| Revision as of 00:55, 4 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 20:04, 3 October 2022 edit undoMandarax (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers, Rollbackers388,559 editsm Correct spelling, as in target articleTag: AWB |
| (26 intermediate revisions by 14 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 441145782 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 442936423 |
|
| Name = Valoneic acid dilactone |
|
| Name = Valoneic acid dilactone |
|
| ImageFile = Valoneic acid dilactone.png |
|
| ImageFile = Valoneic acid dilactone.svg |
|
| ImageSize = 200px |
|
| ImageSize = 250px |
|
| ImageName = Chemical structure of valoneic acid dilactone |
|
| ImageName = Chemical structure of valoneic acid dilactone |
|
| ImageAlt = Chemical structure of valoneic acid dilactone |
|
| ImageAlt = Chemical structure of valoneic acid dilactone |
|
|
| PIN = 3,4,5-Trihydroxy-2-benzopyranobenzopyran-2-yl)oxy]benzoate |
|
| IUPACName = |
|
|
| OtherNames = Valoneic acid bislactone<!-- <br> --> |
|
| OtherNames = Valoneic acid bislactone<br>Valoneic acid bilactone |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 60202-70-2 |
|
| CASNo = 60202-70-2 |
|
| CASNo_Ref = |
|
| CASNoOther = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| CASOther = |
|
|
| PubChem = |
|
| UNII = UH5C3DT5LR |
|
| SMILES = Oc1cc5c(=O)oc3c(O)c(Oc4c(C(=O)O)cc(O)c(O)c4O)cc2c3c5c(c1O)oc2=O |
|
| SMILES = Oc1cc5c(=O)oc3c(O)c(Oc4c(C(=O)O)cc(O)c(O)c4O)cc2c3c5c(c1O)oc2=O |
|
| InChI = |
|
| PubChem = 10151874 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 8327382 |
|
|
| InChI = 1/C21H10O13/c22-7-2-6(19(28)29)16(15(27)12(7)24)32-9-3-5-11-10-4(20(30)34-18(11)14(9)26)1-8(23)13(25)17(10)33-21(5)31/h1-3,22-27H,(H,28,29) |
|
|
| InChIKey = BPAOAXAAABIQKR-UHFFFAOYAM |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C21H10O13/c22-7-2-6(19(28)29)16(15(27)12(7)24)32-9-3-5-11-10-4(20(30)34-18(11)14(9)26)1-8(23)13(25)17(10)33-21(5)31/h1-3,22-27H,(H,28,29) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = BPAOAXAAABIQKR-UHFFFAOYSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>21</sub>H<sub>10</sub>O<sub>13</sub> |
|
| Formula = C<sub>21</sub>H<sub>10</sub>O<sub>13</sub> |
|
| MolarMass = 470.28 g/mol |
|
| MolarMass = 470.28 g/mol |
|
| ExactMass = 470.012139 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
|
| GHS_ref =<!-- no GHS data in PubChem Dec2021 --> |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. --> |
|
|
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. --> |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
'''Valoneic acid dilactone''' is a ] that can be isolated from the heartwood of '']''.<ref>5A-Reductase inhibitory tannin-related compounds isolated from Shorea laeviforia. Yoshio Hirano, Ryuichiro Kondo and Kokki Sakai, Journal of wood science, Volume 49, Number 4, pp.339-343,{{doi|10.1007/s10086-002-0481-y}}</ref> |
|
'''Valoneic acid dilactone''' is a ] that can be isolated from the heartwood of '']''<ref name=Hirano>5A-Reductase inhibitory tannin-related compounds isolated from Shorea laevifolia. Yoshio Hirano, Ryuichiro Kondo and Kokki Sakai, Journal of wood science, Volume 49, Number 4, pp.339-343,{{doi|10.1007/s10086-002-0481-y}}</ref> and in oaks species like the North American white oak ('']'') and European red oak ('']'').<ref>Analysis of oak tannins by liquid chromatography-electrospray ionisation mass spectrometry. Pirjo Mämmelä, Heikki Savolainenb, Lasse Lindroosa, Juhani Kangasd and Terttu Vartiainen, Journal of Chromatography A, Volume 891, Issue 1, 1 September 2000, Pages 75-83, {{doi|10.1016/S0021-9673(00)00624-5}}</ref> |
|
|
|
|
|
It shows an ],<ref name=Hirano/> an enzyme involved in steroids metabolism and prostate cancer. |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{Reflist|2}} |
|
|
|
|
|
==External links== |
|
|
* {{Phenol-Explorer|440}} |
|
|
|
|
|
{{Ellagitannin}} |
|
|
|
|
|
|
] |
|
{{Hydrolysable tannin}} |
|
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{aromatic-stub}} |