| Revision as of 04:31, 12 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validati← Previous edit |
Latest revision as of 08:18, 1 October 2023 edit undoVaccinationist (talk | contribs)Extended confirmed users4,733 edits svg formulaTag: 2017 wikitext editor |
| (13 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 444385753 |
|
⚫ |
| ImageFile=Tigemonam.svg |
|
⚫ |
| ImageSize=250px |
|
⚫ |
| IUPACName=2-<nowiki>amino]-2- oxoethylidene]amino]oxyacetic acid |
|
⚫ |
| OtherNames= Tigemen |
|
⚫ |
|Section1={{Chembox Identifiers |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 82H1LDS5D0 |
|
| UNII = 82H1LDS5D0 |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| verifiedrevid = 437163991 |
|
|
⚫ |
| CASNo=102507-71-1 |
| ⚫ |
|ImageFile=tigemonam.png |
|
|
⚫ |
| PubChem=9576769 |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| SMILES=CC1((C(=O)N1OS(=O)(=O)O)NC(=O)/C(=N\OCC(=O)O)/C2=CSC(=N2)N)C |
| ⚫ |
|IUPACName=2-<nowiki>amino]-2- oxoethylidene]amino]oxyacetic acid |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
|OtherNames= |
|
|
|
| ChemSpiderID = 7851210 |
| ⚫ |
|Section1={{Chembox Identifiers |
|
|
|
| InChI = 1/C12H15N5O9S2/c1-12(2)8(10(21)17(12)26-28(22,23)24)15-9(20)7(16-25-3-6(18)19)5-4-27-11(13)14-5/h4,8H,3H2,1-2H3,(H2,13,14)(H,15,20)(H,18,19)(H,22,23,24)/b16-7-/t8-/m1/s1 |
| ⚫ |
| CASNo=102507-71-1 |
|
|
|
| InChIKey = VAMSVIZLXJOLHZ-QWFSEIHXBK |
| ⚫ |
| PubChem=9576769 |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| SMILES=CC1((C(=O)N1OS(=O)(=O)O)NC(=O)/C(=N\OCC(=O)O)/C2=CSC(=N2)N)C |
|
|
|
| StdInChI = 1S/C12H15N5O9S2/c1-12(2)8(10(21)17(12)26-28(22,23)24)15-9(20)7(16-25-3-6(18)19)5-4-27-11(13)14-5/h4,8H,3H2,1-2H3,(H2,13,14)(H,15,20)(H,18,19)(H,22,23,24)/b16-7-/t8-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = VAMSVIZLXJOLHZ-QWFSEIHXSA-N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=12|H=15|N=5|O=9|S=2 |
|
| Formula=C<sub>12</sub>H<sub>15</sub>N<sub>5</sub>O<sub>9</sub>S<sub>2</sub> |
|
|
|
| Appearance= |
|
| MolarMass=437.4056 |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Tigemonam''' is a ] antibiotic.<ref name="pmid3259122">{{cite journal |author=Fuchs PC, Jones RN, Barry AL |title=In vitro antimicrobial activity of tigemonam, a new orally administered monobactam |journal=Antimicrob. Agents Chemother. |volume=32 |issue=3 |pages=346–9 |year=1988 |month=March |pmid=3259122 |pmc=172173 |doi= |url=http://aac.asm.org/cgi/pmidlookup?view=long&pmid=3259122}}</ref><ref name="pmid3279906">{{cite journal |author=Chin NX, Neu HC |title=Tigemonam, an oral monobactam |journal=Antimicrob. Agents Chemother. |volume=32 |issue=1 |pages=84–91 |year=1988 |month=January |pmid=3279906 |pmc=172104 |doi= |url=http://aac.asm.org/cgi/pmidlookup?view=long&pmid=3279906}}</ref> |
|
'''Tigemonam''' is a ] ].<ref name="pmid3259122">{{cite journal |vauthors=Fuchs PC, Jones RN, Barry AL |title=In vitro antimicrobial activity of tigemonam, a new orally administered monobactam |journal=Antimicrob. Agents Chemother. |volume=32 |issue=3 |pages=346–9 |date=March 1988 |pmid=3259122 |pmc=172173 |doi= 10.1128/aac.32.3.346|url=}}</ref><ref name="pmid3279906">{{cite journal |vauthors=Chin NX, Neu HC |title=Tigemonam, an oral monobactam |journal=Antimicrob. Agents Chemother. |volume=32 |issue=1 |pages=84–91 |date=January 1988 |pmid=3279906 |pmc=172104 |doi= 10.1128/aac.32.1.84|url=}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
] |
|
{{cell wall disruptive antibiotics}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
|
|
|
|
{{cell wall disruptive antibiotics}} |
|
| ⚫ |
{{antibiotic-stub}} |
|
|
|
|
|
|
⚫ |
{{antibiotic-stub}} |
|
] |
|