs)Extended confirmed users10,572 editsm Added UNII |
(18 intermediate revisions by 12 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 443017100 |
|
| Name = Thunberginol C |
|
| Name = Thunberginol C |
|
| ImageFile = Thunberginol C.png |
|
| ImageFile = Thunberginol C.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| ImageName = Chemical structure of thunberginol C |
|
| ImageName = Chemical structure of thunberginol C |
Line 7: |
Line 9: |
|
| IUPACName = 6,8-dihydroxy-3-(4-hydroxyphenyl)-3,4-dihydroisochromen-1-one |
|
| IUPACName = 6,8-dihydroxy-3-(4-hydroxyphenyl)-3,4-dihydroisochromen-1-one |
|
| OtherNames = <!-- <br> --> |
|
| OtherNames = <!-- <br> --> |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 147517-06-4 |
|
| CASNo = 147517-06-4 |
|
| CASNo_Ref = |
|
| CASNoOther = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| CASOther = |
|
|
|
| UNII = X3P5X86ZBF |
|
| PubChem = 10333412 |
|
| PubChem = 10333412 |
|
| SMILES = C1C(OC(=O)C2=C(C=C(C=C21)O)O)C3=CC=C(C=C3)O |
|
| SMILES = C1C(OC(=O)C2=C(C=C(C=C21)O)O)C3=CC=C(C=C3)O |
|
|
| ChemSpiderID = 8508871 |
|
| InChI = |
|
|
|
| StdInChI = 1S/C15H12O5/c16-10-3-1-8(2-4-10)13-6-9-5-11(17)7-12(18)14(9)15(19)20-13/h1-5,7,13,16-18H,6H2 |
|
|
| StdInChIKey = WMAITHDYVBQITD-UHFFFAOYSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>15</sub>H<sub>12</sub>O<sub>5</sub> |
|
| Formula = C<sub>15</sub>H<sub>12</sub>O<sub>5</sub> |
|
| MolarMass = 272.25 g/mol |
|
| MolarMass = 272.25 g/mol |
|
| ExactMass = 272.068473 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. --> |
|
|
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. --> |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Thunberginol C''' is an ] found in ''Hydrangeae Dulcis Folium'', the processed leaves of ''] var. thunbergii''.<ref>Thunberginols C, D, and E, new antiallergic and antimicrobial dihydroisocoumarins, and thunberginol G 3'-O-glucoside and (-)-hydrangenol 4'-O-glucoside, new dihydroisocoumarin glycosides, from Hydrangeae Dulcis Folium. |
|
'''Thunberginol C''' is a ] found in ''Hydrangeae Dulcis Folium'', the processed leaves of ''] var. thunbergii''.<ref>{{Cite journal |
|
|
| last1 = Yoshikawa | first1 = M. |
|
Yoshikawa M, Uchida E, Chatani N, Kobayashi H, Naitoh Y, Okuno Y, Matsuda H, Yamahara J and Murakami N. Chem Pharm Bull (Tokyo). 1992 Dec;40(12), pp. 3352-3354, {{PMID|1363465}}</ref> |
|
|
|
| last2 = Uchida | first2 = E. |
|
|
| last3 = Chatani | first3 = N. |
|
|
| last4 = Kobayashi | first4 = H. |
|
|
| last5 = Naitoh | first5 = Y. |
|
|
| last6 = Okuno | first6 = Y. |
|
|
| last7 = Matsuda | first7 = H. |
|
|
| last8 = Yamahara | first8 = J. |
|
|
| last9 = Murakami | first9 = N. |
|
|
| title = Thunberginols C, D, and E, New Antiallergic and Antimicrobial Dihydroisocoumarins, and Thunberginol G 3'-O-Glucoside and (-)-Hydrangenol 4'-O-Glucoside, New Dihydroisocoumarin Glycosides, from ''Hydrangeae Dulcis Folium'' |
|
|
| journal = Chemical and Pharmaceutical Bulletin |
|
|
| volume = 40 |
|
|
| issue = 12 |
|
|
| pages = 3352–3354 |
|
|
| year = 1992 |
|
|
| pmid = 1363465 |
|
|
| doi = 10.1248/cpb.40.3352 |
|
|
| url = http://www.jstage.jst.go.jp/article/cpb1958/40/12/40_12_3352/_pdf |
|
|
| format = pdf |
|
|
| doi-access = free |
|
|
}}</ref> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{Reflist}} |
|
|
|
|
|
{{Isocoumarin}} |
|
{{Isocoumarin}} |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
|
|
{{aromatic-stub}} |