| Revision as of 13:09, 5 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456812761 of page Pindone for the Chem/Drugbox validation project (updated: 'KEGG', 'CASNo'). |
Latest revision as of 20:29, 16 July 2024 edit حسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits removed Category:Indandiones; added Category:1,3-Indandiones using HotCat |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 400853137 |
|
| verifiedrevid = 464206843 |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageFile=Pindone.png |
|
| ImageFile=Pindone Structural Formula V.1.svg |
|
|
| PIN= 2-(2,2-Dimethylpropanoyl)-1''H''-indene-1,3(2''H'')-dione |
|
|ImageSize=200px |
|
|
⚫ |
| OtherNames=2-Pivaloyl-1,3-indandione |
|
|IUPACName= 2-(2,2-Dimethyl-1-oxopropyl)indane-1,3-dione |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
|OtherNames=2-Pivaloyl-1,3-indandione |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 6476 |
|
| ChemSpiderID = 6476 |
|
| InChI = 1/C14H14O3/c1-14(2,3)13(17)10-11(15)8-6-4-5-7-9(8)12(10)16/h4-7,10H,1-3H3 |
|
| InChI = 1/C14H14O3/c1-14(2,3)13(17)10-11(15)8-6-4-5-7-9(8)12(10)16/h4-7,10H,1-3H3 |
| Line 17: |
Line 16: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = RZKYEQDPDZUERB-UHFFFAOYSA-N |
|
| StdInChIKey = RZKYEQDPDZUERB-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 83-26-1 --> |
|
| CASNo=83-26-1 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem=6732 |
|
|
|
| UNII = 2KFI1XBH7G |
|
⚫ |
| PubChem=6732 |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG = <!-- blanked - oldvalue: C19141 --> |
|
| KEGG = C19141 |
|
| SMILES = O=C2c1ccccc1C(=O)C2C(=O)C(C)(C)C |
|
| SMILES = O=C2c1ccccc1C(=O)C2C(=O)C(C)(C)C |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>14</sub>H<sub>14</sub>O<sub>3</sub> |
|
| Formula=C<sub>14</sub>H<sub>14</sub>O<sub>3</sub> |
|
| MolarMass=230.26 g/mol |
|
| MolarMass=230.26 g/mol |
|
| Appearance= |
|
| Appearance=Bright-yellow powder<ref name=PGCH/> |
|
|
| Odor = almost none |
|
| Density= |
|
| Density=1.06 g/mL |
|
| MeltingPt= |
|
|
|
| MeltingPtC=110 |
|
| BoilingPt= |
|
|
| Solubility= |
|
| BoilingPtC= |
|
|
| Solubility= 0.002% (25°C)<ref name=PGCH/> |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
|
| PEL = TWA 0.1 mg/m<sup>3</sup><ref name=PGCH>{{PGCH|0516}}</ref> |
|
|
| IDLH = 100 mg/m<sup>3</sup><ref name=PGCH/> |
|
|
| REL = TWA 0.1 mg/m<sup>3</sup><ref name=PGCH/> |
|
|
| LD50 = 280 mg/kg (rat, oral)<br/>75 mg/kg (dog, oral)<br/>150 mg/kg (rabbit, oral)<ref>{{IDLH|83261|Pindone}}</ref> |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Pindone''' is an ] ]<ref name="pmid15694595">{{cite journal |vauthors=Robinson MH, Twigg LE, Wheeler SH, Martin GR |title=Effect of the anticoagulant, pindone, on the breeding performance and survival of merino sheep, Ovis aries |journal=Comp. Biochem. Physiol. B |volume=140 |issue=3 |pages=465–73 |date=March 2005 |pmid=15694595 |doi=10.1016/j.cbpc.2004.11.011 }}</ref> for agricultural use. It is commonly used as a ] in the management of ] and ] populations. |
|
|
|
|
|
It is pharmacologically analogous to ] and inhibits the synthesis of ]-dependent ]s. |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{rodenticides}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{agri-stub}} |
|
|
{{ketone-stub}} |