| Revision as of 23:13, 2 September 2011 editBogBot (talk | contribs)Bots53,132 edits populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot← Previous edit |
Latest revision as of 18:30, 21 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Phenols; added Category:Hydroxyarenes using HotCat |
| (58 intermediate revisions by 31 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Opioid analgesic}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 396763267 |
|
| verifiedrevid = 448118966 |
|
| IUPAC_name = N-(Cyclobutylmethyl)- 8β-methyl- 6-methylenemorphinan- 3-ol |
|
| IUPAC_name = ''N''-(Cyclobutylmethyl)-8β-methyl-6-methylenemorphinan-3-ol |
|
| image = Xorphanol.svg |
|
| image = Xorphanol.svg |
|
|
| alt = Structural formula |
|
| width = 200 |
|
| width = 205 |
|
|
| image2 = Xorphanol molecule ball.png |
|
|
| alt2 = Ball-and-stick model |
|
|
| width2 = 220 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
| Line 16: |
Line 22: |
|
| legal_US = |
|
| legal_US = |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 23: |
Line 29: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 77287-89-9 |
|
| CAS_number = 77287-89-9 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
| Line 32: |
Line 39: |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = L415991P58 |
|
| UNII = L415991P58 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 20121496 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=23 | H=31 | N=1 | O=1 |
|
| C=23 | H=31 | N=1 | O=1 |
|
| molecular_weight = 337.498 g/mol |
|
|
| smiles = C1CC(=C)C231(CC4=C2C=C(C=C4)O)N(CC3)CC5CCC5 |
|
| smiles = C1CC(=C)C231(CC4=C2C=C(C=C4)O)N(CC3)CC5CCC5 |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C23H31NO/c1-15-10-16(2)22-21-11-18-6-7-19(25)12-20(18)23(22,13-15)8-9-24(21)14-17-4-3-5-17/h6-7,12,16-17,21-22,25H,1,3-5,8-11,13-14H2,2H3/t16-,21+,22-,23+/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = AZJPPZHRNFQRRE-AZIXLERZSA-N |
|
}} |
|
}} |
|
|
|
|
|
|
'''Xorphanol''' (]) (developmental code name '''TR-5379''' or '''TR-5379M'''), also known as '''xorphanol mesylate''' (]), is an ] ] of the ] family that was never marketed.<ref name="MortonMorton1999">{{cite book| vauthors = Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms|url=https://books.google.com/books?id=mqaOMOtk61IC&pg=PA294|date=31 October 1999|publisher=Springer Science & Business Media|isbn=978-0-7514-0499-9|pages=294–}}</ref><ref>{{cite journal | vauthors = Evans SM, Lenz GR, Lessor RA | title = Analgesics | journal = Annual Reports in Medicinal Chemistry | date = January 1990 | volume = 25 | pages = 11–20 (12) | publisher = Academic Press | url= https://books.google.com/books?id=NZZbEkldeJAC&pg=PA12 |isbn=978-0-08-058369-3 }}</ref><ref name="Lednicer1990">{{cite book| first = Daniel | last = Lednicer | name-list-style = vanc |title=The Organic Chemistry of Drug Synthesis|url=https://books.google.com/books?id=1RBtAAAAMAAJ|date=25 June 1990|publisher=Wiley|isbn=978-0-471-85548-4|page=61}}</ref> |
|
'''Xorphanol''' ('''TR-5379''') is an ] ] from the ] family of drugs. It is a mixed agonist-antagonist at the ] ] and produces potent analgesic effects with little potential for ] or ].<ref>{{cite journal | last1 = Polazzi | first1 = JO | last2 = Kotick | first2 = MP | last3 = Howes | first3 = JF | last4 = Bousquet | first4 = AR | title = Analgesic narcotic antagonists. 9. 6-Methylene-8 beta-alkyl-N-(cycloalkylmethyl)-3-hydroxy- or -methoxymorphinans | journal = Journal of medicinal chemistry | volume = 24 | issue = 12 | pages = 1516–8 | year = 1981 | pmid = 6796691 }}</ref><ref>{{cite journal | last1 = McCarthy | first1 = PS | last2 = Howlett | first2 = GJ | title = Physical dependence induced by opiate partial agonists in the rat | journal = Neuropeptides | volume = 5 | issue = 1-3 | pages = 11–4 | year = 1984 | pmid = 6152317 }}</ref><ref>{{cite journal | last1 = Howes | first1 = JF | last2 = Villarreal | first2 = JE | last3 = Harris | first3 = LS | last4 = Essigmann | first4 = EM | last5 = Cowan | first5 = A | title = Xorphanol | journal = Drug and alcohol dependence | volume = 14 | issue = 3-4 | pages = 373–80 | year = 1985 | pmid = 4039650 }}</ref> |
