| Revision as of 02:20, 21 January 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to verified fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation|Chem/Drugbox valid← Previous edit |
Latest revision as of 18:37, 24 April 2024 edit undoCitation bot (talk | contribs)Bots5,429,560 edits Removed parameters. | Use this bot. Report bugs. | Suggested by AManWithNoPlan | #UCB_toolbarTag: Manual revert |
| (28 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 364830480 |
|
| verifiedrevid = 409092026 |
|
| IUPAC_name = (''Z'')-7-hept-5-enoic acid |
|
| IUPAC_name = (''Z'')-7-hept-5-enoic acid |
|
| image = Unoprostone.svg |
|
| image = Unoprostone.svg |
| ⚫ |
| CAS_number = 120373-36-6 |
|
|
|
|
| ⚫ |
| CAS_supplemental = {{CAS|120373-24-2}} (]) |
|
|
|
<!--Clinical data--> |
| ⚫ |
| ATC_prefix = S01 |
|
|
|
| tradename = Rescula |
| ⚫ |
| ATC_suffix = EE02 |
|
|
|
| Drugs.com = {{drugs.com|CONS|unoprostone}} |
| ⚫ |
| PubChem = 5311236 |
|
|
| DrugBank = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = C |
| ⚫ |
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
⚫ |
| pregnancy_category = |
| ⚫ |
| KEGG = D08661 |
|
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
| ⚫ |
| C=22|H=38|O=5 |
|
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| molecular_weight = 382.534 g/mol |
|
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
| ⚫ |
| bioavailability = |
|
|
|
| legal_US = Discontinued |
| ⚫ |
| protein_bound = |
|
|
| metabolism = |
|
| legal_status = |
| ⚫ |
| elimination_half-life = |
|
|
| excretion = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| ⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
|
| routes_of_administration = Topical (]s) |
|
| routes_of_administration = Topical (]s) |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
|
| metabolism = |
|
⚫ |
| elimination_half-life = 14 min |
|
|
| excretion = ] |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 120373-36-6 |
|
⚫ |
| CAS_supplemental = {{CAS|120373-24-2}} (] ester) |
|
⚫ |
| ATC_prefix = S01 |
|
⚫ |
| ATC_suffix = EE02 |
|
⚫ |
| PubChem = 5311236 |
|
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|
| DrugBank = DB06826 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 6X4F561V3W |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = D08661 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1201407 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4470755 |
|
|
<!--Chemical data--> |
|
⚫ |
| C=22 | H=38 | O=5 |
|
|
| smiles = O=C(O)CCC/C=C\C1(O)C(O)1CCC(=O)CCCCCCC |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C22H38O5/c1-2-3-4-5-8-11-17(23)14-15-19-18(20(24)16-21(19)25)12-9-6-7-10-13-22(26)27/h6,9,18-21,24-25H,2-5,7-8,10-16H2,1H3,(H,26,27)/b9-6-/t18-,19-,20+,21-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = TVHAZVBUYQMHBC-SNHXEXRGSA-N |
|
}} |
|
}} |
|
'''Unoprostone''' (]) is a ]. Its ] ], '''unoprostone isopropyl''', is marketed under the trade name '''Rescula''' (eyedrops, 0.15%) for the management of ] and ]. |
|
|
|
|
|
|
|
'''Unoprostone''' (]) is a ]. Its ] ], '''unoprostone isopropyl''', was marketed under the trade name '''Rescula''' for the management of ] and ].<ref>{{drugs.com|CONS|unoprostone}}</ref><ref name="pmid24648719">{{cite journal | vauthors = Fung DS, Whitson JT | title = An evidence-based review of unoprostone isopropyl ophthalmic solution 0.15% for glaucoma: place in therapy | journal = Clinical Ophthalmology | location = Auckland, N.Z. | volume = 8 | issue = | pages = 543–54 | date = 2014 | pmid = 24648719 | pmc = 3958522 | doi = 10.2147/OPTH.S41562 | doi-access = free }}</ref> |
| ⚫ |
==References== |
|
|
* |
|
|
|
|
|
|
|
It was approved by the ] in 2000.<ref>{{cite news | url= https://www.accessdata.fda.gov/drugsatfda_docs/nda/2000/21214_Rescula.cfm | title=Drug Approval Package | publisher=]}}</ref> |
|
|
|
|
|
In 2009, ] acquired the rights to the drug in the U.S. and Canada.<ref>{{cite press release | url=https://www.biospace.com/article/releases/sucampo-pharmaceuticals-inc-acquires-rights-to-rescula-for-u-s-and-canada-/ | title=Sucampo Pharmaceuticals, Inc. Acquires Rights to Rescula for U.S. and Canada | publisher=] | date=April 24, 2009}}</ref> |
|
|
|
|
|
In 2015, the drug was discontinued in the U.S.{{cn|date=March 2022}} |
|
|
|
|
⚫ |
==References== |
|
|
{{Reflist|1}} |
|
|
|
|
| ⚫ |
{{pharmacology-stub}} |
|
|
{{Antiglaucoma preparations and miotics}} |
|
{{Antiglaucoma preparations and miotics}} |
|
{{Prostaglandins}} |
|
{{Prostaglandins}} |
|
|
{{Prostanoidergics}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
|
⚫ |
{{pharmacology-stub}} |
|
] |
|
|
] |
|