Revision as of 00:06, 7 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[WP:CHEMVALID|Chem/Drugbox validation← Previous edit |
Latest revision as of 23:58, 12 December 2021 edit undoDePiep (talk | contribs)Extended confirmed users294,285 editsm GHS update: remove empty EUClass/Rphrase/Sphrase parameters (depr), replaced: | AutoignitionPt = → | AutoignitionPt =Tag: AWB |
(15 intermediate revisions by 9 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 448837277 |
|
| verifiedrevid = 448840373 |
|
| Name = Viniferal |
|
| Name = Viniferal |
|
| ImageFile = Viniferal.svg |
|
| ImageFile = Viniferal.svg |
Line 6: |
Line 7: |
|
| ImageName = Chemical structure of viniferal |
|
| ImageName = Chemical structure of viniferal |
|
| ImageAlt = Chemical structure of viniferal |
|
| ImageAlt = Chemical structure of viniferal |
|
| IUPACName = (2''R'',2′''S'',3''R'',3′''S'')-3′-(3,5-Dihydroxyphenyl)-6′-hydroxy-2,2′-bis(4-hydroxyphenyl)-2,2′,3,3′-tetrahydro--5-carbaldehyde |
|
| PIN = (2''R'',2′''S'',3''R'',3′''S'')-3′-(3,5-Dihydroxyphenyl)-6′-hydroxy-2,2′-bis(4-hydroxyphenyl)-5-carbaldehyde |
|
| OtherNames = (-)-Viniferal |
|
| OtherNames = (−)-Viniferal |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = 180413-42-7 |
|
| CASNo = 180413-42-7 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASOther = |
|
| ChEBI = 169301 |
|
| PubChem = |
|
| ChEMBL = 469541 |
|
|
| ChEMBL_Comment = (underspecified stereo) |
|
|
| PubChem = 57518718 |
|
| SMILES = O=CC1=CC=C(O(C2=CC=C(O)C=C2)3C4=CC(O)=CC5=C4(C6=CC(O)=CC(O)=C6)(C7=CC=C(O)C=C7)O5)C3=C1 |
|
| SMILES = O=CC1=CC=C(O(C2=CC=C(O)C=C2)3C4=CC(O)=CC5=C4(C6=CC(O)=CC(O)=C6)(C7=CC=C(O)C=C7)O5)C3=C1 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 26233612 |
|
| ChemSpiderID = 26233612 |
|
| InChI = 1/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1 |
|
| InChI = 1/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1 |
|
| InChIKey = DHTHKPNODOWMKF-VPIGGYNKBX |
|
| InChIKey = DHTHKPNODOWMKF-VPIGGYNKBX |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1 |
|
| StdInChI = 1S/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = DHTHKPNODOWMKF-VPIGGYNKSA-N |
|
| StdInChIKey = DHTHKPNODOWMKF-VPIGGYNKSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=35|H=26|O=8 |
|
| C=35 | H=26 | O=8 |
|
| ExactMass = 574.1627668 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. --> |
|
|
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. --> |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Viniferal''' is a ] with an ] group found in '']'' (grapevine).<ref>{{cite journal | doi = 10.1016/0040-4020(96)00543-1 | title = Absolute structures of new hydroxystilbenoids, vitisin C and viniferal, from Vitis vinifera 'Kyohou' | year = 1996 | last1 = Ito | first1 = J | journal = Tetrahedron | volume = 52 | issue = 30 | pages = 9991}}</ref> |
|
'''Viniferal''' is a ] with an ] group found in '']'' (grapevine).<ref>{{cite journal |last1=Ito |first1=Junko |last2=Niwa |first2=Masatake |date=1996 |title=Absolute structures of new hydroxystilbenoids, vitisin C and viniferal, from ''Vitis vinifera'' 'Kyohou' |journal=Tetrahedron |volume=52 |issue=30 |pages=9991–9998 |doi=10.1016/0040-4020(96)00543-1 |s2cid=97047118}}</ref> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
== External links == |
|
* |
|
* |
|
|
|
|
|
{{Stilbenoids}} |
|
{{Oligostilbenoid}} |
|
|
|
|
|
] |
|
] |
⚫ |
] |
|
|
] |
|
] |
|
⚫ |
] |
|
|
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
|
|
{{aromatic-stub}} |