| Revision as of 15:58, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457795730 of page Vindesine for the Chem/Drugbox validation project (updated: 'DrugBank'). |
Latest revision as of 16:41, 24 January 2023 edit Entranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,968 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 470630451 |
|
| Verifiedfields = changed |
|
| ⚫ |
| verifiedrevid = 457794905 |
|
|
| IUPAC_name = methyl (5''S'',7''S'',9''S'')- 9-- 5-ethyl- 5-hydroxy- 1,4,5,6,7,8,9,10-octahydro- 2''H''- 3,7-methanoazacycloundecinoindole- 9-carboxylate |
|
| IUPAC_name = methyl (5''S'',7''S'',9''S'')- 9-- 5-ethyl- 5-hydroxy- 1,4,5,6,7,8,9,10-octahydro- 2''H''- 3,7-methanoazacycloundecinoindole- 9-carboxylate |
|
| image = Vindesin.svg |
|
| image = Vindesin.svg |
|
|
| image2 = Vindesine ball-and-stick animation.gif |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
| Line 23: |
Line 23: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| index2_label = Sulfate |
| ⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
|
| CAS_number2_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| CAS_number = 59917-39-4 |
|
|
|
| CAS_number2 = 59917-39-4 |
|
|
| UNII2_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII2 = CPH2U7DNDY |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CAS_number = 53643-48-4 |
|
| ATC_prefix = L01 |
|
| ATC_prefix = L01 |
|
| ATC_suffix = CA03 |
|
| ATC_suffix = CA03 |
| Line 30: |
Line 35: |
|
| ChEMBL = 219146 |
|
| ChEMBL = 219146 |
|
| PubChem = 40839 |
|
| PubChem = 40839 |
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB00309 |
|
| DrugBank = DB00309 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 37302 |
|
| ChemSpiderID = 37302 |
| Line 43: |
Line 48: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=43 | H=55 | N=5 | O=7 |
|
| C=43 | H=55 | N=5 | O=7 |
|
⚫ |
| smiles = O=C(OC)4(c2c(c1ccccc12)CCN3C(O)(CC)C(C3)C4)c5c(OC)cc6c(c5)89(N6C)(O)(C(=O)N)(O)7(/C=C\CN(78)CC9)CC |
|
| molecular_weight = 753.926 g/mol |
|
| ⚫ |
| smiles = O=C(OC)4(c2c(c1ccccc1n2)CCN3C(O)(CC)C(C3)C4)c5c(OC)cc6c(c5)89(N6C)(O)(C(=O)N)(O)7(/C=C\CN(78)CC9)CC |
|
|
| InChI = 1/C43H55N5O7/c1-6-39(52)21-25-22-42(38(51)55-5,33-27(13-17-47(23-25)24-39)26-11-8-9-12-30(26)45-33)29-19-28-31(20-32(29)54-4)46(3)35-41(28)15-18-48-16-10-14-40(7-2,34(41)48)36(49)43(35,53)37(44)50/h8-12,14,19-20,25,34-36,45,49,52-53H,6-7,13,15-18,21-24H2,1-5H3,(H2,44,50)/t25-,34+,35-,36-,39+,40-,41-,42+,43+/m1/s1 |
|
|
| InChIKey = HHJUWIANJFBDHT-KOTLKJBCBW |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C43H55N5O7/c1-6-39(52)21-25-22-42(38(51)55-5,33-27(13-17-47(23-25)24-39)26-11-8-9-12-30(26)45-33)29-19-28-31(20-32(29)54-4)46(3)35-41(28)15-18-48-16-10-14-40(7-2,34(41)48)36(49)43(35,53)37(44)50/h8-12,14,19-20,25,34-36,45,49,52-53H,6-7,13,15-18,21-24H2,1-5H3,(H2,44,50)/t25-,34+,35-,36-,39+,40-,41-,42+,43+/m1/s1 |
|
| StdInChI = 1S/C43H55N5O7/c1-6-39(52)21-25-22-42(38(51)55-5,33-27(13-17-47(23-25)24-39)26-11-8-9-12-30(26)45-33)29-19-28-31(20-32(29)54-4)46(3)35-41(28)15-18-48-16-10-14-40(7-2,34(41)48)36(49)43(35,53)37(44)50/h8-12,14,19-20,25,34-36,45,49,52-53H,6-7,13,15-18,21-24H2,1-5H3,(H2,44,50)/t25-,34+,35-,36-,39+,40-,41-,42+,43+/m1/s1 |
| Line 52: |
Line 54: |
|
| StdInChIKey = HHJUWIANJFBDHT-KOTLKJBCSA-N |
|
| StdInChIKey = HHJUWIANJFBDHT-KOTLKJBCSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Vindesine''', also termed Eldisine, is a ] ] derived from the flowering plant ''].''<ref name="pmid31228447">{{cite journal | vauthors = Mondal A, Gandhi A, Fimognari C, Atanasov AG, Bishayee A | title = Alkaloids for cancer prevention and therapy: Current progress and future perspectives | journal = European Journal of Pharmacology | volume = 858 | pages = 172472 | date = September 2019 | pmid = 31228447 | doi = 10.1016/j.ejphar.2019.172472 | s2cid = 195298770 }}</ref> Like the natural (e.g. ] and ]) and semisynthetic vinca alkaloids (e.g. ] and ]) derived from this plant, vindesine is an ] that is used as a ] drug.<ref name="pmid30122223">{{cite journal | vauthors = Martino E, Casamassima G, Castiglione S, Cellupica E, Pantalone S, Papagni F, Rui M, Siciliano AM, Collina S | title = Vinca alkaloids and analogues as anti-cancer agents: Looking back, peering ahead | journal = Bioorganic & Medicinal Chemistry Letters | volume = 28 | issue = 17 | pages = 2816–2826 | date = September 2018 | pmid = 30122223 | doi = 10.1016/j.bmcl.2018.06.044 | s2cid = 52039135 }}</ref> By inhibiting ], vinedsine blocks the proliferation of cells, particularly the rapidly proliferation cells of certain types of cancer. It is used, generally in combination with other chemotherapeutic drugs, in the treatment of various malignancies such as ], ], ], ], and ].<ref>{{cite web |url=https://www.cancerresearchuk.org/about-cancer/cancer-in-general/treatment/cancer-drugs/drugs/vindesine |title = Vindesine (Eldisine) {{!}} Cancer information {{!}} Cancer Research UK}}</ref> |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Chemotherapeutic agents}} |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
{{antineoplastic-drug-stub}} |