| Revision as of 10:41, 15 November 2010 editMaxxicum (talk | contribs)663 editsm <ref name="stringfellow" /> this actually has the source already← Previous edit |
Latest revision as of 10:29, 28 August 2024 edit undoMeodipt (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers, Rollbackers35,723 edits acts through the same pathway |
| (43 intermediate revisions by 31 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Refimprove|date=September 2009}} |
|
|
{{drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| IUPAC_name = 2,7-Bis(2-diethylaminoethoxy)fluoren-9-one |
|
|
|
| Watchedfields = changed |
| ⚫ |
| image = Tilorone.png |
|
|
|
| verifiedrevid = 396883483 |
| ⚫ |
| CAS_number = 27591-97-5 |
|
|
⚫ |
| IUPAC_name = 2,7-Bis(2-diethylaminoethoxy)fluoren-9-one |
| ⚫ |
| ATC_prefix = none |
|
|
⚫ |
| image = Tilorone.svg |
| ⚫ |
| ATC_suffix = |
|
|
|
| width = 275 |
| ⚫ |
| PubChem = 5475 |
|
|
|
|
| ⚫ |
| DrugBank = |
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|tilorone}} |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
|
| routes_of_administration = ] (]) |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = 60% |
|
⚫ |
| protein_bound = ~80% |
|
⚫ |
| metabolism = Nil |
|
⚫ |
| elimination_half-life = 48 hours |
|
|
| excretion = Feces (70%), urine (9%)<ref>{{cite web|title=Registry of Medicinal Products (RLS). Tilorone: Prescribing Information|url=http://www.rlsnet.ru/mnn_index_id_2731.htm|access-date=2 October 2016|language=Russian}}</ref> |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 27591-97-5 |
|
⚫ |
| ATC_prefix = J05 |
|
⚫ |
| ATC_suffix = AX19 |
|
⚫ |
| PubChem = 5475 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = O6W7VEW6KS |
|
|
| ChEBI = 147347 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 47298 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 5276 |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = D06149 |
|
|
|
|
|
<!--Chemical data--> |
|
| C=25 | H=34 | N=2 | O=3 |
|
| C=25 | H=34 | N=2 | O=3 |
|
|
| smiles = CCN(CC)CCOc1ccc-2c(c1)C(=O)c3c2ccc(c3)OCCN(CC)CC |
|
| molecular_weight = 410.55 g/mol |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| bioavailability = |
|
|
|
| StdInChI = 1S/C25H34N2O3/c1-5-26(6-2)13-15-29-19-9-11-21-22-12-10-20(30-16-14-27(7-3)8-4)18-24(22)25(28)23(21)17-19/h9-12,17-18H,5-8,13-16H2,1-4H3 |
| ⚫ |
| protein_bound = |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| metabolism = |
|
|
|
| StdInChIKey = MPMFCABZENCRHV-UHFFFAOYSA-N |
| ⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| ⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
|
| routes_of_administration = Oral |
|
|
}} |
|
}} |
|
|
|
|
|
'''Tilorone''' (trade name '''Amixin IC''') is the first recognized ], small ] compound that is an orally active ] inducer.<ref name="stringfellow">{{cite journal |author=Stringfellow D, Glasgow L |title=Tilorone hydrochloride: an oral interferon-inducing agent |journal=Antimicrob Agents Chemother |volume=2 |issue=2 |pages=73–8 |year=1972 |pmid=4670490 |pmc=444270}}</ref> It is used as an ]. |
|
'''Tilorone''' (trade names '''Amixin''', '''Lavomax''' and others) is the first recognized ], small ] compound that is an orally active ] inducer.<ref name="stringfellow">{{cite journal | vauthors = Stringfellow DA, Glasgow LA | title = Tilorone hydrochloride: an oral interferon-inducing agent | journal = Antimicrobial Agents and Chemotherapy | volume = 2 | issue = 2 | pages = 73–78 | date = August 1972 | pmid = 4670490 | pmc = 444270 | doi = 10.1128/aac.2.2.73 }}</ref> It is used as an ] in some countries which do not require double-blind placebo-controlled studies, including Russia. It is effective against ] in mice.<ref>{{cite journal | vauthors = Ekins S, Lingerfelt MA, Comer JE, Freiberg AN, Mirsalis JC, O'Loughlin K, Harutyunyan A, McFarlane C, Green CE, Madrid PB | display-authors = 6 | title = Efficacy of Tilorone Dihydrochloride against Ebola Virus Infection | journal = Antimicrobial Agents and Chemotherapy | volume = 62 | issue = 2 | date = February 2018 | pmid = 29133569 | pmc = 5786809 | doi = 10.1128/AAC.01711-17 }}</ref> It shows activity against ] and related viruses.<ref>Ogorek TJ, Golden JE. Advances in the Development of Small Molecule Antivirals against Equine Encephalitic Viruses. ''Viruses''. 2023 Feb 1;15(2):413. {{doi|10.3390/v15020413}} {{pmid|36851628}}</ref> |
|
|
|
|
==History== |
|
|
Tilorone was developed in the 1970s by the Physical and Chemical Institute of the National Academy of Sciences of ]. It has been widely used in Ukraine since March 2005. It is produced by ], based in ]. |
|
|
|
|
|
|
==Pharmacology== |
|
==Pharmacology== |
|
Tilorone activates the production of interferon.<ref name="stringfellow" /> |
|
Tilorone activates the production of interferon.<ref name="stringfellow" /> |
|
|
|
|
|
|
==See also== |
|
According to the results of clinical tests, conducted in ], the efficacy of prophylactic action of tilorone was 93.7%.{{Fact|date=November 2010}} |
|
|
|
* ] |
|
|
|
|
|
==Uses== |
|
== References == |
|
Tilorone is used for different viral diseases: ], ], ], ] and others. In addition, it is used in the treatment of ], ] and other viral and ] diseases. |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{pharma-stub}} |
|
{{antiinfective-drug-stub}} |
|
|
|
|
] |
|
|
] |
|