| Revision as of 10:08, 12 May 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 04:30, 8 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name |
| (15 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 303355221 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 428728651 |
|
| ImageFile = Virginiamycin S1.png |
|
| ImageFile = Virginiamycin S1.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
|
| SystematicName = ''N''-pyrrolo oxapentaazacyclononadecin-9-yl]-3-hydroxypyridine-2-carboxamide |
|
| IUPACName = |
|
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 23152-29-6 |
|
| CASNo = 23152-29-6 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = |
|
|
|
| UNII = J91D5GN5AT |
|
⚫ |
| PubChem = 5388936 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4534976 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 46416 |
|
|
| InChI = 1/C43H49N7O10/c1-4-29-40(56)49-21-12-17-30(49)41(57)48(3)32(23-26-13-7-5-8-14-26)42(58)50-22-19-28(51)24-31(50)37(53)47-35(27-15-9-6-10-16-27)43(59)60-25(2)34(38(54)45-29)46-39(55)36-33(52)18-11-20-44-36/h5-11,13-16,18,20,25,29-32,34-35,52H,4,12,17,19,21-24H2,1-3H3,(H,45,54)(H,46,55)(H,47,53)/t25-,29-,30+,31+,32+,34+,35+/m1/s1 |
|
|
| InChIKey = FEPMHVLSLDOMQC-IYPFLVAKBH |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C43H49N7O10/c1-4-29-40(56)49-21-12-17-30(49)41(57)48(3)32(23-26-13-7-5-8-14-26)42(58)50-22-19-28(51)24-31(50)37(53)47-35(27-15-9-6-10-16-27)43(59)60-25(2)34(38(54)45-29)46-39(55)36-33(52)18-11-20-44-36/h5-11,13-16,18,20,25,29-32,34-35,52H,4,12,17,19,21-24H2,1-3H3,(H,45,54)(H,46,55)(H,47,53)/t25-,29-,30+,31+,32+,34+,35+/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = FEPMHVLSLDOMQC-IYPFLVAKSA-N |
|
| SMILES = O=C((CC2=CC=CC=C2)N(C)(6N(CCC6)C5=O)=O)N1((N(C(O(C)(C(N5CC)=O)NC(C4=NC=CC=C4O)=O)=O)3=CC=CC=C3)=O)CC(CC1)=O |
|
| SMILES = O=C((CC2=CC=CC=C2)N(C)(6N(CCC6)C5=O)=O)N1((N(C(O(C)(C(N5CC)=O)NC(C4=NC=CC=C4O)=O)=O)3=CC=CC=C3)=O)CC(CC1)=O |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=43 | H=49 | N=7 | O=10 |
|
| C=43 | H=49 | N=7 | O=10 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
|
|
'''Virginiamycin S1''' is a ] in the group of antibiotics known as ]. |
|
'''Virginiamycin S1''' is a ] in the group of antibiotics known as ].<ref>{{cite journal | title = Studies in the biosynthesis of antibiotics of the virginiamycin family | author = Kingston, David G. I.; Molinero, Anthony A.; Purvis, Michael B.; Reed, Josephine W.; LeFevre, Joseph W. | journal = Revista Latinoamericana de Química | date = 1989 | volume = 20 | issue = 3–4 | pages = 128–132 }}</ref> |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
] |
|
] |