Revision as of 11:46, 11 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chem← Previous edit |
Latest revision as of 16:50, 19 June 2024 edit undoCitation bot (talk | contribs)Bots5,427,476 edits Altered pmc. Add: authors 1-1. Removed parameters. Some additions/deletions were parameter name changes. | Use this bot. Report bugs. | Suggested by Headbomb (alt) | Category:CS1 maint: PMC format | #UCB_Category 4/9 |
(39 intermediate revisions by 27 users not shown) |
Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 444247232 |
|
| verifiedrevid = 444248572 |
|
| ImageFile = Y-27632.svg |
|
| ImageFile = Y-27632.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| ImageAlt = |
|
| ImageAlt = |
|
| IUPACName = (1R,4r)-4-((R)-1-aminoethyl)-N-(pyridin-4-yl)cyclohexanecarboxamide |
|
| IUPACName = (1''R'',4''r'')-4-((''R'')-1-Aminoethyl)-''N''-(pyridin-4-yl)cyclohexanecarboxamide |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| IUPHAR_ligand = 5290 |
|
| CASNo = 146986-50-7 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 146986-50-7 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| PubChem = 448042 |
|
|
|
| UNII = 0X370ROP6H |
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
⚫ |
| PubChem = 448042 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 75393 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 2218937 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB08756 |
|
| DrugBank = DB08756 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = IYOZTVGMEWJPKR-IJLUTSLNSA-N |
|
| StdInChIKey = IYOZTVGMEWJPKR-IJLUTSLNSA-N |
|
| SMILES = O=C(1CC((N)C)()CC1)NC2=CC=NC=C2 |
|
| SMILES = O=C(1CC((N)C)()CC1)NC2=CC=NC=C2 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 20016532 |
|
| ChemSpiderID = 20016532 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI=1S/C14H21N3O/c1-10(15)11-2-4-12(5-3-11)14(18)17-13-6-8-16-9-7-13/h6-12H,2-5,15H2,1H3,(H,16,17,18)/t10-,11-,12-/m1/s1 |
|
| StdInChI=1S/C14H21N3O/c1-10(15)11-2-4-12(5-3-11)14(18)17-13-6-8-16-9-7-13/h6-12H,2-5,15H2,1H3,(H,16,17,18)/t10-,11-,12-/m1/s1 |
|
| InChI = 1/C14H21N3O/c1-10(15)11-2-4-12(5-3-11)14(18)17-13-6-8-16-9-7-13/h6-12H,2-5,15H2,1H3,(H,16,17,18)/t10-,11-,12-/m1/s1 |
|
| InChI = 1/C14H21N3O/c1-10(15)11-2-4-12(5-3-11)14(18)17-13-6-8-16-9-7-13/h6-12H,2-5,15H2,1H3,(H,16,17,18)/t10-,11-,12-/m1/s1 |
|
| InChIKey = IYOZTVGMEWJPKR-IJLUTSLNBP |
|
| InChIKey = IYOZTVGMEWJPKR-IJLUTSLNBP |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=14 | H=21 | N=3 | O=1 |
|
| C=14 | H=21 | N=3 | O=1 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Y-27632''' is a biochemical tool used in the study of the ] (ROCK) signaling pathways.<ref>{{cite journal | author = Uehata, Masayoshi | title = Y-27632. Selective probe of ROCK/Rho-kinase | journal = Jikken Igaku | year = 1999 | volume = 17 | issue = 7 | pages = 850–855}}</ref> Y-27632 selectively inhibits p160ROCK.<ref>{{cite journal | pmid = 9353125 | year = 1997 | last1 = Uehata | first1 = M | last2 = Ishizaki | first2 = T | last3 = Satoh | first3 = H | last4 = Ono | first4 = T | last5 = Kawahara | first5 = T | last6 = Morishita | first6 = T | last7 = Tamakawa | first7 = H | last8 = Yamagami | first8 = K | last9 = Inui | first9 = J | title = Calcium sensitization of smooth muscle mediated by a Rho-associated protein kinase in hypertension | volume = 389 | issue = 6654 | pages = 990–4 | doi = 10.1038/40187 | journal = Nature}}</ref> |
|
