| Revision as of 09:43, 27 January 2011 edit130.188.8.11 (talk) added pubchem cid to chembox← Previous edit |
Latest revision as of 17:01, 30 April 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name |
| (26 intermediate revisions by 21 users not shown) |
| Line 1: |
Line 1: |
|
{{Chembox |
|
{{Chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 396322569 |
|
| verifiedrevid = 443555231 |
|
| ImageFile = CMP_chemical_structure.png |
|
| ImageFile = CMP_chemical_structure.png |
|
| ImageSize = 180px |
|
| ImageSize = 180px |
|
|
| ImageAlt = Skeletal formula of cytidine monophosphate as an anion (1- charge) |
| ⚫ |
| IUPACName = |
|
|
|
| ImageFile1 = Cytidine monophosphate anion 3D spacefill.png |
|
| OtherNames = 5'-Cytidylic acid |
|
|
|
| ImageAlt1 = Space-filling model of the cytidine monophosphate molecule as anion (2- charge) |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
⚫ |
| IUPACName = 5′-Cytidylic acid |
|
|
| SystematicName = methyl dihydrogen phosphate |
|
|
| OtherNames = Cytidylic acid; 5'-Cytidylic acid; Cytidine 5'-monophosphate; Cytidine 5'-phosphate; Cytidylate; 5'-CMP |
|
⚫ |
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 5901 |
|
| ChemSpiderID = 5901 |
|
| InChI = 1/C9H14N3O8P/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1 |
|
| InChI = 1/C9H14N3O8P/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1 |
|
| InChIKey = IERHLVCPSMICTF-XVFCMESIBY |
|
| InChIKey = IERHLVCPSMICTF-XVFCMESIBY |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 307679 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C9H14N3O8P/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1 |
|
| StdInChI = 1S/C9H14N3O8P/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)(H2,16,17,18)/t4-,6-,7-,8-/m1/s1 |
| Line 15: |
Line 22: |
|
| StdInChIKey = IERHLVCPSMICTF-XVFCMESISA-N |
|
| StdInChIKey = IERHLVCPSMICTF-XVFCMESISA-N |
|
| CASNo = 63-37-6 |
|
| CASNo = 63-37-6 |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = F469818O25 |
|
| PubChem = 6131 |
|
| PubChem = 6131 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 17361 |
|
| SMILES = c1cn(c(=O)nc1N)2(((O2)COP(=O)(O)O)O)O |
|
| SMILES = c1cn(c(=O)nc1N)2(((O2)COP(=O)(O)O)O)O |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=9 | H=14 | N=3 | O=8 | P=1 |
|
| Formula = C<sub>9</sub>H<sub>14</sub>N<sub>3</sub>O<sub>8</sub>P |
|
|
| MolarMass = 323.20 g/mol |
|
|
| Appearance = |
|
| Appearance = |
|
| pKa = 0.8, 4.5, 6.3 |
|
| pKa = 0.8, 4.5, 6.3 |
| Line 28: |
Line 38: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''Cytidine monophosphate''', also known as '''5'-cytidylic acid''' or simply '''cytidylate''', and abbreviated '''CMP''', is a ] that is found in ].<ref name="pmid18262407">{{cite journal |author=Pascal JM |title=DNA and RNA ligases: structural variations and shared mechanisms |journal=Curr. Opin. Struct. Biol. |volume=18 |issue=1 |pages=96–105 |year=2008 |month=February |pmid=18262407 |doi=10.1016/j.sbi.2007.12.008 |url=http://linkinghub.elsevier.com/retrieve/pii/S0959-440X(07)00208-4}}</ref> It is an ] of ] with the ] ]. CMP consists of the ] ], the ] ] ], and the ] ]; hence, a ]. |
|
'''Cytidine monophosphate''', also known as '''5'-cytidylic acid''' or simply '''cytidylate''', and abbreviated '''CMP''', is a ] that is used as a ] in ].<ref name="pmid18262407">{{cite journal |author=Pascal JM |title=DNA and RNA ligases: structural variations and shared mechanisms |journal=Curr. Opin. Struct. Biol. |volume=18 |issue=1 |pages=96–105 |date=February 2008 |pmid=18262407 |doi=10.1016/j.sbi.2007.12.008 }}</ref> It is an ] of ] with the ] ]. CMP consists of the ] ], the ] ] ], and the ] ]; hence, a ]. |
|
As a ] it takes the form of the prefix '''cytidylyl-'''. |
|
As a ] it takes the form of the prefix '''cytidylyl-'''. |
|
|
|
|
|
==Metabolism== |
|
==Metabolism== |
|
CMP can be phosphorylated to ] by the enzyme CMP kinase, with ] or ] donating the phosphate group. Since ] is generated by amination of ], the main source of CMP is from RNA being decomposed, eg. by ]. |
|
CMP can be phosphorylated to ] by the enzyme ], with ] or ] donating the phosphate group. Since ] is generated by amination of ], the main source of CMP is from RNA being decomposed by ]. |
|
|
|
|
==Biochemistry== |
|
|
CMP is used to activate mannose in metabolism. |
|
|
|
|
|
|
|
|
|
==See also== |
|
==See also== |
|
⚫ |
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
* ] |
| ⚫ |
* ] |
|
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist|2}} |
|
{{reflist}} |
|
|
|
|
{{-}} |
|
|
{{Nucleobases, nucleosides, and nucleotides}} |
|
{{Nucleobases, nucleosides, and nucleotides}} |
|
|
{{Purine receptor modulators}} |
|
|
|
|
|
{{DEFAULTSORT:Cytidine Monophosphate}} |
|
{{DEFAULTSORT:Cytidine Monophosphate}} |
|
|
|
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
{{Biochem-stub}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
Y verify (what is ?)
Infobox references