Viniferal - Misplaced Pages

Viniferal
Names

Preferred IUPAC name (2R,2′S,3R,3′S)-3′-(3,5-Dihydroxyphenyl)-6′-hydroxy-2,2′-bis(4-hydroxyphenyl)-5-carbaldehyde
Other names (−)-Viniferal
Identifiers
CAS Number	180413-42-7
3D model (JSmol)	Interactive image
ChEBI	CHEBI:169301
ChEMBL	ChEMBL469541 (underspecified stereo)
ChemSpider	26233612
PubChem CID	57518718
CompTox Dashboard (EPA)	DTXSID80727006
InChI InChI=1S/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1Key: DHTHKPNODOWMKF-VPIGGYNKSA-N InChI=1/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1Key: DHTHKPNODOWMKF-VPIGGYNKBX
SMILES O=CC1=CC=C(O(C2=CC=C(O)C=C2)3C4=CC(O)=CC5=C4(C6=CC(O)=CC(O)=C6)(C7=CC=C(O)C=C7)O5)C3=C1
Properties
Chemical formula	C₃₅H₂₆O₈
Molar mass	574.585 g·mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). Y verify (what is ?) Infobox references

Chemical compound

Viniferal is a hydroxystilbenoid with an aldehyde group found in Vitis vinifera (grapevine).

References

Ito, Junko; Niwa, Masatake (1996). "Absolute structures of new hydroxystilbenoids, vitisin C and viniferal, from Vitis vinifera 'Kyohou'". Tetrahedron. 52 (30): 9991–9998. doi:10.1016/0040-4020(96)00543-1. S2CID 97047118.

Dimers

Trimers

Tetramers:

Higher polymers
(five units or more)

Oligomeric forms
of resveratrol

Dimers	Amurensin A and H Ampelopsin A B D and F Balanocarpol Cyphostemmin A and B δ-viniferin ε-viniferin Gnetin A and C Leachinol F Malibatol A Pallidol Parthenocissin A Quadrangularin A Restrytisol A, B and C Vitisinol D
Trimers	α-viniferin Ampelopsin C Amurensin C, D and G Hopeanolin Malaysianol A Miyabenol C Resviniferin A and B trans-diptoindonesin B
Tetramers	Ampelopsin H Amurensin K Caraphenol B Carasinol B Flexuosol A Hopeaphenol Kobophenol A Miyabenol A Vaticanol B and C Vaticaphenol A Vitisin A B and C β-viniferin (cyclic resveratrol tetramer)
Pentamers	Amurensin E and F
Hexamers	Chunganenol
Higher polymers	γ-viniferin Valeriaphenol A

Glycosides or conjugates

This article about an aromatic compound is a stub. You can help Misplaced Pages by expanding it.