'''Y-27632''' is a biochemical tool used in the study of the ] (ROCK) signaling pathways.<ref>{{cite journal | author = Uehata, Masayoshi | title = Y-27632. Selective probe of ROCK/Rho-kinase | journal = Jikken Igaku | year = 1999 | volume = 17 | issue = 7 | pages = 850–855}}</ref> Y-27632 selectively inhibits ], although it does inhibit other protein kinases such as ] at higher concentrations.<ref>{{cite journal | pmid = 9353125 | year = 1997 | last1 = Uehata | first1 = M | last2 = Ishizaki | first2 = T | last3 = Satoh | first3 = H | last4 = Ono | first4 = T | last5 = Kawahara | first5 = T | last6 = Morishita | first6 = T | last7 = Tamakawa | first7 = H | last8 = Yamagami | first8 = K | last9 = Inui | first9 = J | last10 = Inui | first10 = Jun | last11 = Maekawa | first11 = Midori | title = Calcium sensitization of smooth muscle mediated by a Rho-associated protein kinase in hypertension | volume = 389 | issue = 6654 | pages = 990–4 | doi = 10.1038/40187 | journal = Nature| bibcode = 1997Natur.389..990U | s2cid = 4419556 | display-authors = 8 }}</ref> |
|
|
|
|
|
|
It has been studied for its effects on corneal ]s (CECs) <ref>{{Cite journal|last1=Peh|first1=Gary S. L.|last2=Adnan|first2=Khadijah|last3=George|first3=Benjamin L.|last4=Ang|first4=Heng-Pei|last5=Seah|first5=Xin-Yi|last6=Tan|first6=Donald T.|last7=Mehta|first7=Jodhbir S.|date=2015-03-16|title=The effects of Rho-associated kinase inhibitor Y-27632 on primary human corneal endothelial cells propagated using a dual media approach|journal=Scientific Reports|volume=5|page=9167|doi=10.1038/srep09167|issn=2045-2322|pmc=4387913|pmid=25823914|bibcode=2015NatSR...5E9167P}}</ref> and cardiac ]s (CSCs).<ref>{{Cite journal|last1=Kan|first1=Lijuan|last2=Smith|first2=Aubrie|last3=Chen|first3=Miao|last4=Ledford|first4=Benjamin T.|last5=Fan|first5=Huimin|last6=Liu|first6=Zhongmin|last7=He|first7=Jia-Qiang|date=2015-12-08|title=Rho-Associated Kinase Inhibitor (Y-27632) Attenuates Doxorubicin-Induced Apoptosis of Human Cardiac Stem Cells|journal=PLOS ONE|volume=10|issue=12|pages=e0144513|doi=10.1371/journal.pone.0144513|issn=1932-6203|pmc=4672899|pmid=26645568|bibcode=2015PLoSO..1044513K|doi-access=free}}</ref> |
⚫ |
==References== |
|
⚫ |
{{reflist}} |
|
|
|
|
|
|
|
The substance has been used as part of a chemical cocktail to turn old and ] human cells back into young ones (as measured by transcriptomic age), without turning them all the way back into undifferentiated ].<ref>{{Cite journal |last1=Yang |first1=Jae-Hyun |last2=Petty |first2=Christopher A. |last3=Dixon-McDougall |first3=Thomas |last4=Lopez |first4=Maria Vina |last5=Tyshkovskiy |first5=Alexander |last6=Maybury-Lewis |first6=Sun |last7=Tian |first7=Xiao |last8=Ibrahim |first8=Nabilah |last9=Chen |first9=Zhili |last10=Griffin |first10=Patrick T. |last11=Arnold |first11=Matthew |last12=Li |first12=Jien |last13=Martinez |first13=Oswaldo A. |last14=Behn |first14=Alexander |last15=Rogers-Hammond |first15=Ryan |date=2023-07-12 |title=Chemically induced reprogramming to reverse cellular aging |url=https://www.aging-us.com/article/204896/text |journal=Aging |language=en |volume=15 |issue=13 |pages=5966–5989 |doi=10.18632/aging.204896 |issn=1945-4589 |pmc=10373966 |pmid=37437248}}</ref> |
|
|
|
|
|
|
A mixture of ] (1%), ] (10%), ] (10%), and Y-27632 (10 μM), termed MEDY, has been shown to be an effective ] reagent for brain tissue, enabling tissue to resume growth and function after freezing using liquid nitrogen.<ref>{{Cite journal | doi=10.1016/j.crmeth.2024.100777 | title=Effective cryopreservation of human brain tissue and neural organoids | date=2024 | last1=Xue | first1=Weiwei | last2=Li | first2=Huijuan | last3=Xu | first3=Jinhong | last4=Yu | first4=Xiao | last5=Liu | first5=Linlin | last6=Liu | first6=Huihui | last7=Zhao | first7=Rui | last8=Shao | first8=Zhicheng | journal=Cell Reports Methods | volume=4 | issue=5 | pmid=38744289 | doi-access=free | pmc=11133841 }}</ref> |
|
{{organic-compound-stub}} |
|
|
|
|
|
⚫ |
==References== |
|
⚫ |
{{reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |