Misplaced Pages

Bibrocathol: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 18:01, 20 July 2011 editLouisajb (talk | contribs)Extended confirmed users4,402 edits added chembl id← Previous edit Revision as of 07:19, 2 September 2011 edit undoBogBot (talk | contribs)Bots53,132 edits populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBotNext edit →
Line 1: Line 1:
{{drugbox {{Drugbox
⚫ | IUPAC_name = 4,5,6,7-tetrabromo-2-hydroxy-1,3,2-benzodioxabismole
⚫ | image = Bibrocathol structure.svg

<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|international|bibrocathol}}
⚫ | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫ | pregnancy_US = <!-- A / B / C / D / X -->
⚫ | pregnancy_category =
⚫ | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫ | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫ | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫ | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫ | legal_status =
⚫ | routes_of_administration = Topical (eye ointment)

<!--Pharmacokinetic data-->
⚫ | bioavailability =
⚫ | protein_bound =
⚫ | metabolism =
⚫ | elimination_half-life =
⚫ | excretion =

<!--Identifiers-->
⚫ | CAS_number = 6915-57-7
⚫ | ATC_prefix = S01
⚫ | ATC_suffix = AX05
⚫ | PubChem = 16683103
⚫ | DrugBank =
⚫ | ChemSpiderID = 11232581
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0KJ20H1BLJ | UNII = 0KJ20H1BLJ
⚫ | ChEMBL = 44875
⚫ | IUPAC_name = 4,5,6,7-tetrabromo-2-hydroxy-1,3,2-benzodioxabismole

⚫ | image = Bibrocathol structure.svg
<!--Chemical data-->
⚫ | chemical_formula =
⚫ | C=6 | H=1 | Bi=1 | Br=4 | O=3
⚫ | molecular_weight = 650.675 g/mol
⚫ | smiles = O1Oc2c(Br)c(Br)c(Br)c(Br)c2O1
| InChI = 1/C6H2Br4O2.Bi.H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h11-12H;;1H2/q;+3;/p-3/rC6HBiBr4O3/c8-1-2(9)4(11)6-5(3(1)10)13-7(12)14-6/h12H | InChI = 1/C6H2Br4O2.Bi.H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h11-12H;;1H2/q;+3;/p-3/rC6HBiBr4O3/c8-1-2(9)4(11)6-5(3(1)10)13-7(12)14-6/h12H
| InChIKey = VTAVFIZOZUAKKE-AJXSUKGNAS | InChIKey = VTAVFIZOZUAKKE-AJXSUKGNAS
⚫ | synonyms = Bibrocathin<br>Tetrabromopyrocatechol&nbsp;bismuth
⚫ | CAS_number = 6915-57-7
⚫ | ATC_prefix = S01
⚫ | ATC_suffix = AX05
⚫ | PubChem = 16683103
⚫ | DrugBank =
⚫ | ChemSpiderID = 11232581
⚫ | ChEMBL = 44875
⚫ | chemical_formula =
⚫ | C=6 | H=1 | Bi=1 | Br=4 | O=3
⚫ | molecular_weight = 650.675 g/mol
⚫ | smiles = O1Oc2c(Br)c(Br)c(Br)c(Br)c2O1
⚫ | synonyms = Bibrocathin<br>Tetrabromopyrocatechol&nbsp;bismuth
⚫ | bioavailability =
⚫ | protein_bound =
⚫ | metabolism =
⚫ | elimination_half-life =
⚫ | excretion =
⚫ | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫ | pregnancy_US = <!-- A / B / C / D / X -->
⚫ | pregnancy_category=
⚫ | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫ | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫ | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫ | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫ | legal_status =
⚫ | routes_of_administration = Topical (eye ointment)
}} }}
'''Bibrocathol''' (], trade names '''Noviform''' and '''Posiformin''') is the substance 4,5,6,7-Tetrabrom-1,3,2-benzodioxabismol-2-ol. It contains ] and is used to treat eye infections and control swelling. '''Bibrocathol''' (], trade names '''Noviform''' and '''Posiformin''') is the substance 4,5,6,7-Tetrabrom-1,3,2-benzodioxabismol-2-ol. It contains ] and is used to treat eye infections and control swelling.

Revision as of 07:19, 2 September 2011

Pharmaceutical compound
Bibrocathol
Clinical data
Other namesBibrocathin
Tetrabromopyrocatechol bismuth
AHFS/Drugs.comInternational Drug Names
Routes of
administration		Topical (eye ointment)
ATC code
Identifiers
IUPAC name
  • 4,5,6,7-tetrabromo-2-hydroxy-1,3,2-benzodioxabismole
CAS Number
PubChem CID
ChemSpider
UNII
ChEMBL
CompTox Dashboard (EPA)
ECHA InfoCard100.027.294 Edit this at Wikidata
Chemical and physical data
FormulaC6HBiBr4O3
Molar mass650.675 g/mol g·mol
3D model (JSmol)
SMILES
  • O1Oc2c(Br)c(Br)c(Br)c(Br)c2O1

Bibrocathol (INN, trade names Noviform and Posiformin) is the substance 4,5,6,7-Tetrabrom-1,3,2-benzodioxabismol-2-ol. It contains bismuth and is used to treat eye infections and control swelling.

Bismuth compounds
Bismuth(III)
Organobismuth(III)
Bismuth(V)
Organobismuth(V)
Stub icon

This antiinfective drug article is a stub. You can help Misplaced Pages by expanding it.

Categories: