| Revision as of 22:19, 30 July 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 17:19, 18 June 2024 edit undoJJMC89 bot III (talk | contribs)Bots, Administrators3,687,711 editsm Moving Category:Dimerization (chemistry) to Category:Dimers (chemistry) per Misplaced Pages:Categories for discussion/SpeedyTag: Manual revert |
| (15 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
| verifiedrevid = 441102222 |
|
|verifiedrevid = 442266594 |
|
| ImageFile = Tris(dimethylamino)aluminium dimer.png |
|
|ImageFile = Tris(dimethylamino)aluminium dimer.png |
|
|
|IUPACName = <em>N</em>--<em>N</em>-methylmethanamine |
|
| ImageSize = |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
| ImageAlt = |
|
|
|
|CASNo_Ref = {{cascite|correct|??}} |
|
| IUPACName = |
|
|
|
|CASNo = 32093-39-3 |
|
| OtherNames = |
|
|
|
|ChemSpiderID = 21170557 |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
| CASNo = 32093-39-3 |
|
|EC_number = 626-275-2 |
|
|
|DTXSID = DTXSID60586931 |
| ⚫ |
| PubChem = |
|
|
|
|InChI = InChI=1S/6C2H6N.2Al/c6*1-3-2;;/h6*1-2H3;;/q6*-1;2*+3 |
|
| SMILES = }} |
|
|
|
|InChIKey = JGZUJELGSMSOID-UHFFFAOYSA-N |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
⚫ |
|PubChem = 16688802 |
| ⚫ |
| C = 12 | H = 36 | Al = 2 | N = 6 |
|
|
|
|SMILES = CN(C)(N(C)C)N(C)C.CN(C)(N(C)C)N(C)C}} |
|
| MolarMass = |
|
|
⚫ |
|Section2={{Chembox Properties |
| ⚫ |
| Appearance = Colorless solid |
|
|
⚫ |
|C=12 | H=36 | Al=2 | N=6 |
|
| Density = |
|
|
⚫ |
|Appearance = Colorless solid |
|
| MeltingPt = |
|
|
|
|Density = 0.865 g/cm<sup>3</sup> |
|
| BoilingPt = |
|
|
|
|MeltingPt = 82-84 °C |
|
| Solubility = }} |
|
|
|
|BoilingPt = 90 °C |
| ⚫ |
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| Autoignition = }} |
|
|
}} |
|
}} |
|
⚫ |
|Section3={{Chembox Hazards |
| ⚫ |
'''Tris(dimethylamino)aluminium dimer''', formally bis(μ-dimethylamino)tetrakis(dimethylamino)dialuminium, is an ] of ]. This compound may be used as a precursor to other aluminium complexes. |
|
|
|
|Hazards_ref =<ref>{{cite web|title =Tris(dimethylamido)aluminum(III)|url=https://www.americanelements.com/tris-dimethylamido-aluminum-iii-32093-39-3|publisher = ]|accessdate = August 21, 2019}}</ref> |
|
|
|GHSPictograms = {{GHS02}}{{GHS05}} |
|
|
|GHSSignalWord = Danger |
|
|
|HPhrases = {{H-phrases|260|314}} |
|
|
|PPhrases = {{P-phrases|223|231+232|260|264|280|301+330+331|303+361+353|304+340|305+351+338|310|321|335+334|363|370+378|402+404|405|501}} |
|
|
|MainHazards = Flammable, Corrosive |
|
|
|FlashPt = 21.1 °C}} |
|
|
}} |
|
⚫ |
'''Tris(dimethylamino)aluminium dimer''', formally bis(μ-dimethylamino)tetrakis(dimethylamino)dialuminium, is an ] of ]. This compound may be used as a precursor to other aluminium complexes. |
|
|
|
|
|
Commercially available, this compound may be prepared from lithium dimethylamide and ].<ref> {{Cite journal | doi = 10.1016/S0277-5387(00)80578-1 | title = Structural and spectroscopic characterization of the compounds 2, 2, 2 (1-Ad = 1-adamantanyl) and | year = 1990 | last1 = Waggoner | first1 = K.M. | last2 = Olmstead | first2 = M.M. | last3 = Power | first3 = P.P. | journal = Polyhedron | volume = 9 | issue = 2–3 | pages = 257–263}}</ref> |
|
Commercially available, this compound may be prepared from lithium dimethylamide and ].<ref>{{Cite journal | doi = 10.1016/S0277-5387(00)80578-1 | title = Structural and spectroscopic characterization of the compounds 2, 2, 2 (1-Ad = 1-adamantanyl) and | year = 1990 | last1 = Waggoner | first1 = K.M. | last2 = Olmstead | first2 = M.M. | last3 = Power | first3 = P.P. | journal = Polyhedron | volume = 9 | issue = 2–3 | pages = 257–263}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
|
{{Reflist}} |
|
<references/> |
|
|
|
{{organic-chem-stub}} |
|
|
|
|
⚫ |
] |
|
|
|
| ⚫ |
] |
|
|
] |
|
] |
|
|
] |