| Revision as of 15:54, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 405924235 of page Vetivazulene for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 21:08, 25 February 2022 edit Fswitzer4 (talk | contribs)Extended confirmed users10,990 editsm Added/Verified UNII and Verified CAS |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 402873742 |
|
| verifiedrevid = 470629847 |
|
| Name = Vetivazulene |
|
| Name = Vetivazulene |
|
| ImageFile = Vetivazulene.png |
|
| ImageFile = Vetivazulene.png |
|
| ImageSize = 200px |
|
| ImageSize = |
|
| ImageName = Vetivazulene |
|
| ImageName = Vetivazulene |
|
| IUPACName = 4,8-dimethyl-2-isopropylazulene |
|
| PIN = 4,8-Dimethyl-2-(propan-2-yl)azulene |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 61551 |
|
| ChemSpiderID = 61551 |
|
| PubChem = 68253 |
|
| PubChem = 68253 |
| Line 18: |
Line 19: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = APVKGMMYGFJZHY-UHFFFAOYSA-N |
|
| StdInChIKey = APVKGMMYGFJZHY-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 529-08-8 --> |
|
|
|
| CASNo = 529-08-8 |
| ⚫ |
| SMILES = c12c(cccc(c1cc(c2)C(C)C)C)C}} |
|
|
|
|
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| Formula = C<sub>15</sub>H<sub>18 |
|
|
|
|
| ⚫ |
| MolarMass = 198.31 g/mol |
|
|
| Density = |
|
| UNII = 5DFF5RUP6X |
|
⚫ |
| SMILES = c12c(cccc(c1cc(c2)C(C)C)C)C}} |
|
| MeltingPt = 32-33 °C |
|
|
⚫ |
|Section2={{Chembox Properties |
| ⚫ |
| BoilingPt = |
|
|
⚫ |
| Formula = C<sub>15</sub>H<sub>18</sub> |
| ⚫ |
}} |
|
|
⚫ |
| MolarMass = 198.31 g/mol |
|
|
| Density = |
|
|
| MeltingPtC = 32 to 33 |
|
|
| MeltingPt_notes = |
|
⚫ |
| BoilingPt = |
|
⚫ |
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Vetivazulene''' is an ] derivate obtained from ] oil.<ref>{{cite journal |last1=Gordon |first1=Maxwell |title=The Azulenes. |journal=Chemical Reviews |date=1 February 1952 |volume=50 |issue=1 |pages=127–200 |doi=10.1021/cr60155a004}}</ref> It is a bicyclic ] and an ] of ]. |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
{{hydrocarbon-stub}} |