| Revision as of 15:55, 30 July 2010 editPotatoBot (talk | contribs)Bots51,239 editsm Stub sorting and placement of stub template(s): antineoplastic-drug-stub← Previous edit |
Latest revision as of 10:58, 14 November 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Aziridines; added Category:1-Aziridinyl compounds using HotCat |
| (34 intermediate revisions by 23 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 266253659 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| IUPAC_name = 2,4,6-Tris(aziridin-1-yl)-1,3,5-triazine |
|
|
⚫ |
| verifiedrevid = 376279379 |
| ⚫ |
| width = 150 |
|
|
⚫ |
| IUPAC_name = 2,4,6-Tris(aziridin-1-yl)-1,3,5-triazine |
|
| image = Triethylenemelamine.png |
|
| image = Triethylenemelamine.png |
|
| CASNo_Ref = {{cascite}} |
|
|
⚫ |
| width = 150 |
| ⚫ |
| CAS_number = 51-18-3 |
|
|
|
<!--Clinical data--> |
| ⚫ |
| ATC_prefix = |
|
|
| ATC_suffix = |
|
| tradename = |
|
| PubChem = 5799 |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| DrugBank = |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
| ⚫ |
| C=9|H=12|N=6 |
|
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| molecular_weight = 204.23 g/mol |
|
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
| ⚫ |
| bioavailability = |
|
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
| ⚫ |
| protein_bound = |
|
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
| ⚫ |
| metabolism = |
|
|
|
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
<!--Identifiers--> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
⚫ |
| CAS_number = 51-18-3 |
| ⚫ |
| pregnancy_category= |
|
|
⚫ |
| ATC_prefix = None |
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
|
| ATC_suffix = |
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
|
| PubChem = 5799 |
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
| DrugBank = |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
| ⚫ |
| routes_of_administration = |
|
|
|
| UNII = F7IY6HZG9D |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = C07642 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 502384 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 5594 |
|
|
<!--Chemical data--> |
|
⚫ |
| C=9 | H=12 | N=6 |
|
|
| smiles = C1CN1c2nc(nc(n2)N3CC3)N4CC4 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI=1S/C9H12N6/c1-2-13(1)7-10-8(14-3-4-14)12-9(11-7)15-5-6-15/h1-6H2 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = IUCJMVBFZDHPDX-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
|
'''Triethylenemelamine''' (abbreviated '''TEM''', also called '''Tretamine''') is a drug used in ].<ref>{{cite journal | vauthors = Wong JR, Morton LM, Tucker MA, Abramson DH, Seddon JM, Sampson JN, Kleinerman RA | title = Risk of subsequent malignant neoplasms in long-term hereditary retinoblastoma survivors after chemotherapy and radiotherapy | journal = Journal of Clinical Oncology | volume = 32 | issue = 29 | pages = 3284–3290 | date = October 2014 | pmid = 25185089 | pmc = 4178525 | doi = 10.1200/JCO.2013.54.7844 }}</ref> |
|
'''Triethylenemelamine''' is a drug used in ]. |
|
|
|
|
|
|
It can cause chromatid aberrations.<ref name="pmid565312">{{cite journal |author=Luippold HE, Gooch PC, Brewen JG |title=The production of chromosome aberrations in various mammalian cells by triethylenemelamine |journal=Genetics |volume=88 |issue=2 |pages=317–26 |year=1978 |month=February |pmid=565312 |pmc=1213803 |doi= |url=http://www.genetics.org/cgi/pmidlookup?view=long&pmid=565312}}</ref> |
|
It can cause ] aberrations in cell models.<ref name="pmid565312">{{cite journal | vauthors = Luippold HE, Gooch PC, Brewen JG | title = The production of chromosome aberrations in various mammalian cells by triethylenemelamine | journal = Genetics | volume = 88 | issue = 2 | pages = 317–326 | date = February 1978 | pmid = 565312 | pmc = 1213803 | doi = 10.1093/genetics/88.2.317 }}</ref> |
|
|
|
|
|
==See also== |
|
== See also == |
|
* ] |
|
* ] |
|
|
* ] |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
|
|
{{Chemotherapeutic agents}} |
|
{{Chemotherapeutic agents}} |
|
|
|
|
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{antineoplastic-drug-stub}} |
|
{{antineoplastic-drug-stub}} |