|
|
|
|
|
|
|
Xorphanol is a mixed ] of ]s,<ref name="ColbernGispen1988">{{cite book| vauthors = Colbern DL, Gispen WH |title=Neural Mechanisms and Biological Significance of Grooming Behavior|url=https://books.google.com/books?id=EVEeAQAAIAAJ|date=1 January 1988|publisher=New York Academy of Sciences|isbn=978-0-89766-441-7}}</ref><ref name="GmerekCowan1988">{{cite journal | vauthors = Gmerek DE, Cowan A | title = Role of opioid receptors in bombesin-induced grooming | journal = Annals of the New York Academy of Sciences | volume = 525 | issue = 1 Neural Mechan | pages = 291–300 | year = 1988 | pmid = 2839069 | doi = 10.1111/j.1749-6632.1988.tb38614.x | bibcode = 1988NYASA.525..291G | hdl = 2027.42/73648 | s2cid = 31977725 | url = https://deepblue.lib.umich.edu/bitstream/2027.42/73648/1/j.1749-6632.1988.tb38614.x.pdf | hdl-access = free }}</ref><ref name="pmid3018570">{{cite journal | vauthors = Cowan A, Zhu XZ, Mosberg HI, Porreca F | title = Central infusion of rats with agents selective for different types of opioid receptor | journal = NIDA Research Monograph | volume = 67 | pages = 132–7 | year = 1986 | pmid = 3018570 }}</ref> acting preferentially as a high-] ]/near-] of the ] (K<sub>i</sub> = 0.4 nM; ] = 3.3 nM; {{abbr|I<sub>max</sub>|maximum inhibition}} = 49%; {{abbr|IA|relative intrinsic activity}} = 0.84)<ref name="GharagozlouHashemi2006">{{cite journal | vauthors = Gharagozlou P, Hashemi E, DeLorey TM, Clark JD, Lameh J | title = Pharmacological profiles of opioid ligands at kappa opioid receptors | journal = BMC Pharmacology | volume = 6 | issue = 1 | pages = 3 | date = January 2006 | pmid = 16433932 | pmc = 1403760 | doi = 10.1186/1471-2210-6-3 | doi-access = free }}</ref><ref name="Testa2013">{{cite book|author=Bernard Testa|title=Advances in Drug Research|url=https://books.google.com/books?id=eiAlBQAAQBAJ&pg=PA245|date=22 October 2013|publisher=Elsevier|isbn=978-1-4832-8798-0|pages=245–}}</ref><ref name="pmid12513698">{{cite journal | vauthors = Gharagozlou P, Demirci H, David Clark J, Lameh J | title = Activity of opioid ligands in cells expressing cloned mu opioid receptors | journal = BMC Pharmacology | volume = 3 | pages = 1 | date = January 2003 | pmid = 12513698 | pmc = 140036 | doi = 10.1186/1471-2210-3-1 | doi-access = free }}</ref> and to a lesser extent as a ] of the ] (K<sub>i</sub> = 0.25 nM; ] = 3.4 nM; {{abbr|I<sub>max</sub>|maximum inhibition}} = 29%) with lower relative ] and marked ] potential (including the ability to antagonize ]-induced effects and induce ] in ] individuals).<ref name="Lednicer1990" /><ref name="Kadam2007">{{cite book|author=Dr. S. S. Kadam|title=PRINCIPLES OF MEDICINAL CHEMISTRY Vol. - II|url=https://books.google.com/books?id=Z7Pb3lJuRksC&pg=PA214|date=1 July 2007|publisher=Pragati Books Pvt. Ltd.|isbn=978-81-85790-03-9|pages=214–}}</ref> The drug has also been found to act as an agonist of the ] (K<sub>i</sub> = 1.0 nM; IC<sub>50</sub> = 8 nM; {{abbr|I<sub>max</sub>|maximum inhibition}} = 76%).<ref name="GharagozlouDemirci2002">{{cite journal | vauthors = Gharagozlou P, Demirci H, Clark JD, Lameh J | title = Activation profiles of opioid ligands in HEK cells expressing delta opioid receptors | journal = BMC Neuroscience | volume = 3 | issue = 1 | pages = 19 | date = November 2002 | pmid = 12437765 | pmc = 137588 | doi = 10.1186/1471-2202-3-19 | doi-access = free }}</ref> |
|
Side effects in animal studies were relatively mild, with only ] and ] being prominent, although it also produced ] at the highest dose tested.<ref>{{cite journal | last1 = Porter | first1 = MC | last2 = Hartnagel | first2 = RE | last3 = Clemens | first3 = GR | last4 = Kowalski | first4 = RL | last5 = Bare | first5 = JJ | last6 = Halliwell | first6 = WE | last7 = Kitchen | first7 = DN | title = Preclinical toxicity and teratogenicity studies with the narcotic antagonist analgesic drug TR5379M | journal = Fundamental and applied toxicology : official journal of the Society of Toxicology | volume = 3 | issue = 5 | pages = 478–82 | year = 1983 | pmid = 6642105 }}</ref> However human trials revealed additional side effects such as ]s and ], and this was the subject of a lawsuit between the drug's inventors and the company to which they had licensed the marketing rights, which claimed that these side effects had not been revealed to them during the license negotiations.<ref></ref> This dispute resulted in the drug never being marketed commercially, although it is still used in scientific research. |
|
|
|
|
|
|
|
Xorphanol produces potent analgesia, and was originally claimed to possess a minimal potential for ] or ].<ref>{{cite journal | vauthors = Polazzi JO, Kotick MP, Howes JF, Bousquet AR | title = Analgesic narcotic antagonists. 9. 6-Methylene-8 beta-alkyl-N-(cycloalkylmethyl)-3-hydroxy- or -methoxymorphinans | journal = Journal of Medicinal Chemistry | volume = 24 | issue = 12 | pages = 1516–8 | date = December 1981 | pmid = 6796691 | doi = 10.1021/jm00144a029 }}</ref><ref>{{cite journal | vauthors = McCarthy PS, Howlett GJ | title = Physical dependence induced by opiate partial agonists in the rat | journal = Neuropeptides | volume = 5 | issue = 1–3 | pages = 11–4 | date = December 1984 | pmid = 6152317 | doi = 10.1016/0143-4179(84)90014-3 | s2cid = 31842402 }}</ref><ref>{{cite journal | vauthors = Howes JF, Villarreal JE, Harris LS, Essigmann EM, Cowan A | title = Xorphanol | journal = Drug and Alcohol Dependence | volume = 14 | issue = 3–4 | pages = 373–80 | date = February 1985 | pmid = 4039650 | doi = 10.1016/0376-8716(85)90068-7 }}</ref> Moreover, ]s in ] were relatively mild, with only ] and ] being prominent, although it also produced ] at the highest dose tested.<ref>{{cite journal | vauthors = Porter MC, Hartnagel RE, Clemens GR, Kowalski RL, Bare JJ, Halliwell WE, Kitchen DN | title = Preclinical toxicity and teratogenicity studies with the narcotic antagonist analgesic drug TR5379M | journal = Fundamental and Applied Toxicology | volume = 3 | issue = 5 | pages = 478–82 | year = 1983 | pmid = 6642105 | doi = 10.1016/S0272-0590(83)80023-2 }}</ref> However, human trials revealed additional side effects such as ]s and ], and this was the subject of a lawsuit between the drug's inventors and the company to which they had licensed the marketing rights, which claimed that these side effects had not been revealed to them during the license negotiations.<ref></ref> As a result of this dispute, the drug was never marketed commercially. |
| ⚫ |
==See also== |
|
|
|
|
|
⚫ |
== See also == |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
* ] |
|
|
|
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
{{clear}} |
|
== References == |
|
== References == |
|
{{reflist}} |
|
{{Reflist|2}} |
|
|
|
|
|
{{opioids}} |
|
{{Hallucinogens}} |
|
|
{{Opioidergics}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{pharm-stub}} |
|
{{analgesic-stub}} |