Browse history interactively

Page 1

Page 1Revision 1

Page 2

Page 2Revision 2

← Previous editContent deleted Content addedVisualWikitext

Revision as of 17:40, 29 July 2010 editPotatoBot (talk | contribs)Bots51,239 editsm Stub sorting and placement of stub template(s)← Previous edit		Latest revision as of 01:10, 14 November 2024 edit undoCollectivePsychosis (talk | contribs)24 edits corrected IUPAC name to reflect modern conventions
(30 intermediate revisions by 24 users not shown)
Line 1:		Line 1:
			{{Short description|Chemical compound}}
	{{Drugbox		{{Drugbox
			| Verifiedfields = changed
	| IUPAC_name = (4''R'',5''S'',6''S'',8''R'',9a''R'',10''R'')-5-Hydroxy-4,6,9,10-tetramethyl-1-oxo-6-vinyldecahydro-3a,9-propanocyclopentaannulen-8-yl {sulfanyl}acetate
			| Watchedfields = changed
⚫	| image = Tiamulin skeletal.svg
			| verifiedrevid = 376122925
⚫	| width =
			| IUPAC_name = tetradecanyl] 2-acetate
⚫	| CAS_number = 55297-95-5
		⚫	| image = Tiamulin skeletal.svg
	| CAS_supplemental =
		⚫	| width =
⚫	| ATCvet = yes
⚫	| ATC_prefix = J01
			<!--Clinical data-->
⚫	| ATC_suffix = XQ01
			| tradename = Dynamutilin, others
⚫	| ATC_supplemental =
	| PubChem = 656958		| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
	| DrugBank =		| pregnancy_US = <!-- A / B / C / D / X -->
	| chemical_formula =		| pregnancy_category =
		⚫	| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫	| C=28 | H=47 | N=1 | O=4 | S=1
		⚫	| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
	| molecular_weight = 493.742 g/mol
		⚫	| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫	| bioavailability =
		⚫	| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫	| protein_bound =
		⚫	| legal_status = Veterinary use only
⚫	| metabolism =
⚫	| elimination_half-life =
⚫	| excretion =
	| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
	| pregnancy_US = <!-- A / B / C / D / X -->
	| pregnancy_category=
⚫	| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫	| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫	| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫	| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫	| legal_status = Veterinary use only
	| routes_of_administration = Oral		| routes_of_administration = Oral
			<!--Pharmacokinetic data-->
		⚫	| bioavailability =
		⚫	| protein_bound =
		⚫	| metabolism =
		⚫	| elimination_half-life =
		⚫	| excretion =
			<!--Identifiers-->
			| CAS_number_Ref = {{cascite|correct|??}}
		⚫	| CAS_number = 55297-95-5
		⚫	| ATCvet = yes
		⚫	| ATC_prefix = J01
		⚫	| ATC_suffix = XQ01
		⚫	| ATC_supplemental =
			| PubChem = 656958
			| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
			| DrugBank =
			| UNII_Ref = {{fdacite|changed|FDA}}
			| UNII = E38WZ4U54R
			| ChEMBL_Ref = {{ebicite|changed|EBI}}
			| ChEMBL = 498466
			| ChEBI_Ref = {{ebicite|changed|EBI}}
			| ChEBI = 44137
			| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
			| ChemSpiderID = 571196
			<!--Chemical data-->
			| chemical_formula =
		⚫	| C=28 | H=47 | N=1 | O=4 | S=1
			| smiles = CCN(CC)CCSCC(=O)O1C(((23CC(1(2C(=O)CC3)C)C)C)O)(C)C=C
			| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
			| StdInChI = 1S/C28H47NO4S/c1-8-26(6)17-22(33-23(31)18-34-16-15-29(9-2)10-3)27(7)19(4)11-13-28(20(5)25(26)32)14-12-21(30)24(27)28/h8,19-20,22,24-25,32H,1,9-18H2,2-7H3/t19-,20+,22-,24+,25+,26-,27+,28+/m1/s1
			| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
			| StdInChIKey = UURAUHCOJAIIRQ-QGLSALSOSA-N
	}}		}}
	'''Tiamulin''' is a ] ] drug that is used in veterinary medicine particularly for pigs and poultry.<ref></ref><ref>{{cite journal|last=Long|first=Katherine S|title=Interaction of Pleuromutilin Derivatives with the Ribosomal Peptidyl Transferase Center|journal=Antimicrobial Agents and Chemotherapy|date=April 2006|volume=50|issue=4|pages=1458–1462|url=http://aac.asm.org/cgi/reprint/50/4/1458.pdf|doi=10.1128/AAC.50.4.1458-1462.2006|pmid=16569865|first2=LH|first3=L|first4=B|pmc=1426994}}</ref>		'''Tiamulin''' (previously '''thiamutilin''') is a ] ] drug that is used in veterinary medicine particularly for pigs and poultry.<ref>{{cite web | url = http://www.bioagrimix.com/haccp/html/tiamulin.htm | work = HACCP | title = Tiamulin in Veterinary Medicine | archive-url = https://web.archive.org/web/20090610080725/http://www.bioagrimix.com/haccp/html/tiamulin.htm | archive-date=2009-06-10 }}</ref><ref>{{cite journal | vauthors = Long KS, Hansen LH, Jakobsen L, Vester B | title = Interaction of pleuromutilin derivatives with the ribosomal peptidyl transferase center | journal = Antimicrobial Agents and Chemotherapy | volume = 50 | issue = 4 | pages = 1458–62 | date = April 2006 | pmid = 16569865 | pmc = 1426994 | doi = 10.1128/AAC.50.4.1458-1462.2006 | url = }}</ref>
	Tiamulin is a ] antimicrobial with a pleuromutilin chemical structure similar to that of ].<ref></ref>		Tiamulin is a ] antimicrobial with a pleuromutilin chemical structure similar to that of ].<ref>{{cite web | url = http://www.emea.europa.eu/pdfs/vet/mrls/074700en.pdf | work = EMEA | title = Tiamulin Summary Report }}</ref>
	==References==		== References ==
	{{reflist}}		{{reflist}}
			{{Other antibacterials}}
	{{Protein synthesis inhibitor antibiotics}}
	]		]
	]		]
	]		]
	]		]
	]		]
			]
			]
			]
	{{antibiotic-stub}}		{{antibiotic-stub}}
	]