Viniferal: Difference between revisions

Browse history interactively ← Previous editContent deleted Content addedVisual WikitextInline

Revision as of 15:41, 6 December 2011 editChemNerd (talk \| contribs)Extended confirmed users17,568 edits removed Category:Natural polyphenols; added Category:Polyphenols using HotCat ← Previous edit		Latest revision as of 23:58, 12 December 2021 edit undoDePiep (talk \| contribs)Extended confirmed users294,285 editsm GHS update: remove empty EUClass/Rphrase/Sphrase parameters (depr), replaced: \| AutoignitionPt = → \| AutoignitionPt =Tag: AWB
(14 intermediate revisions by 8 users not shown)
Line 1:		Line 1:
	{{chembox		{{chembox
			\| Watchedfields = changed
	\| verifiedrevid = ~~448837277~~		\| verifiedrevid = 448840373
	\| Name = Viniferal		\| Name = Viniferal
	\| ImageFile = Viniferal.svg		\| ImageFile = Viniferal.svg
Line 6:		Line 7:
	\| ImageName = Chemical structure of viniferal		\| ImageName = Chemical structure of viniferal
	\| ImageAlt = Chemical structure of viniferal		\| ImageAlt = Chemical structure of viniferal
	\| ~~IUPACName~~ = (2''R'',~~2′~~''S'',3''R'',~~3′~~''S'')-~~3′~~-(3,5-Dihydroxyphenyl)-~~6′~~-hydroxy-2,~~2′~~-bis(4-hydroxyphenyl)~~-2,2′,~~3,~~3′~~-~~tetrahydro~~-~~-5-carbaldehyde~~		\| PIN = (2''R'',2′''S'',3''R'',3′''S'')-3′-(3,5-Dihydroxyphenyl)-6′-hydroxy-2,2′-bis(4-hydroxyphenyl)-5-carbaldehyde
	\| OtherNames = (-)-Viniferal		\| OtherNames = (−)-Viniferal
	\|Section1= {{Chembox Identifiers		\|Section1={{Chembox Identifiers
	\| CASNo = 180413-42-7		\| CASNo = 180413-42-7
	\| CASNo_Ref = {{cascite\|correct\|~~CAS~~}}		\| CASNo_Ref = {{cascite\|correct\|??}}
	\| ~~CASOther~~ =		\| ChEBI = 169301
	\| ~~PubChem~~ =		\| ChEMBL = 469541
			\| ChEMBL_Comment = (underspecified stereo)
			\| PubChem = 57518718
	\| SMILES = O=CC1=CC=C(O(C2=CC=C(O)C=C2)3C4=CC(O)=CC5=C4(C6=CC(O)=CC(O)=C6)(C7=CC=C(O)C=C7)O5)C3=C1		\| SMILES = O=CC1=CC=C(O(C2=CC=C(O)C=C2)3C4=CC(O)=CC5=C4(C6=CC(O)=CC(O)=C6)(C7=CC=C(O)C=C7)O5)C3=C1
	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}		\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| ChemSpiderID = 26233612		\| ChemSpiderID = 26233612
	\| InChI = 1/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1		\| InChI = 1/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1
	\| InChIKey = DHTHKPNODOWMKF-VPIGGYNKBX		\| InChIKey = DHTHKPNODOWMKF-VPIGGYNKBX
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChI = 1S/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1		\| StdInChI = 1S/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = DHTHKPNODOWMKF-VPIGGYNKSA-N		\| StdInChIKey = DHTHKPNODOWMKF-VPIGGYNKSA-N
	\| MeSHName =		\| MeSHName =
	}}		}}
	\|Section2= {{Chembox Properties		\|Section2={{Chembox Properties
	\| C=35\|H=26\|O=8		\| C=35 \| H=26 \| O=8
	\| ExactMass = 574.1627668 u
	\| Appearance =		\| Appearance =
	\| Density =		\| Density =
	\| MeltingPt = ~~<!-- °C -->~~		\| MeltingPt =
	\| BoilingPt = ~~<!-- °C -->~~		\| BoilingPt =
	\| Solubility =		\| Solubility =
	}}		}}
	\| Section3 = {{Chembox Hazards		\|Section3={{Chembox Hazards
	\| MainHazards =		\| MainHazards =
	\| FlashPt =		\| FlashPt =
	\| ~~Autoignition~~ =		\| AutoignitionPt =
	\| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. -->
	\| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. -->
	}}		}}
	}}		}}

