Misplaced Pages

Tolciclate: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 02:58, 7 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to verified fields - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation|Chem/Drugbox validation← Previous edit Latest revision as of 23:00, 1 April 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,831 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper 
(33 intermediate revisions by 24 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| UNII_Ref = {{fdacite|changed|FDA}} | Watchedfields = changed
| verifiedrevid = 448221674
| UNII = T3TZ02X2AZ
| IUPAC_name = ''O''-Tricycloundeca-2,4,6-trien-4-yl methyl(3-methylphenyl)carbamothioate
| verifiedrevid = 408940015
| image = Tolciclate.svg
| IUPAC_name =
| image2 = Tolciclate 3D spacefill.png
| image = tolciclate.png
| width2 = 200
| CAS_number = 50838-36-3
| alt2 = Space-filling model of the tolciclate molecule
| ATC_prefix = D01

| ATC_suffix = AE19
<!--Clinical data-->
| PubChem = 5506
| tradename =
| Drugs.com = {{drugs.com|international|tolciclate}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 50838-36-3
| ATC_prefix = D01
| ATC_suffix = AE19
| PubChem = 5506
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = | DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = T3TZ02X2AZ
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01384 | KEGG = D01384
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| C=20|H=21|N=1|O=1|S=1
| ChemSpiderID = 5305
| molecular_weight = 323.45 g/mol
| synonyms = <small>''O''-(1,2,3,4-Tetrahydro-1,4-methanonaphthalen-6-yl) ''m'',''N''-dimethylthiocarbanilate</small><ref name="INN">{{cite web|title=International Nonproprietary Names for Pharmaceutical Substances (INN). Recommended International Nonproprietary names: List 15|url=https://www.who.int/medicines/publications/druginformation/innlists/RL15.pdf|publisher=World Health Organization|access-date=12 November 2016|date=1975}}</ref>
| bioavailability =

| protein_bound =
<!--Chemical data-->
| metabolism =
| C=20 | H=21 | N=1 | O=1 | S=1
| elimination_half-life =
| smiles = Cc1cccc(c1)N(C)C(=S)Oc2ccc3c(c2)C4CCC3C4
| excretion =
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| StdInChI = 1S/C20H21NOS/c1-13-4-3-5-16(10-13)21(2)20(23)22-17-8-9-18-14-6-7-15(11-14)19(18)12-17/h3-5,8-10,12,14-15H,6-7,11H2,1-2H3
| pregnancy_US = <!-- A / B / C / D / X -->
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| pregnancy_category=
| StdInChIKey = CANCCLAKQQHLNK-UHFFFAOYSA-N
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
}} }}


'''Tolciclate''' is an ].<ref name="pmid3524433">{{cite journal |author=Ryder NS, Frank I, Dupont MC |title=Ergosterol biosynthesis inhibition by the thiocarbamate antifungal agents tolnaftate and tolciclate |journal=Antimicrob. Agents Chemother. |volume=29 |issue=5 |pages=858–60 |year=1986 |month=May |pmid=3524433 |pmc=284167 |doi= |url=http://aac.asm.org/cgi/pmidlookup?view=long&pmid=3524433}}</ref><ref name="pmid907333">{{cite journal |author=Bianchi A, Monti G, de Carneri I |title=Tolciclate: further antimycotic studies |journal=Antimicrob. Agents Chemother. |volume=12 |issue=3 |pages=429–30 |year=1977 |month=September |pmid=907333 |pmc=429931 |doi= |url=http://aac.asm.org/cgi/pmidlookup?view=long&pmid=907333}}</ref> '''Tolciclate''' (])<ref name="INN" />{{rp|9}} is an ] medication.<ref name="pmid3524433">{{cite journal | vauthors = Ryder NS, Frank I, Dupont MC | title = Ergosterol biosynthesis inhibition by the thiocarbamate antifungal agents tolnaftate and tolciclate | journal = Antimicrobial Agents and Chemotherapy | volume = 29 | issue = 5 | pages = 858–60 | date = May 1986 | pmid = 3524433 | pmc = 284167 | doi = 10.1128/aac.29.5.858 }}</ref><ref name="pmid907333">{{cite journal | vauthors = Bianchi A, Monti G, de Carneri I | title = Tolciclate: further antimycotic studies | journal = Antimicrobial Agents and Chemotherapy | volume = 12 | issue = 3 | pages = 429–30 | date = September 1977 | pmid = 907333 | pmc = 429931 | doi = 10.1128/aac.12.3.429 }}</ref>


==References== == See also ==
* ]

== References ==
{{reflist}} {{reflist}}




{{Antifungals}} {{Antifungals}}


] ]
]
]
]


{{antiinfective-drug-stub}}

{{dermatologic-drug-stub}} {{dermatologic-drug-stub}}