| Revision as of 04:20, 31 July 2011 editArcadian (talk | contribs)163,050 edits removed Category:Antineoplastic drugs; added Category:Topoisomerase inhibitors using HotCat← Previous edit |
Latest revision as of 18:31, 21 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Phenols; added Category:Hydroxyarenes using HotCat |
| (13 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
| Verifiedfields = changed |
|
|
⚫ |
| verifiedrevid = 442303628 |
|
| Watchedfields = changed |
|
|
⚫ |
| IUPAC_name = (E)-N'-(1-((2S,4S)-4-((2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyltetrahydro-2H-pyran-2-yloxy)-2,5,12-trihydroxy-7-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-2-yl)ethylidene)benzohydrazide |
| ⚫ |
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
⚫ |
| image = Zorubicin.png |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = rubidazon, rubidazone |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = Rx-only |
|
⚫ |
| routes_of_administration = i.v. |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 54083-22-6 |
|
⚫ |
| ATC_prefix = L01 |
|
⚫ |
| ATC_suffix = DB05 |
|
⚫ |
| ATC_supplemental = |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = DB11618 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = V25F9362OP |
|
| UNII = V25F9362OP |
|
|
| PubChem = 9595290 |
| ⚫ |
| verifiedrevid = 376128310 |
|
|
|
| ChemSpiderID = 7869436 |
| ⚫ |
| IUPAC_name = (E)-N'-(1-((2S,4S)-4-((2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyltetrahydro-2H-pyran-2-yloxy)-2,5,12-trihydroxy-7-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-2-yl)ethylidene)benzohydrazide |
|
|
|
| StdInChI = 1S/C34H35N3O10/c1-15-28(38)20(35)12-23(46-15)47-22-14-34(44,16(2)36-37-33(43)17-8-5-4-6-9-17)13-19-25(22)32(42)27-26(30(19)40)29(39)18-10-7-11-21(45-3)24(18)31(27)41/h4-11,15,20,22-23,28,38,40,42,44H,12-14,35H2,1-3H3,(H,37,43)/b36-16+/t15-,20-,22-,23-,28+,34-/m0/s1 |
| ⚫ |
| image = Zorubicin.png |
|
|
|
| StdInChIKey = FBTUMDXHSRTGRV-ALTNURHMSA-N |
| ⚫ |
| CAS_number = 54083-22-6 |
|
|
|
|
|
| CAS_supplemental = |
|
|
|
<!--Chemical data--> |
| ⚫ |
| ATC_prefix = L01 |
|
|
⚫ |
| chemical_formula = |
| ⚫ |
| ATC_suffix = DB05 |
|
| ⚫ |
| ATC_supplemental = |
|
|
| PubChem = 9573395 |
|
| ⚫ |
| DrugBank = |
|
| ⚫ |
| chemical_formula = |
|
|
| C=34 | H=35 | N=3 | O=10 |
|
| C=34 | H=35 | N=3 | O=10 |
|
⚫ |
| smiles = OC1=C(C(C4=C(C=CC=C4OC)C3=O)=O)C3=C(O)C2=C1(O5()O(C)(O)(N)C5)C(/(C)=N/NC(C6=CC=CC=C6)=O)(O)C2 |
|
| molecular_weight = 645.65 g/mol |
|
| ⚫ |
| smiles = OC1=C(C(C4=C(C=CC=C4OC)C3=O)=O)C3=C(O)C2=C1(O5()O(C)(O)(N)C5)C(/(C)=N/NC(C6=CC=CC=C6)=O)(O)C2 |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = Rx-only |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Zorubicin''' (]) is a ]] derivative of the ] antineoplastic antibiotic ]. Zorubicin intercalates into DNA; it as well interacts with ] and inhibits DNA polymerases and therefore is used to treat ]. <ref>{{Cite web|url=https://drugs.ncats.io/drug/V25F9362OP|title=NCATS Inxight Drugs — ZORUBICIN|website=drugs.ncats.io}}</ref> |
|
'''Zorubicin''' (]) is an ]. |
|
|
|
|
|
|
|
|
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
{{Chemotherapeutic agents}} |
|
{{Chemotherapeutic agents}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|