| Revision as of 19:46, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 451608458 of page Acefurtiamine for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 14:12, 6 February 2024 edit VastV0idInSpace0 (talk | contribs)Extended confirmed users2,406 edits Fixed spacing between stub template and category templates.Tag: 2017 wikitext editor |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 443668196 |
|
| verifiedrevid = 477237993 |
|
| IUPAC_name = (3''E'')-4-{(formyl)amino}-3-pent-3-en-1-yl (acetyloxy)acetate |
|
| IUPAC_name = (3''E'')-4-{(formyl)amino}-3-pent-3-en-1-yl (acetyloxy)acetate |
|
| image = Acefurtiamine.svg |
|
| image = Acefurtiamine.svg |
|
| width = 200 |
|
| width = |
|
|
| drug_name = |
|
| imagename = <!-- else may use drug_name --> |
|
|
| drug_name = Acefurtiamine<!-- else may use imagename --> |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
| Line 23: |
Line 22: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 10072-48-7 --> |
|
| CAS_number = 10072-48-7 |
|
| PubChem = 3037171 |
|
| PubChem = 3037171 |
|
|
| ATC_prefix = none |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 2300987 |
|
| ChemSpiderID = 2300987 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 2104090 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 6APJ3D1308 |
|
| UNII = 6APJ3D1308 |
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=21 | H=24 | N=4 | O=7 | S=1 |
|
| C=21 | H=24 | N=4 | O=7 | S=1 |
|
⚫ |
| SMILES = O=C(OCC(=O)OCCC(\SC(=O)c1occc1)=C(/N(C=O)Cc2cnc(nc2N)C)C)C |
|
| molecular_weight = 476.503 |
|
| ⚫ |
| smiles = O=C(OCC(=O)OCCC(\SC(=O)c1occc1)=C(/N(C=O)Cc2cnc(nc2N)C)C)C |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C21H24N4O7S/c1-13(25(12-26)10-16-9-23-14(2)24-20(16)22)18(33-21(29)17-5-4-7-30-17)6-8-31-19(28)11-32-15(3)27/h4-5,7,9,12H,6,8,10-11H2,1-3H3,(H2,22,23,24)/b18-13+ |
|
| StdInChI = 1S/C21H24N4O7S/c1-13(25(12-26)10-16-9-23-14(2)24-20(16)22)18(33-21(29)17-5-4-7-30-17)6-8-31-19(28)11-32-15(3)27/h4-5,7,9,12H,6,8,10-11H2,1-3H3,(H2,22,23,24)/b18-13+ |
| Line 40: |
Line 41: |
|
| StdInChIKey = MYBUGVXNAHWTOL-QGOAFFKASA-N |
|
| StdInChIKey = MYBUGVXNAHWTOL-QGOAFFKASA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Acefurtiamine''' (]) is a ] in a manner similar to the ]ergic activity of the ] derivative ].<ref name="MartindaleSciences1993">{{cite book| vauthors = Martindale W |title=The Extra Pharmacopoeia|url=https://books.google.com/books?id=EGZWAAAAYAAJ |year=1993 |publisher= Pharmaceutical Press |isbn=978-0-85369-300-0 |page=1053}}</ref> It functions as an ] agent at sufficient doses.{{medcn|date=April 2016}} |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
== Further reading == |
|
|
{{refbegin}} |
|
|
*{{cite book| veditors = Elks J, Ganellin CR |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA2|date=1990|publisher=Springer|isbn=978-1-4757-2085-3|doi=10.1007/978-1-4757-2085-3|pages=2–}} |
|
|
{{refend}} |
|
|
|
|
|
{{Vitamins}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{analgesic-stub}} |