| Revision as of 14:19, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 454809664 of page Trional for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 07:06, 15 November 2023 edit 32.209.69.132 (talk) →History |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
{{Infobox drug |
|
{{Drugbox |
|
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 447628315 |
|
| verifiedrevid = 470616274 |
|
| IUPAC_name = 2,2-bis(ethylsulfonyl)butane |
|
| IUPAC_name = 2,2-bis(ethylsulfonyl)butane |
|
| image = Trional_structure.png |
|
| image = Trional.svg |
|
| width = 180 |
|
| width = 180 |
|
|
| image2 = Trional ball-and-stick.png |
|
|
| width2 = 180 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
| Line 11: |
Line 14: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 76-20-0 --> |
|
| CAS_number = 76-20-0 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| Line 25: |
Line 29: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=8 | H=18 | O=4 | S=2 |
|
| C=8 | H=18 | O=4 | S=2 |
|
| molecular_weight = 242.356 g/mol |
|
|
| smiles = CCC(C)(S(=O)(=O)CC)S(=O)(=O)CC |
|
| smiles = CCC(C)(S(=O)(=O)CC)S(=O)(=O)CC |
|
}} |
|
}} |
|
|
|
|
|
'''Trional''' ('''Methylsulfonal''') is a ]<ref>{{cite book | date = 1907 | chapter-url = https://archive.org/stream/cu31924003469677#page/n465/mode/2up/ | chapter = Trional | title = Merck's 1907 Index | location = New York | publisher = Merck & Co. | page = 448 }}</ref> and ] ] with ] ]s{{Citation needed|date=November 2010}}. It has similar effects to ], except it is faster acting.<ref>{{cite journal | vauthors = Sajous CE | date = 1896 | title = General Therapeutics | url = https://archive.org/stream/1896annualofuniv05philuoft/#page/n169/mode/2up | journal = Annual of the Universal Medical Sciences | location = Philadelphia | publisher = F. A. Davis | volume = 5 | pages = A-156 }}</ref> |
|
|
|
|
|
==History== |
|
|
Trional was prepared and introduced by ] and ] in 1888.<ref>{{cite book | vauthors = Drinkwater H | date = 1924 | url = https://archive.org/stream/fiftyyearsofmedi00drin#page/40/mode/2up | title = Fifty years of medical progress, 1873-1922 | location = New York | publisher = The Macmillan Company | page = 40 }}</ref> |
|
|
|
|
|
== Cultural references == |
|
|
|
|
|
Appeared in Agatha Christie's '']'', '']'', and other novels such as John Bude's '']'' as a sleep-inducing sedative; and in '']'' (Sodom and Gomorrah) by ] as a ]. ] also references trional in his novel '']''. |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{Hypnotics}} |
|
|
{{General anesthetics}} |
|
|
{{GABAAR PAMs}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{sedative-stub}} |