| Revision as of 18:49, 8 August 2010 editWaacstats (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers1,348,587 editsm stub sorting, replaced: organic-compound-stub → steroid-stub using AWB← Previous edit |
Latest revision as of 16:00, 3 December 2024 edit undoCitation bot (talk | contribs)Bots5,428,977 edits Add: bibcode, pages, issue, volume, journal, date, title, authors 1-4. | Use this bot. Report bugs. | Suggested by Marbletan | #UCB_toolbar |
| (22 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
|ImageFile=zymosterol.png |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageSize=200px |
|
|
|
| verifiedrevid = 377858461 |
| ⚫ |
|IUPACName=(3''S'',5''S'',10''S'',13''R'',14''R'',17''R'')-10,13-dimethyl-17--2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1''H''-cyclopentaphenanthren-3-ol |
|
|
⚫ |
| ImageFile = zymosterol.png |
| ⚫ |
|OtherNames=5α-Cholesta-8,24-dien-3β-ol |
|
|
⚫ |
| ImageSize = |
|
|
| ImageFile1 = Zymosterol molecule ball.png |
|
|
| ImageSize1 = 250 |
|
|
| ImageAlt1 = Ball-and-stick model of zymosterol |
|
⚫ |
| IUPACName = 5α-Cholesta-8,24-dien-3β-ol |
|
⚫ |
| SystematicName = (1''R'',3a''R'',5a''S'',7''S'',9a''S'',11a''R'')-9a,11a-Dimethyl-1--2,3,3a,4,5,5a,6,7,8,9,9a,10,11,11a-tetradecahydro-1''H''-cyclopentaphenanthren-7-ol |
|
|
| OtherNames = |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo=128-33-6 |
|
| CASNo = 128-33-6 |
| ⚫ |
| PubChem=92746 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES=C(CCC=C(C)C)1CC21(CCC3=C2CC43(CC(C4)O)C)C |
|
|
|
| UNII = PU2755PT4O |
| ⚫ |
}} |
|
|
⚫ |
| PubChem = 92746 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 83724 |
|
⚫ |
| SMILES = O4CC3(/C2=C(/1CC((C)CC\C=C(/C)C)1(C)CC2)CC3C4)C |
|
|
| InChI = 1/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h7,19-21,23-24,28H,6,8-17H2,1-5H3/t19-,20+,21+,23-,24+,26+,27-/m1/s1 |
|
|
| InChIKey = CGSJXLIKVBJVRY-XTGBIJOFBJ |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h7,19-21,23-24,28H,6,8-17H2,1-5H3/t19-,20+,21+,23-,24+,26+,27-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = CGSJXLIKVBJVRY-XTGBIJOFSA-N }} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C = 27 | H = 4 | O = 1 |
|
| Formula=C<sub>27</sub>H<sub>44</sub>O |
|
|
|
| Appearance = |
|
| MolarMass=384.64 g/mol |
|
|
|
| Density = |
|
| Appearance= |
|
|
|
| MeltingPt = |
|
| Density= |
|
|
|
| BoilingPt = |
|
| MeltingPt= |
|
|
|
| Solubility = |
|
| BoilingPt= |
|
|
⚫ |
}} |
|
| Solubility= |
|
|
}} |
|
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards = |
|
| FlashPt= |
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Zymosterol''' is an intermediate in ] biosynthesis.<ref>{{Cite journal | doi = 10.1021/ja00183a042 | title = Synthesis of zymosterol, fecosterol, and related biosynthetic sterol intermediates | date = 1989 | last1 = Dolle | first1 = Roland E. | last2 = Schmidt | first2 = Stanley J. | last3 = Erhard | first3 = Karl F. | last4 = Kruse | first4 = Lawrence I. | journal = Journal of the American Chemical Society | volume = 111 | issue = 1 | pages = 278–284 | bibcode = 1989JAChS.111..278D }}</ref> Disregarding some intermediate compounds (e.g. 4-4-dimethylzymosterol), ] can be considered a precursor of zymosterol in the cholesterol synthesis pathway. The conversion of zymosterol into cholesterol happens in the ]. Zymosterol accumulates quickly in the plasma membrane coming from the ]. The movement of zymosterol across the cytosol is more than twice as fast as the movement of cholesterol itself. |
|
'''Zymosterol''' is a ] intermediate. |
|
|
|
|
|
|
|
==References== |
|
|
|
|
{{steroid-stub}} |
|
{{reflist}} |
|
|
|
|
|
{{Cholesterol and steroid intermediates}} |
|
{{Cholesterol and steroid intermediates}} |
|
|
|
|
|
|
{{steroid-stub}} |
|
|
|
|
|
|
] |
|
] |
|
] |