| Revision as of 16:25, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 470119050 of page Yamogenin for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 06:24, 12 July 2024 edit حسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits removed Category:Alcohols; added Category:Secondary alcohols using HotCat |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 458273772 |
|
| verifiedrevid = 470634551 |
|
| Reference=<ref>{{PubChem|441900}}</ref> |
|
| Reference=<ref>{{PubChem|441900}}</ref> |
|
| ImageFile = yamogenin.png |
|
| ImageFile = yamogenin.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| IUPACName = |
|
| IUPACName = (25''S'')-Spirost-5-en-3β-ol |
|
|
| SystematicName = (2''S'',4a''R'',4b''S'',6a''S'',6b''R'',7''S'',8''R'',9a''S'',10a''S'',10b''S'')-4a,5′,6a,7-Tetramethyl-1,2,3,4,4a,4b,5,6,6a,6b,7,9a,10,10a,10b,11-hexadecahydrospiroindenofuran-8,2′-oxan]-2-ol |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 390476 |
|
| ChemSpiderID = 390476 |
| Line 17: |
Line 18: |
|
| InChI = 1S/C27H42O3/c1-16-7-12-27(29-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(28)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28H,6-15H2,1-4H3/t16-,17-,19-,20+,21-,22-,23-,24-,25-,26-,27+/m0/s1 |
|
| InChI = 1S/C27H42O3/c1-16-7-12-27(29-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(28)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28H,6-15H2,1-4H3/t16-,17-,19-,20+,21-,22-,23-,24-,25-,26-,27+/m0/s1 |
|
| InChIKey1 = WQLVFSAGQJTQCK-CAKNJAFZSA-N |
|
| InChIKey1 = WQLVFSAGQJTQCK-CAKNJAFZSA-N |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 512-06-1 --> |
|
| CASNo=512-06-1 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = M487OD4XW3 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 400807 |
|
| ChEMBL = 400807 |
| Line 24: |
Line 27: |
|
| SMILES=C1CC2((3(O2)C43(CC54CC=C65(CC(C6)O)C)C)C)OC1 |
|
| SMILES=C1CC2((3(O2)C43(CC54CC=C65(CC(C6)O)C)C)C)OC1 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=27|H=42|O=3 |
|
| Formula=C<sub>27</sub>H<sub>42</sub>O<sub>3</sub> |
|
|
| MolarMass=414.62 g/mol |
|
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
| Line 33: |
Line 35: |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Yamogenin''' is a ] of the class called ]s.<ref>{{cite journal | doi = 10.1016/S0031-9422(00)85706-4 | title = Isolation and characterization of yamogenin from balanites aegyptiaca | journal = Phytochemistry | volume = 9 | issue = 3 | pages = 645–649 | year = 1970 | last1 = Hardman | first1 = Roland | last2 = Sofowora | first2 = Ezekiel Abayomi | bibcode = 1970PChem...9..645H }}</ref> It is found in the ] ] (''Trigonella foenum-graecum'') and other plants. |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Saponins}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{alcohol-stub}} |