| Revision as of 10:02, 21 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 461607775 of page Halazepam for the Chem/Drugbox validation project (updated: 'DrugBank'). |
Latest revision as of 13:48, 30 June 2024 edit Michael D. Turnbull (talk | contribs)Extended confirmed users13,731 edits Undid revision 1231783510 by 2.101.54.127 (talk) WP:BANREVERTTag: Undo |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 418945949 |
|
| verifiedrevid = 461743655 |
|
| IUPAC_name = 7-chloro- 5-phenyl- 1-(2,2,2-trifluoroethyl) -1,3-dihydro- 2''H''-1,4-benzodiazepin- 2-one |
|
| IUPAC_name = 7-chloro-5-phenyl-1-(2,2,2-trifluoroethyl)-3''H''-1,4-benzodiazepin-2-one |
|
| image = Halazepam.svg |
|
| image = Halazepam.svg |
|
| width = 220 |
|
| width = 170 |
|
| image2 = Halazepam3d.png |
|
| image2 = Halazepam3d.png |
|
|
| width2 = 150 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|CONS|halazepam}} |
|
| Drugs.com = {{drugs.com|CONS|halazepam}} |
|
| MedlinePlus = a684001 |
|
| MedlinePlus = a684001 |
|
| pregnancy_category = ? |
|
| pregnancy_category = ? |
|
|
| legal_BR = B1 |
|
| legal_status = ] (US) |
|
|
|
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=] |language=pt-BR |publication-date=2023-04-04}}</ref> |
|
|
| legal_CA = Schedule IV |
|
|
| legal_DE = Rx-only/Anlage III |
|
|
| legal_US = Schedule IV |
|
| routes_of_administration = Oral |
|
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = ? |
|
| bioavailability = |
|
| metabolism = ] |
|
| metabolism = ] |
|
| elimination_half-life = ? |
|
| elimination_half-life = 14 hours (halazepam), 50–100 hours (metabolites). |
|
| excretion = ] |
|
| excretion = ] |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| IUPHAR_ligand = 7195 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 23092-17-3 |
|
| CAS_number = 23092-17-3 |
| Line 40: |
Line 46: |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=17 | H=12 | Cl=1 | F=3 | N=2 | O=1 |
|
| C=17 | H=12 | Cl=1 | F=3 | N=2 | O=1 |
|
⚫ |
| smiles = FC(F)(CN1C(CN=C(C2=CC=CC=C2)C3=C1C=CC(Cl)=C3)=O)F |
|
| molecular_weight = 352.7 |
|
| ⚫ |
| smiles = FC(F)(F)CN1C(=O)C/N=C(\c2cc(Cl)ccc12)c3ccccc3 |
|
|
| InChI = 1/C17H12ClF3N2O/c18-12-6-7-14-13(8-12)16(11-4-2-1-3-5-11)22-9-15(24)23(14)10-17(19,20)21/h1-8H,9-10H2 |
|
|
| InChIKey = WYCLKVQLVUQKNZ-UHFFFAOYAZ |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C17H12ClF3N2O/c18-12-6-7-14-13(8-12)16(11-4-2-1-3-5-11)22-9-15(24)23(14)10-17(19,20)21/h1-8H,9-10H2 |
|
| StdInChI = 1S/C17H12ClF3N2O/c18-12-6-7-14-13(8-12)16(11-4-2-1-3-5-11)22-9-15(24)23(14)10-17(19,20)21/h1-8H,9-10H2 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = WYCLKVQLVUQKNZ-UHFFFAOYSA-N |
|
| StdInChIKey = WYCLKVQLVUQKNZ-UHFFFAOYSA-N |
|
| synonyms = <small>9-chloro- 6-phenyl- 2-(2,2,2-trifluoroethyl)- 2,5-diazabicyclo undeca- 5,8,10,12-tetraen -3-one</small> |
|
| synonyms = <small>9-chloro-6-phenyl-2-(2,2,2-trifluoroethyl)-2,5-diazabicycloundeca-5,8,10,12-tetraen-3-one</small> |
|
}} |
|
}} |
|
|
|
|
|
'''Halazepam''' is a ] derivative that was marketed under the brand names '''Paxipam''' in the United States,<ref name=DrugsH /> '''Alapryl''' in Spain,<ref name=DrugsA>{{cite web|title=Alapryl|url=https://www.drugs.com/international/alapryl.html|publisher=Drugs.com|access-date=December 11, 2014}}</ref> and '''Pacinone''' in Portugal.<ref name=DrugsP>{{cite web|title=Pacinone|url=https://www.drugs.com/international/pacinone.html|publisher=Drugs.com|access-date=December 11, 2014}}</ref> |
|
|
|
|
|
==Medical uses== |
|
|
Halazepam was used for the treatment of ].<ref name=DrugsH /> |
|
|
|
|
|
==Adverse effects== |
|
|
Adverse effects include drowsiness, confusion, dizziness, and sedation. Gastrointestinal side effects have also been reported including dry mouth and nausea.<ref name=DrugsH /> |
|
|
|
|
|
==Pharmacokinetics and pharmacodynamics== |
|
|
Pharmacokinetics and pharmacodynamics were listed in ''Current Psychotherapeutic Drugs'' published on June 15, 1998 as follows:<ref>{{cite book| veditors = Quitkin FM, etal | vauthors = Sellers EM | chapter = Antianxiety agents: benzodiazepine derivatives |title = Current Psychotherapeutic Drugs |date=1998|publisher=American Psychiatric Press|location=Washington|isbn=978-0-88048-994-2 |page=166|edition=2nd}}</ref> |
|
|
|
|
|
{| class="wikitable" |
|
|
|- |
|
|
| Onset of action || Intermediate to slow |
|
|
|- |
|
|
| Plasma half life || 14 hr for parent drug and 30-100 hr for its metabolite |
|
|
|- |
|
|
| Peak plasma levels || 1-3 hr for parent drug and 3-6 hf for its metabolite |
|
|
|- |
|
|
| Metabolism || Metabolized into desmethyldiazepam and 3-hydroxyhalazepam (in the liver) |
|
|
|- |
|
|
| Excretion || Excreted through kidneys |
|
|
|- |
|
|
| Protein binding|| 98% bound to plasma protein |
|
|
|} |
|
|
|
|
|
==Regulatory Information== |
|
|
Halazepam is classified as a ] ] with a corresponding code 2762 by the ] (DEA).<ref name=DEA>{{cite web|title=SCHEDULES OF CONTROLLED SUBSTANCES|url=http://www.gpo.gov/fdsys/pkg/CFR-2012-title21-vol9/xml/CFR-2012-title21-vol9-part1308.xml|publisher=Code of Federal Regulations|access-date=December 12, 2014|pages=§ 1308.14 Schedule IV|date=2012-04-01}}</ref> |
|
|
|
|
|
==Commercial production== |
|
|
Halazepam was invented by Schlesinger Walter in the U.S. It was marketed as an anti-anxiety agent in 1981. However, Halazepam is not commercially available in the United States because it was withdrawn by its manufacturer for poor sales.<ref name=DrugsH>{{cite web|title=halazepam|url=https://www.drugs.com/mtm/halazepam.html|publisher=Drugs.com|access-date=December 11, 2014}}</ref> |
|
|
|
|
|
==See also== |
|
|
*]s |
|
|
*] |
|
|
*] |
|
|
*] |
|
|
*], ], ] — benzodiazepines with ] attached |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
==External links== |
|
|
* |
|
|
|
|
|
{{Benzodiazepines}} |
|
|
{{Anxiolytics}} |
|
|
{{GABAAR PAMs}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{sedative-stub}} |