| Revision as of 15:53, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 465417270 of page Veratraldehyde for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 19:38, 27 October 2022 edit Citation bot (talk | contribs)Bots5,458,205 edits Misc citation tidying. | Use this bot. Report bugs. | Suggested by AManWithNoPlan | #UCB_CommandLine |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 444244394 |
|
| verifiedrevid = 470629641 |
|
| ImageFile = Veratrumaldehyd.svg |
|
| ImageFile = Veratrumaldehyd.svg |
|
| ImageSize = 150px |
|
| ImageSize = 150px |
|
| IUPACName = 3,4-Dimethoxybenzaldehyde |
|
| PIN= 3,4-Dimethoxybenzaldehyde |
|
|
| SystematicName = 3,4-Dimethoxybenzenecarbaldehyde |
|
| OtherNames = Methylvanillin; Veratric aldehyde; Veratral; Veratryl aldehyde; Veratrum aldehyde; Vanillin methyl ether |
|
| OtherNames = Methylvanillin; Veratric aldehyde; Veratral; Veratryl aldehyde; Veratrum aldehyde; Vanillin methyl ether |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = UI88P68JZD |
|
| UNII = UI88P68JZD |
|
| InChI = 1S/C9H10O3/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-6H,1-2H3 |
|
| InChI = 1S/C9H10O3/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-6H,1-2H3 |
| Line 15: |
Line 15: |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 120-14-9 |
|
| CASNo = 120-14-9 |
|
| PubChem = 8419 |
|
| PubChem = 8419 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 21106008 |
|
| ChemSpiderID = 21106008 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 17098 |
|
| ChEBI = 17098 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = WJUFSDZVCOTFON-UHFFFAOYSA-N |
|
| StdInChIKey = WJUFSDZVCOTFON-UHFFFAOYSA-N |
|
| SMILES = COc1cc(ccc1OC)C=O |
|
| SMILES = COc1cc(ccc1OC)C=O |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 1088937 |
|
| ChEMBL = 1088937 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChI = 1S/C9H10O3/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-6H,1-2H3 |
|
| StdInChI = StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
⚫ |
}} |
| ⚫ |
| StdInChI=1S/C9H10O3/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-6H,1-2H3 |
|
|
⚫ |
|Section2={{Chembox Properties |
| ⚫ |
}} |
|
|
⚫ |
| C=9 | H=10 | O=3 |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
⚫ |
| Appearance = Peach coloured crystals |
| ⚫ |
| C=9|H=10|O=3 |
|
|
|
| Density = 1.114 g/mL |
| ⚫ |
| Appearance = Peach coloured crystals |
|
|
| Density = |
|
| MeltingPtC = 40 to 43 |
|
⚫ |
| BoilingPtC = 281 |
|
| MeltingPt = 40–43 °C |
|
|
⚫ |
| Solubility = organic solvents |
| ⚫ |
| BoilingPtC = 281 |
|
|
⚫ |
}} |
| ⚫ |
| Solubility = |
|
|
⚫ |
|Section3={{Chembox Hazards |
| ⚫ |
}} |
|
|
⚫ |
| MainHazards = Harmful |
| ⚫ |
| Section3 = {{Chembox Hazards |
|
|
|
| FlashPt = |
| ⚫ |
| MainHazards = Xn Harmful |
|
|
| FlashPt = |
|
| AutoignitionPt = |
|
⚫ |
}} |
|
| Autoignition = |
|
| ⚫ |
}} |
|
|
}} |
|
}} |
|
|
|
|
|
'''Veratraldehyde''' ('''3,4-dimethoxybenzaldehyde''') is an ] that is widely used as a flavorant and odorant. The compound is structurally related to ]. |
|
|
|
|
|
This compound is popular commercially because of its pleasant woody fragrance. It is derivative of ], from which it is prepared by ].<ref>Karl-Georg Fahlbusch, Franz-Josef Hammerschmidt, Johannes Panten, Wilhelm Pickenhagen, Dietmar Schatkowski, , Kurt Bauer, Dorothea Garbe and Horst Surburg "Flavors and Fragrances" in ''Ullmann's Encyclopedia of Industrial Chemistry'', Wiley-VCH, Weinheim, 2003. {{doi|10.1002/14356007.a11_141}}</ref> |
|
|
|
|
|
==Uses== |
|
|
Veratraldehyde can be used as an intermediate in the synthesis of some pharmaceutical drugs including ], ], ], ], ], ], ], ], and ].{{cn|date=October 2018}} |
|
|
|
|
|
==See also== |
|
|
*] |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
] |
|
|
] |