| Revision as of 14:54, 26 January 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChEMBL KEGG.← Previous edit |
Latest revision as of 22:00, 1 June 2023 edit undoGraeme Bartlett (talk | contribs)Administrators250,229 edits added Category:Lactones using HotCat |
| (22 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 402878462 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Wedelolactone.png |
|
|
⚫ |
| verifiedrevid = 470632227 |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| ImageFile = Wedelolactone.png |
| ⚫ |
|IUPACName= 1,8,9-trihydroxy-3-methoxy-6H-benzofurochromen-6-one |
|
|
⚫ |
| ImageSize = 200px |
| ⚫ |
|OtherNames= |
|
|
⚫ |
| PIN = 1,8,9-Trihydroxy-3-methoxy-6''H''-benzofurobenzopyran-6-one |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
| OtherNames = |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| IUPHAR_ligand = 5551 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4445124 |
|
| ChemSpiderID = 4445124 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C10541 |
|
| KEGG = C10541 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| InChI = 1/C16H10O7/c1-21-6-2-10(19)14-12(3-6)23-16(20)13-7-4-8(17)9(18)5-11(7)22-15(13)14/h2-5,17-19H,1H3 |
|
|
| InChIKey = XQDCKJKKMFWXGB-UHFFFAOYAT |
|
|
| ChEMBL = 97453 |
|
| ChEMBL = 97453 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 10037 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C16H10O7/c1-21-6-2-10(19)14-12(3-6)23-16(20)13-7-4-8(17)9(18)5-11(7)22-15(13)14/h2-5,17-19H,1H3 |
|
| StdInChI = 1S/C16H10O7/c1-21-6-2-10(19)14-12(3-6)23-16(20)13-7-4-8(17)9(18)5-11(7)22-15(13)14/h2-5,17-19H,1H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = XQDCKJKKMFWXGB-UHFFFAOYSA-N |
|
| StdInChIKey = XQDCKJKKMFWXGB-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 524-12-9 |
|
| CASNo = 524-12-9 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = 5281813 |
|
|
|
| UNII = 0K6L725GNS |
| ⚫ |
| SMILES = O=C3Oc4cc(OC)cc(O)c4c2oc1c(cc(O)c(O)c1)c23 |
|
|
⚫ |
| PubChem = 5281813 |
| ⚫ |
}} |
|
|
⚫ |
| SMILES = O=C3Oc4cc(OC)cc(O)c4c2oc1c(cc(O)c(O)c1)c23 |
|
|Section2= {{Chembox Properties |
|
|
| Formula = C<sub>16</sub>H<sub>10</sub>O<sub>7</sub> |
|
|
| MolarMass= 314.24 g/mol |
|
|
| ExactMass = 314.042653 |
|
|
| Appearance= |
|
| ⚫ |
| Density= |
|
| ⚫ |
| MeltingPt= |
|
| ⚫ |
| BoilingPt= |
|
| ⚫ |
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section2={{Chembox Properties |
|
|
| C=16 | H=10 | O=7 |
| ⚫ |
| MainHazards= |
|
|
| FlashPt= |
|
| Appearance= |
|
⚫ |
| Density= |
|
| Autoignition= |
|
|
⚫ |
| MeltingPt= |
|
⚫ |
| BoilingPt= |
|
⚫ |
| Solubility= |
|
⚫ |
}} |
|
|
|Section3={{Chembox Hazards |
|
⚫ |
| MainHazards= |
|
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Wedelolactone''' (]<sub>15</sub>]<sub>10</sub>]<sub>7</sub>) is an ] ] classified as a ] that occurs in '']'' (false daisy) and in '']''<ref>. |
|
'''Wedelolactone''' is an organic chemical compound classified as a ] that occurs in '']'' (false daisy) and in '']''.<ref>{{Cite journal | pmid = 18603418 | doi = 10.1016/j.phymed.2008.05.005| year = 2008| last1 = Prakash| first1 = T.| title = Neuropharmacological studies on Wedelia calendulacea Less stem extract| journal = Phytomedicine| volume = 15| issue = 11| pages = 959–70| last2 = Rao| first2 = N. R.| last3 = Swamy| first3 = A. H.}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{Polyphenol-stub}} |
|
{{aromatic-stub}} |