| Revision as of 12:21, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 451564362 of page Terbequinil for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 23:03, 29 January 2023 edit Entranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers173,027 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 451335956 |
|
| verifiedrevid = 470602164 |
|
| IUPAC_name = 1-(methoxymethyl)-4-oxo-N-propylquinoline-3-carboxamide |
|
| IUPAC_name = 1-(methoxymethyl)-4-oxo-N-propylquinoline-3-carboxamide |
|
| image = Terbequinil_structure.png |
|
| image = Terbequinil_structure.png |
|
|
| image2 = Terbequinil 3D ball.png |
|
| width = 200 |
|
|
|
| alt2 = Ball-and-stick model of the terbequinil molecule |
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
| Line 16: |
Line 17: |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
| Line 23: |
Line 24: |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 113079-82-6 --> |
|
| CAS_number = 113079-82-6 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| PubChem = 65916 |
|
| PubChem = 65916 |
| Line 38: |
Line 40: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=15 | H=18 | N=2 | O=3 |
|
| C=15 | H=18 | N=2 | O=3 |
|
| molecular_weight = 274.315 g/mol |
|
|
| smiles = CCCNC(=O)C1=CN(C2=CC=CC=C2C1=O)COC |
|
| smiles = CCCNC(=O)C1=CN(C2=CC=CC=C2C1=O)COC |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 45: |
Line 46: |
|
| StdInChIKey = RIPDGZHPNKQLDC-UHFFFAOYSA-N |
|
| StdInChIKey = RIPDGZHPNKQLDC-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Terbequinil''' ('''SR-25776''') is a ] and ] drug which acts as a partial ] at benzodiazepine sites on the ] ]. In human trials it was found to partially reverse the ] and ] effects of the hypnotic drug ] with only slight effects when administered by itself.<ref name="pmid8091361">{{cite journal | vauthors = Warot D, Danjou P, Douillet P, Keane P, Puech AJ | title = Cognitive impairments induced by triazolam in healthy volunteers: antagonism by a partial inverse agonist of benzodiazepine receptor | journal = Therapie | volume = 49 | issue = 1 | pages = 23–6 | date = 1994 | pmid = 8091361 }}</ref> |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{GABAergics}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |