Revision as of 21:05, 25 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validati← Previous edit |
Latest revision as of 05:36, 5 January 2025 edit undoTheseVGF (talk | contribs)Extended confirmed users1,053 editsm Fixed lint error – bogus file options |
(45 intermediate revisions by 28 users not shown) |
Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 433356863 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 446718238 |
|
| Name = 2-Tolidine |
|
| Name = 2-Tolidine |
|
| Reference = <ref name="BGIA GESTIS">{{GESTIS|Name=ortho-Tolidin|ZVG=17950|CAS=119-93-7|Date=6.6.2008}}</ref> |
|
| Reference = <ref name="BGIA GESTIS">{{GESTIS|Name=ortho-Tolidin|ZVG=17950|CAS=119-93-7|Date=6.6.2008}}</ref> |
|
| ImageFile = 2-tolidine.svg |
|
| ImageFile = 2-tolidine.svg |
|
⚫ |
| ImageAlt = |
|
| ImageSize = 200px |
|
|
|
| PIN = 3,3′-Dimethyl--4,4′-diamine |
⚫ |
| ImageAlt = |
|
|
⚫ |
| OtherNames = ''o''-Tolidine; Orthotolidine; Diaminoditolyl; Diaminotolyl; Bianisidine; Tolidine blue; 3,3'-Dimethylbenzidine; 4,4'-Bi-''o''-] |
|
| IUPACName = 4-(4-Amino-3-methylphenyl)-2-methylaniline |
|
|
⚫ |
|Section1={{Chembox Identifiers |
⚫ |
| OtherNames = ''o''-Tolidine; Orthotolidine; Diaminoditolyl; Diaminotolyl; Bianisidine; Tolidine blue; 3,3'-Dimethylbenzidine; 4,4'-Bi-''o''-toluidine |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
⚫ |
| Section1 = {{Chembox Identifiers |
|
|
| CASNo = 119-93-7 |
|
| CASNo = 119-93-7 |
|
| PubChem = 8413 |
|
| ChEMBL = 85109 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 63HLO2IV6K |
|
|
| PubChem = 8413 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C14443 |
|
| KEGG = C14443 |
|
| SMILES = CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C)N |
|
| SMILES = CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C)N |
|
|
| InChI = 1/C14H16N2/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12/h3-8H,15-16H2,1-2H3 |
|
|
| InChIKey = NUIURNJTPRWVAP-UHFFFAOYAK |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C14H16N2/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12/h3-8H,15-16H2,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = NUIURNJTPRWVAP-UHFFFAOYSA-N |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 34320 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 8106 |
|
|
| EINECS = 204-358-0 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=14|H=16|N=2 |
|
| C=14 | H=16 | N=2 |
|
| Appearance = |
|
| Appearance = White to reddish crystals or powder |
|
| Density = 1.23 g/cm<sup>3</sup> |
|
| Density = 1.23 g/cm<sup>3</sup> |
|
| MeltingPtC = 129 |
|
| MeltingPtC = 129 |
|
| BoilingPtC = 300.5 |
|
| BoilingPtC = 300.5 |
|
| Solubility = 1.3 g/L}} |
|
| Solubility = 1.3 g/L}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = potential carcinogen |
|
| FlashPt = 244 °C |
|
| FlashPtC = 244 |
|
| Autoignition = |
|
| AutoignitionPtC = |
|
| RPhrases = {{R45}} {{R22}} {{R51/53}} |
|
| GHSPictograms = {{GHS07}}{{GHS08}}{{GHS09}} |
|
|
| GHSSignalWord = Danger |
|
| SPhrases = {{S53}} {{S45}} {{S61}} |
|
|
|
| HPhrases = {{H-phrases|302|350|411}} |
|
|
| PPhrases = {{P-phrases|201|202|264|270|273|281|301+312|308+313|330|391|405|501}} |
|
|
| IDLH = Ca |
|
|
| PEL = Handle with care |
|
|
| REL = Ca C 0.02 mg/m<sup>3</sup> |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''2-Tolidine''' ('''orthotolidine''', '''o-tolidine'''; not to be confused with ]) is an organic compound with the chemical formula (C<sub>6</sub>H<sub>4</sub>(CH<sub>3</sub>)NH<sub>2</sub>)<sub>2</sub>. Several isomers are known; the 3-tolidine derivative is also important commercially. It is a colorless compound although commercial samples are often colored. It is slightly soluble in water. It forms ] with acids, such as the ], which is commercially available. |
|
'''Tolidine''' is a group of ]ic ]s, the most prevalent of which is 2-tolidine (''o''-tolidine). |
|
|
|
|
|
|
|
2-Tolidine can be produced by many ] from a ] derivative derived from ].<ref>Noller, Carl R.: ''Textbook of Organic Chemistry'', Springer Verlag, 1960</ref> |
|
==Chemistry== |
|
|
|
:(CH<sub>3</sub>C<sub>6</sub>H<sub>4</sub>)<sub>2</sub>N<sub>2</sub>H<sub>2</sub> → (C<sub>6</sub>H<sub>3</sub>(CH<sub>3</sub>)NH<sub>2</sub>)<sub>2</sub> |
|
2-Tolidine is slightly soluble in water (1.3 g/L) and has a melting point of 129 °C. It readily forms ] with acids, such as the ] which is commercially available. 2-Tolidine can be produced by a ] from a hydrazine derivative.<ref>Noller, Carl R.: ''Textbook of Organic Chemistry'', Springer Verlag, 1960</ref> |
|
|
|
|
|
|
==Uses== |
|
==Uses== |
|
2-Tolidine is a commercially important ]s used mainly for dye production, but also for the production of certain ]rs. 2-Tolidine is an intermediate for the production of soluble ]s and insoluble pigments used particularly in the textile, leather and paper industries. |
|
2-Tolidine ] is used mainly for dye production.<ref name=Ullmann1>K. Hunger. W. Herbst "Pigments, Organic" in ''Ullmann's Encyclopedia of Industrial Chemistry'', Wiley-VCH, Weinheim, 2012. {{doi|10.1002/14356007.a20_371}}</ref> 2-Tolidine is an intermediate for the production of soluble ]s and insoluble pigments used particularly in the textile, leather and paper industries. |
|
|
], a derivative of o-tolidine]] |
|
|
|
|
|
It is also used for the production of certain ]s. |
⚫ |
2-Tolidine also widely used as a reagent or indicator in analytical, clinical and forensic chemistry, such as in the analytical determination of gold. |
|
|
|
] |
|
⚫ |
2-Tolidine was widely used as a reagent or indicator in analytical, clinical and forensic chemistry, such as in the analytical determination of gold, or determination of the ] level in ] water. |
|
|
|
|
|
==Safety== |
|
==Safety== |
|
2-Tolidine is toxic and possibly carcinogenic. It is listed as an ], meaning it is "possibly carcinogenic to humans". |
|
2-Tolidine is toxic and possibly ]ic. It is listed as an ], meaning it is "possibly carcinogenic to humans". Animal studies have shown that animals exposed to tolidine developed tumors in the liver, kidney, and mammary glands.<ref>{{cite web |url=https://www.cdc.gov/niosh/npg/npgd0618.html |title=CDC - NIOSH Pocket Guide to Chemical Hazards - o-Tolidine |website=www.cdc.gov}}</ref> |
|
|
{{clear|left}} |
|
|
|
|
|
==References== |
|
==References== |
|
<references/> |
|
<references/> |
|
|
{{Authority control}} |
|
|
|
|
] |
|
] |
|
|
|
|
] |
|
|
] |
|
|
] |
|