| Revision as of 07:36, 7 December 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits added Category:Resorcinols using HotCat← Previous edit |
Latest revision as of 16:34, 11 January 2025 edit undoArthurfragoso (talk | contribs)Extended confirmed users, Template editors4,591 edits dark mode fix |
| (25 intermediate revisions by 16 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 401016252 |
|
| Name = Wighteone |
|
| Name = Wighteone |
|
| ImageFile = Wighteone.PNG |
|
| ImageFile = Wighteone structure.svg |
|
|
| ImageClass = skin-invert-image |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| IUPACName = 5,7-dihydroxy-3-(4-hydroxyphenyl)-6-(3-methylbut-2-enyl)chromen-4-one |
|
| IUPACName = 4′,5,7-Trihydroxy-6-(3-methylbut-2-en-1-yl)isoflavone |
|
|
| SystematicName = 5,7-Dihydroxy-3-(4-hydroxyphenyl)-6-(3-methylbut-2-en-1-yl)-4''H''-1-benzopyran-4-one |
|
| OtherNames = 6-isopentenyl]<br>6-]-5,7,4'-trihydroxyisoflavone |
|
| OtherNames = 6-Isopentenylgenistein<br>6-Prenyl-5,7,4′-trihydroxyisoflavone |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 51225-30-0 |
|
| CASNo = 51225-30-0 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 48ZS74CB9A |
|
| PubChem = 5281814 |
|
| PubChem = 5281814 |
|
| Beilstein = |
|
| Beilstein = |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 10038 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 393222 |
|
| SMILES = CC(=CCC1=C(C=C2C(=C1O)C(=O)C(=CO2)C3=CC=C(C=C3)O)O)C |
|
| SMILES = CC(=CCC1=C(C=C2C(=C1O)C(=O)C(=CO2)C3=CC=C(C=C3)O)O)C |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4445125 |
|
|
| InChI = 1/C20H18O5/c1-11(2)3-8-14-16(22)9-17-18(19(14)23)20(24)15(10-25-17)12-4-6-13(21)7-5-12/h3-7,9-10,21-23H,8H2,1-2H3 |
|
|
| InChIKey = KIMDVVKVNNSHGZ-UHFFFAOYAL |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C20H18O5/c1-11(2)3-8-14-16(22)9-17-18(19(14)23)20(24)15(10-25-17)12-4-6-13(21)7-5-12/h3-7,9-10,21-23H,8H2,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = KIMDVVKVNNSHGZ-UHFFFAOYSA-N |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=20 | H=18 | O=5 |
|
| Formula = C<sub>20</sub>H<sub>18</sub>O<sub>5</sub> |
|
|
| MolarMass = 338.35 g/mol |
|
|
| ExactMass = 338.115424 |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
| ⚫ |
'''Wighteone''' is an ], a type of flavonoid. It can be found in '']'', the hedge apple<ref></ref>. |
|
|
|
|
|
|
⚫ |
'''Wighteone''' is an ], a type of ]. It can be found in '']'', the hedge apple.<ref></ref> |
| ⚫ |
==References== |
|
|
|
|
|
⚫ |
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{isoflavone}} |
|
{{isoflavone}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
{{Polyphenol-stub}} |
|
{{phenol-stub}} |