| Revision as of 21:23, 20 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chem← Previous edit |
Latest revision as of 13:10, 19 August 2022 edit undoFswitzer4 (talk | contribs)Extended confirmed users10,990 editsm Added UNII |
| (32 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 445882959 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 445884377 |
|
| Name = Valoneic acid |
|
| Name = Valoneic acid |
|
| ImageFile = Valoneic acid.png |
|
| ImageFile = Valoneic acid.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| ImageName = Chemical structure of valoneic acid |
|
| ImageName = Chemical structure of valoneic acid |
|
| ImageAlt = Chemical structure of valoneic acid |
|
| ImageAlt = Chemical structure of valoneic acid |
|
| IUPACName = |
|
| IUPACName = |
|
| OtherNames = <!-- <br> --> |
|
| OtherNames = Valoneaic acid<!-- <br> --> |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = |
|
|
| CASNo_Ref = |
|
| CASNo = 517-54-4 |
|
| CASOther = |
|
| CASNoOther = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = |
|
|
|
| UNII = G4WG3M7WNB |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
| PubChem = 12444662 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 26233367 |
|
| ChemSpiderID = 26233367 |
|
| SMILES = c1c(c(cc(c1O)O)C(=O)O)c2cc(c(cc2C(=O)O)Oc3c(cc(c(c3O)O)O)C(=O)O)O |
|
| SMILES = c1c(c(cc(c1O)O)C(=O)O)c2cc(c(cc2C(=O)O)Oc3c(cc(c(c3O)O)O)C(=O)O)O |
|
| InChI = 1/C21H14O13/c22-11-1-6(8(19(28)29)3-12(11)23)7-2-13(24)15(5-9(7)20(30)31)34-18-10(21(32)33)4-14(25)16(26)17(18)27/h1-5,22-27H,(H,28,29)(H,30,31)(H,32,33) |
|
| InChI = 1/C21H14O13/c22-11-1-6(8(19(28)29)3-12(11)23)7-2-13(24)15(5-9(7)20(30)31)34-18-10(21(32)33)4-14(25)16(26)17(18)27/h1-5,22-27H,(H,28,29)(H,30,31)(H,32,33) |
|
| InChIKey = YIWUPYVTWJLBDH-UHFFFAOYAX |
|
| InChIKey = YIWUPYVTWJLBDH-UHFFFAOYAX |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C21H14O13/c22-11-1-6(8(19(28)29)3-12(11)23)7-2-13(24)15(5-9(7)20(30)31)34-18-10(21(32)33)4-14(25)16(26)17(18)27/h1-5,22-27H,(H,28,29)(H,30,31)(H,32,33) |
|
| StdInChI = 1S/C21H14O13/c22-11-1-6(8(19(28)29)3-12(11)23)7-2-13(24)15(5-9(7)20(30)31)34-18-10(21(32)33)4-14(25)16(26)17(18)27/h1-5,22-27H,(H,28,29)(H,30,31)(H,32,33) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = YIWUPYVTWJLBDH-UHFFFAOYSA-N |
|
| StdInChIKey = YIWUPYVTWJLBDH-UHFFFAOYSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>21</sub>H<sub>14</sub>O<sub>13</sub> |
|
| Formula = C<sub>21</sub>H<sub>14</sub>O<sub>13</sub>; C<sub>21</sub>H<sub>14</sub>O<sub>15</sub> |
|
| MolarMass = 474.32 g/mol |
|
| MolarMass = 474.32 g/mol, 506.32 g/mol |
|
| ExactMass = 474.043440 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
|
|
|
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. --> |
|
|
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. --> |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Valoneic acid''' is a ]. It can be chemically synthetised.<ref> |
|
'''Valoneic acid''' is a ]. It is a component of some hydrolysable tannins such as ]. |
| ⚫ |
Enantioselective synthesis of valoneic acid derivative. Hitoshi Abe, Yusuke Sahara, Yuki Matsuzaki, Yasuo Takeuchi and Takashi Harayama, Tetrahedron Letters, Volume 49, Issue 4, 21 January 2008, pp. 605-609, {{doi|10.1016/j.tetlet.2007.11.154}}</ref> |
|
|
|
|
|
|
|
The difference with its isomer ] is that the hydroxyl that links the ] (HHDP) group to the ] group belongs to the HHDP group. |
| ⚫ |
==References== |
|
|
|
] |
| ⚫ |
{{reflist}} |
|
|
|
|
|
|
⚫ |
It can be chemically synthesized.<ref>Enantioselective synthesis of valoneic acid derivative. Hitoshi Abe, Yusuke Sahara, Yuki Matsuzaki, Yasuo Takeuchi and Takashi Harayama, Tetrahedron Letters, Volume 49, Issue 4, 21 January 2008, pp. 605-609, {{doi|10.1016/j.tetlet.2007.11.154}}</ref> |
| ⚫ |
==See also== |
|
|
|
|
| ⚫ |
* ] |
|
|
⚫ |
== See also == |
|
|
* ] |
|
* ] (''Quercus macrolepis'') |
|
* ] (''Quercus macrolepis'') |
|
⚫ |
* ] |
|
|
|
|
|
|
|
{{Hydrolysable tannin}} |
|
|
⚫ |
== References == |
|
⚫ |
{{reflist}} |
|
|
|
|
|
== External links == |
|
|
* by ] |
|
|
|
|
|
{{ellagitannin}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
⚫ |
] |
|
|
|
|
| ⚫ |
] |
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{aromatic-stub}} |