| Revision as of 13:46, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 465842011 of page Toxoflavin for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 14:38, 28 February 2024 edit Maxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,052 edits Altered journal. Added series. | Use this tool. Report bugs. | #UCB_Gadget |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 459508337 |
|
| verifiedrevid = 470612035 |
|
| Reference = <ref name=Merck>'']'', 11th Edition, '''9480'''</ref><ref>, at the ]</ref> |
|
| Reference = <ref name=Merck>'']'', 11th Edition, '''9480'''</ref><ref>, at the ]</ref> |
|
| ImageFile = Toxoflavin.png |
|
| ImageFile = Toxoflavin.png |
| Line 9: |
Line 8: |
|
| IUPACName = 1,6-Dimethylpyrimidotriazine-5,7(1''H'',6''H'')-dione |
|
| IUPACName = 1,6-Dimethylpyrimidotriazine-5,7(1''H'',6''H'')-dione |
|
| OtherNames = Toxoflavine; Xanthothricin; Xanthotricin |
|
| OtherNames = Toxoflavine; Xanthothricin; Xanthotricin |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 84-82-2 --> |
|
| CASNo = 84-82-2 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 5N5YI4IP1P |
|
|
| ChEBI = 80729 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 578512 |
|
| ChEMBL = 578512 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 19: |
Line 21: |
|
| StdInChIKey = SLGRAIAQIAUZAQ-UHFFFAOYSA-N |
|
| StdInChIKey = SLGRAIAQIAUZAQ-UHFFFAOYSA-N |
|
| PubChem = 66541 |
|
| PubChem = 66541 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 59912 |
|
| ChemSpiderID = 59912 |
|
| SMILES = O=C2\N=C1C(=N/C=N\N1C)\C(=O)N2C |
|
| SMILES = O=C2\N=C1C(=N/C=N\N1C)\C(=O)N2C |
|
| InChI = InChI=1S/C7H7N5O2/c1-11-6(13)4-5(10-7(11)14)12(2)9-3-8-4/h3H,1-2H3 |
|
| InChI = 1S/C7H7N5O2/c1-11-6(13)4-5(10-7(11)14)12(2)9-3-8-4/h3H,1-2H3 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=7|H=7|N=5|O=2 |
|
| C=7 | H=7 | N=5 | O=2 |
|
| Appearance = Bright yellow solid |
|
| Appearance = Bright yellow solid |
|
| Density = |
|
| Density = |
|
|
| MeltingPtC = 172 to 173 |
|
| MeltingPt = 172–173 °C (dec.) |
|
|
|
| MeltingPt_notes = (decomposes) |
|
| BoilingPt = |
|
|
| Solubility = |
|
| BoilingPt = |
|
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| LD50 = 1.7 mg/kg (], mouse)<br>8.4 mg/kd (], mouse) |
|
| LD50 = 1.7 mg/kg (], mouse)<br/>8.4 mg/kg (], mouse) |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Toxoflavin''' is a ] produced by a variety of bacteria including '']''. It also has antibiotic properties.<ref>{{cite journal | title = Xanthothricin, a new antibiotic |author1=Machlowitz, Roy A. |author2=Fisher, W. P. |author3=McKay, Betsey S. |author4=Tytell, Alfred A. |author5=Charney, Jesse |journal=Antibiotics & Chemotherapy (Northfield, Ill.) | series = ] | year = 1954 | volume = 4 |issue=3 | pages = 259–261|pmid=24542943 }}</ref> |
|
|
|
|
|
Toxoflavin acts as a ], changing between yellow and colorless at pH 10.5.<ref name=Merck/> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{heterocyclic-stub}} |
|
|
|
|
|
] |