Revision as of 19:29, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 455739478 of page A-412,997 for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 19:29, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 466319139 of page A-41988 for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 413287887 |
|
| verifiedrevid = 408392364 |
|
| IUPAC_name = N-(3-methylphenyl)-2-(4-pyridin-2-ylpiperidin-1-yl)acetamide |
|
| IUPAC_name = 8--5,5-dimethyl-2-prop-2-ynyl-3,4-dihydro-1H-chromenopyridin-10-ol |
|
| image = A-412,997.png |
|
| image = A-41988.png |
|
|
| width = 240 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| licence_EU = |
|
| legal_status = |
|
| pregnancy_category = |
|
|
| legal_UK = |
|
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
Line 19: |
Line 17: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| ATC_suffix = |
|
|
|
| CAS_number = <!-- blanked - oldvalue: 52763-30-1 --> |
|
| PubChem = 10425450 |
|
| PubChem = 3085018 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 8600878 |
|
| ChemSpiderID = 2341998 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 375596 |
|
| ChEMBL = 303312 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=19 | H=23 | N=3 | O=1 |
|
| C=28 | H=32 | F=1 | N=1 | O=2 |
|
| molecular_weight = 309.405 g/mol |
|
| molecular_weight = 433.556 g/mol |
|
| smiles = c3ccc(cc3C)NC(=O)CN2CCC(CC2)c1ccccn1 |
|
| smiles = c4cc(F)ccc4CCCC(C)c3cc(O)c1C=2CN(CC#C)CCC=2C(C)(C)Oc1c3 |
|
| InChI = 1/C19H23N3O/c1-15-5-4-6-17(13-15)21-19(23)14-22-11-8-16(9-12-22)18-7-2-3-10-20-18/h2-7,10,13,16H,8-9,11-12,14H2,1H3,(H,21,23) |
|
| InChI = 1/C28H32FNO2/c1-5-14-30-15-13-24-23(18-30)27-25(31)16-21(17-26(27)32-28(24,3)4)19(2)7-6-8-20-9-11-22(29)12-10-20/h1,9-12,16-17,19,31H,6-8,13-15,18H2,2-4H3 |
|
| InChIKey = JFCDMGGMCUKHST-UHFFFAOYAU |
|
| InChIKey = UIDOJGIFVOOMLY-UHFFFAOYAY |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C19H23N3O/c1-15-5-4-6-17(13-15)21-19(23)14-22-11-8-16(9-12-22)18-7-2-3-10-20-18/h2-7,10,13,16H,8-9,11-12,14H2,1H3,(H,21,23) |
|
| StdInChI = 1S/C28H32FNO2/c1-5-14-30-15-13-24-23(18-30)27-25(31)16-21(17-26(27)32-28(24,3)4)19(2)7-6-8-20-9-11-22(29)12-10-20/h1,9-12,16-17,19,31H,6-8,13-15,18H2,2-4H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = JFCDMGGMCUKHST-UHFFFAOYSA-N |
|
| StdInChIKey = UIDOJGIFVOOMLY-UHFFFAOYSA-N |
|
}} |
|
}} |