| Revision as of 07:57, 1 September 2011 editBogBot (talk | contribs)Bots53,132 edits populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot← Previous edit |
Latest revision as of 19:39, 30 October 2023 edit undoBoghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,857 edits consistent citation formatting |
| (27 intermediate revisions by 21 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 443766958 |
|
| verifiedrevid = 447818390 |
|
| IUPAC_name = 4,5-dimethyl-2-heptanyl]phenol |
|
| IUPAC_name = 4,5-dimethyl-2-heptanyl]phenol |
|
| image = xibornol.png |
|
| image = xibornol.png |
| Line 6: |
Line 7: |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|international|xibornol}} |
|
| Drugs.com = {{drugs.com|international|xibornol}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 13741-18-9 |
|
| CAS_number = 13741-18-9 |
|
| ATC_prefix = J01 |
|
| ATC_prefix = J01 |
| Line 31: |
Line 33: |
|
| PubChem = 11777299 |
|
| PubChem = 11777299 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = DB13714 |
|
|
| ChEMBL = 2104519 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 9951982 |
|
| ChemSpiderID = 9951982 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 131713 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = RQ12GMY0FZ |
|
| UNII = RQ12GMY0FZ |
| Line 40: |
Line 45: |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=18 | H=26 | O=1 |
|
| C=18 | H=26 | O=1 |
|
| molecular_weight = 258.398 g/mol |
|
|
| smiles = Oc1cc(c(cc1C2CC3CCC2(C)C3(C)C)C)C |
|
| smiles = Oc1cc(c(cc1C2CC3CCC2(C)C3(C)C)C)C |
|
| InChI = 1/C18H26O/c1-11-8-14(16(19)9-12(11)2)15-10-13-6-7-18(15,5)17(13,3)4/h8-9,13,15,19H,6-7,10H2,1-5H3 |
|
|
| InChIKey = RNRHMQWZFJXKLZ-UHFFFAOYAB |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C18H26O/c1-11-8-14(16(19)9-12(11)2)15-10-13-6-7-18(15,5)17(13,3)4/h8-9,13,15,19H,6-7,10H2,1-5H3 |
|
| StdInChI = 1S/C18H26O/c1-11-8-14(16(19)9-12(11)2)15-10-13-6-7-18(15,5)17(13,3)4/h8-9,13,15,19H,6-7,10H2,1-5H3 |
| Line 50: |
Line 52: |
|
| StdInChIKey = RNRHMQWZFJXKLZ-UHFFFAOYSA-N |
|
| StdInChIKey = RNRHMQWZFJXKLZ-UHFFFAOYSA-N |
|
}} |
|
}} |
|
⚫ |
'''Xibornol''' is a ] substance with ] properties, mainly used in Italy and Spain. It is primarily administered to the ] as a spray mouthwash. As of 2007, all approved forms are water-based suspensions.<ref name="pmid17531411">{{cite journal | vauthors = Cirri M, Mura P, Mora PC | title = Liquid spray formulations of xibornol by using self-microemulsifying drug delivery systems | journal = International Journal of Pharmaceutics | volume = 340 | issue = 1–2 | pages = 84–91 | date = August 2007 | pmid = 17531411 | doi = 10.1016/j.ijpharm.2007.03.021 }}</ref> |
|
'''Xibornol''' is an ]. |
|
|
|
|
|
|
|
The drug was discovered in the 1970s.<ref>{{cite book | vauthors = Celandroni F, Mazzantini D, Calvigioni M, Ceccanti S, Vecchiani S, Battaglia S, Bigini C, Ghelardi E | title = Advances in Microbiology, Infectious Diseases and Public Health | chapter = Antimicrobial Activity of Xibornol and a Xibornol-Based Formulation Against Gram-Positive Pathogens of the Respiratory Tract | series = Advances in Experimental Medicine and Biology | display-authors = 6 | volume = 1369 | pages = 101–106 | date = 2022 | pmid = 34387849 | doi = 10.1007/5584_2021_664 | isbn = 978-3-031-01994-4 | hdl-access = free | s2cid = 236998271 | hdl = 11568/1115592 }}</ref> |
| ⚫ |
It is primarily administered to the ].<ref name="pmid17531411">{{cite journal |author=Cirri M, Mura P, Mora PC |title=Liquid spray formulations of xibornol by using self-microemulsifying drug delivery systems |journal=Int J Pharm |volume=340 |issue=1-2 |pages=84–91 |year=2007 |pmid=17531411 |doi=10.1016/j.ijpharm.2007.03.021 |url=http://linkinghub.elsevier.com/retrieve/pii/S0378-5173(07)00267-0}}</ref> |
|
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
|
|
{{Other antibacterials}} |
|
{{Other antibacterials}} |
| Line 62: |
Line 63: |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{antibiotic-stub}} |
|
{{antibiotic-stub}} |