| Revision as of 01:15, 21 January 2011 editPashihiko (talk | contribs)Extended confirmed users3,559 editsNo edit summary← Previous edit |
Latest revision as of 15:25, 22 April 2023 edit undoVaccinationist (talk | contribs)Extended confirmed users4,733 editsNo edit summary |
| (31 intermediate revisions by 20 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| IUPAC_name = 7-(3-Aminopyrrolidin-1-yl)-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid |
|
|
|
| Watchedfields = changed |
|
| image = tosufloxacin.png |
|
|
|
| verifiedrevid = 409083557 |
| ⚫ |
| CAS_number = 100490-36-6 |
|
|
|
| image = Tosufloxacin structure.svg |
| ⚫ |
| ATC_prefix = none |
|
|
|
|
| ⚫ |
| ATC_suffix = |
|
|
|
<!--Clinical data--> |
| ⚫ |
| PubChem = 5517 |
|
|
| DrugBank = |
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|international|tosufloxacin}} |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| routes_of_administration = |
|
⚫ |
| ATC_prefix = J01 |
|
⚫ |
| ATC_suffix = MA22 |
|
|
| ATC_supplemental = {{ATC|S01|AE09}} |
|
|
|
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 100490-36-6 |
|
⚫ |
| PubChem = 5517 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = GHJ553KQPS |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D02317 |
|
| KEGG = D02317 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| C=19|H=15|F=3|N=4|O=3 |
|
|
|
| ChEBI = 77573 |
|
| molecular_weight = 404.34 g/mol |
|
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| bioavailability = |
|
|
|
| ChEMBL = 273348 |
| ⚫ |
| protein_bound = |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| metabolism = |
|
|
|
| ChemSpiderID = 5316 |
| ⚫ |
| elimination_half-life = |
|
|
|
|
| ⚫ |
| excretion = |
|
|
|
<!--Chemical data--> |
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
⚫ |
| IUPAC_name = 7-(3-Aminopyrrolidin-1-yl)-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
⚫ |
| C=19 | H=15 | F=3 | N=4 | O=3 |
| ⚫ |
| pregnancy_category= |
|
|
|
| smiles = NC1CCN(C1)c1nc2n(cc(C(O)=O)c(=O)c2cc1F)-c1ccc(F)cc1F |
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
|
| StdInChI =1S/C19H15F3N4O3/c20-9-1-2-15(13(21)5-9)26-8-12(19(28)29)16(27)11-6-14(22)18(24-17(11)26)25-4-3-10(23)7-25/h1-2,5-6,8,10H,3-4,7,23H2,(H,28,29) |
| ⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
|
| StdInChIKey = WUWFMDMBOJLQIV-UHFFFAOYSA-N |
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''Tosufloxacin''' is a ] ]. It has a controversial safety profile in relation to other fluoroquinolones. It is associated with severe thrombocytopenia and nephritis, and hepatotoxicity.<ref>{{Cite journal | last1 = Rubinstein | first1 = E. | title = History of quinolones and their side effects. | journal = Chemotherapy | volume = 47 Suppl 3 | issue = | pages = 3–8; discussion 44–8 | month = | year = 2001 | doi = | PMID = 11549783 }}</ref> It is sold in ] under the brand name '''Ozex'''. |
|
'''Tosufloxacin''' is a ] ]. It has a controversial safety profile in relation to other fluoroquinolones. It is associated with severe thrombocytopenia and nephritis, and hepatotoxicity.<ref>{{cite journal | vauthors = Rubinstein E | title = History of quinolones and their side effects | journal = Chemotherapy | volume = 47 Suppl 3 | issue = 3| pages = 3–8; discussion 44–8 | year = 2001 | pmid = 11549783 | doi = 10.1159/000057838 | s2cid = 21890070 }}</ref> It is sold in ] under the brand name '''Ozex'''. |
|
|
|
|
|
==See also== |
|
== References == |
|
*] |
|
|
*] |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
|
|
{{QuinoloneAntiBiotics}} |
|
{{QuinoloneAntiBiotics}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{antibiotic-stub}} |
|
{{antibiotic-stub}} |
|
|
|
|
] |
|
|
] |
|