	'''Viniferal''' is a ] with an ] group found in '']'' (grapevine).<ref>{{cite journal \| ~~doi~~ = ~~10.1016/0040-4020(96)00543-1~~ \| title = Absolute structures of new hydroxystilbenoids, vitisin C and viniferal, from Vitis vinifera 'Kyohou' \| ~~year = 1996 \| last1 = Ito \| first1 = J \|~~ journal = Tetrahedron \| volume = 52 \| issue = 30 \| pages = ~~9991~~}}</ref>		'''Viniferal''' is a ] with an ] group found in '']'' (grapevine).<ref>{{cite journal \|last1=Ito \|first1=Junko \|last2=Niwa \|first2=Masatake \|date=1996 \|title=Absolute structures of new hydroxystilbenoids, vitisin C and viniferal, from ''Vitis vinifera'' 'Kyohou' \|journal=Tetrahedron \|volume=52 \|issue=30 \|pages=9991–9998 \|doi=10.1016/0040-4020(96)00543-1 \|s2cid=97047118}}</ref>

	==References==		== References ==
	{{reflist}}		{{reflist}}

	==External links==		== External links ==
	*		*

	{{~~Stilbenoids~~}}		{{Oligostilbenoid}}

	]		]
⚫	]
	]		]
		⚫	]


	{{Natural-phenol-stub}}
			{{aromatic-stub}}

Latest revision as of 23:58, 12 December 2021

Viniferal
Names

Preferred IUPAC name (2R,2′S,3R,3′S)-3′-(3,5-Dihydroxyphenyl)-6′-hydroxy-2,2′-bis(4-hydroxyphenyl)-5-carbaldehyde
Other names (−)-Viniferal
Identifiers
CAS Number	180413-42-7
3D model (JSmol)	Interactive image
ChEBI	CHEBI:169301
ChEMBL	ChEMBL469541 (underspecified stereo)
ChemSpider	26233612
PubChem CID	57518718
CompTox Dashboard (EPA)	DTXSID80727006
InChI InChI=1S/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1Key: DHTHKPNODOWMKF-VPIGGYNKSA-N InChI=1/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1Key: DHTHKPNODOWMKF-VPIGGYNKBX
SMILES O=CC1=CC=C(O(C2=CC=C(O)C=C2)3C4=CC(O)=CC5=C4(C6=CC(O)=CC(O)=C6)(C7=CC=C(O)C=C7)O5)C3=C1
Properties
Chemical formula	C₃₅H₂₆O₈
Molar mass	574.585 g·mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). Y verify (what is ?) Infobox references

Chemical compound

Viniferal is a hydroxystilbenoid with an aldehyde group found in Vitis vinifera (grapevine).

References

Ito, Junko; Niwa, Masatake (1996). "Absolute structures of new hydroxystilbenoids, vitisin C and viniferal, from Vitis vinifera 'Kyohou'". Tetrahedron. 52 (30): 9991–9998. doi:10.1016/0040-4020(96)00543-1. S2CID 97047118.

External links

Website of the Schröder group

Oligostilbenoids and their glycosides

Dimers

Trimers

Tetramers:

Dibalanocarpol
Gnetin J (3"-hydroxygnetin E)
Gnetin K (3"-methoxygnetin E)
Gnetuhainin R (isorhapontigenin tetramer)
Laetevirenol F and G

Higher polymers
(five units or more)

Vaticanol D, H, I and J

Oligomeric forms
of resveratrol

Dimers	Amurensin A and H Ampelopsin A B D and F Balanocarpol Cyphostemmin A and B δ-viniferin ε-viniferin Gnetin A and C Leachinol F Malibatol A Pallidol Parthenocissin A Quadrangularin A Restrytisol A, B and C Vitisinol D
Trimers	α-viniferin Ampelopsin C Amurensin C, D and G Hopeanolin Malaysianol A Miyabenol C Resviniferin A and B trans-diptoindonesin B
Tetramers	Ampelopsin H Amurensin K Caraphenol B Carasinol B Flexuosol A Hopeaphenol Kobophenol A Miyabenol A Vaticanol B and C Vaticaphenol A Vitisin A B and C β-viniferin (cyclic resveratrol tetramer)
Pentamers	Amurensin E and F
Hexamers	Chunganenol
Higher polymers	γ-viniferin Valeriaphenol A

Glycosides or conjugates

Diptoindonesin A (C-glucoside of ε-viniferin)
Foeniculoside I (glucoside of miyabenol C), II, III and IV
Laevifonol (an ε-viniferin-ascorbic acid hybrid compound)
Laevifoside (O-glucoside of ampelopsin A)

This article about an aromatic compound is a stub. You can help Misplaced Pages by expanding it.

Categories: