Evoxine: Difference between revisions

Browse history interactively ← Previous editContent deleted Content addedVisual WikitextInline

Revision as of 09:23, 3 June 2011 editرائد 1991 (talk \| contribs)139 editsNo edit summary← Previous edit		Latest revision as of 14:02, 21 January 2024 edit undoMaxim Masiutin (talk \| contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,043 edits Added bibcode.
(23 intermediate revisions by 15 users not shown)
Line 1:		Line 1:
	{{~~drugbox~~		{{Chembox
			\| Watchedfields = changed
	\| verifiedrevid = ~~414055854~~		\| verifiedrevid = 432325202
⚫	\| ~~IUPAC_name~~ = 1-(4,8-~~dimethoxyfuro~~quinolin-7-yl)oxy-3-methylbutane-2,3-diol
	\| ~~image~~ = Evoxine.~~png~~		\| ImageFile = Evoxine.svg
			\| ImageAlt =
	\| width = 200
		⚫	\| IUPACName = (±)-1-(4,8-Dimethoxyfuroquinolin-7-yl)oxy-3-methylbutane-2,3-diol
⚫	\| ~~CAS_number~~ = 522-11-2
			\| OtherNames = Haploperine
	\| ATC_prefix = none
			\|Section1={{Chembox Identifiers
	\| ATC_suffix =
		⚫	\| CASNo = 522-11-2
	\| PubChem = 73416		\| PubChem = 73416
	\| DrugBank =
			\| ChEMBL = 1416006
	\| C=11\|H=12\|O=2
		⚫	\| SMILES = CC(C)(C(COC1=C(C2=C(C=C1)C(=C3C=COC3=N2)OC)OC)O)O
	\| molecular_weight = 347.362 g/mol
			\| ChemSpiderID = 66130
⚫	\| ~~smiles~~ = CC(C)(C(COC1=C(C2=C(C=C1)C(=C3C=COC3=N2)OC)OC)O)O
			\| InChI = 1/C18H21NO6/c1-18(2,21)13(20)9-25-12-6-5-10-14(16(12)23-4)19-17-11(7-8-24-17)15(10)22-3/h5-8,13,20-21H,9H2,1-4H3
	\| bioavailability =
			\| InChIKey = FGANMDNHTVJAHL-UHFFFAOYAV
	\| protein_bound =
			\| StdInChI = 1S/C18H21NO6/c1-18(2,21)13(20)9-25-12-6-5-10-14(16(12)23-4)19-17-11(7-8-24-17)15(10)22-3/h5-8,13,20-21H,9H2,1-4H3
	\| metabolism =
			\| StdInChIKey = FGANMDNHTVJAHL-UHFFFAOYSA-N}}
	\| elimination_half-life =
			\|Section2={{Chembox Properties
	\| excretion =
			\| C=18 \| H=21 \| N=1 \| O=6
	\| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
			\| Appearance =
	\| pregnancy_US = <!-- A / B / C / D / X -->
			\| Density =
	\| pregnancy_category=
			\| MeltingPt =
	\| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
			\| BoilingPt =
	\| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
			\| Solubility = }}
	\| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
			\|Section3={{Chembox Hazards
	\| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
			\| MainHazards =
	\| legal_status = Legal
			\| FlashPt =
	\| routes_of_administration =
			\| AutoignitionPt = }}
			\|Section5={{Chembox Pharmacology
			\| ATCCode_prefix = none

			\| AdminRoutes =
			\| Bioavail =
			\| Metabolism =
			\| HalfLife =
			\| ProteinBound =
			\| Excretion =
			\| Legal_status =
			\| Legal_US =
			\| Legal_UK =
			\| Legal_AU =
			\| Legal_CA =
			\| Pregnancy_category =
			\| Pregnancy_AU =
			}}
	}}		}}

	'''Evoxine''' ('''~~Haploperine~~''') is an ] with ] and ] effects. It is found naturally in a variety of Australian and African plants including '']''<ref>{{cite journal \| doi = 10.1071/CH9540087 \| last1 = Eastwood \| first1 = FW \| last2 = Hughes \| first2 = GK \| last3 = Ritchie \| first3 = E. \| year = 1954 \| title = Alkaloids of the Australian Rutaceae: Evodia xanthoxyloides F.Muell. IV. The structures of Evoxine and Evoxoidine ~~\| url =~~ \| journal = Australian Journal of Chemistry \| volume = 7 \| issue = 1\| pages = 87–98 }}</ref> and '']''.<ref>{{cite journal \| last1 = Waffo \| first1 = AF \| last2 = Coombes \| first2 = PH \| last3 = Crouch \| first3 = NR \| last4 = Mulholland \| first4 = DA \| last5 = El Amin \| first5 = SM \| last6 = Smith \| first6 = PJ \| title = Acridone and furoquinoline alkaloids from Teclea gerrardii (Rutaceae: Toddalioideae) of southern Africa. \| journal = Phytochemistry \| volume = 68 \| issue = 5 \| pages = 663–7 \| year = 2007 \| pmid = 17174364 \| doi = 10.1016/j.phytochem.2006.10.011 }}</ref>		'''Evoxine''' ('''haploperine''') is a ] with ] and ] effects. It is found naturally in a variety of Australian and African plants including '']''<ref>{{cite journal \| doi = 10.1071/CH9540087 \| last1 = Eastwood \| first1 = FW \| last2 = Hughes \| first2 = GK \| last3 = Ritchie \| first3 = E. \| year = 1954 \| title = Alkaloids of the Australian Rutaceae: Evodia xanthoxyloides F.Muell. IV. The structures of Evoxine and Evoxoidine \| journal = Australian Journal of Chemistry \| volume = 7 \| issue = 1\| pages = 87–98 }}</ref> and '']''.<ref>{{cite journal \| last1 = Waffo \| first1 = AF \| last2 = Coombes \| first2 = PH \| last3 = Crouch \| first3 = NR \| last4 = Mulholland \| first4 = DA \| last5 = El Amin \| first5 = SM \| last6 = Smith \| first6 = PJ \| title = Acridone and furoquinoline alkaloids from Teclea gerrardii (Rutaceae: Toddalioideae) of southern Africa. \| journal = Phytochemistry \| volume = 68 \| issue = 5 \| pages = 663–7 \| year = 2007 \| pmid = 17174364 \| doi = 10.1016/j.phytochem.2006.10.011 \| bibcode = 2007PChem..68..663K }}</ref>

	==References==		==References==
Line 37:		Line 55:
	]		]
	]		]
	]		]
	]		]
	]		]
			]
	]

Latest revision as of 14:02, 21 January 2024

Evoxine
Names

IUPAC name (±)-1-(4,8-Dimethoxyfuroquinolin-7-yl)oxy-3-methylbutane-2,3-diol
Other names Haploperine
Identifiers
CAS Number	522-11-2
3D model (JSmol)	Interactive image
ChEMBL	ChEMBL1416006
ChemSpider	66130
PubChem CID	73416
CompTox Dashboard (EPA)	DTXSID801028138
InChI InChI=1S/C18H21NO6/c1-18(2,21)13(20)9-25-12-6-5-10-14(16(12)23-4)19-17-11(7-8-24-17)15(10)22-3/h5-8,13,20-21H,9H2,1-4H3Key: FGANMDNHTVJAHL-UHFFFAOYSA-N InChI=1/C18H21NO6/c1-18(2,21)13(20)9-25-12-6-5-10-14(16(12)23-4)19-17-11(7-8-24-17)15(10)22-3/h5-8,13,20-21H,9H2,1-4H3Key: FGANMDNHTVJAHL-UHFFFAOYAV
SMILES CC(C)(C(COC1=C(C2=C(C=C1)C(=C3C=COC3=N2)OC)OC)O)O
Properties
Chemical formula	C₁₈H₂₁NO₆
Molar mass	347.367 g·mol
Pharmacology
ATC code	none
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). Y verify (what is ?) Infobox references

Chemical compound

Evoxine (haploperine) is a furoquinoline alkaloid with hypnotic and sedative effects. It is found naturally in a variety of Australian and African plants including Evodia xanthoxyloides and Teclea gerrardii.

References

Eastwood, FW; Hughes, GK; Ritchie, E. (1954). "Alkaloids of the Australian Rutaceae: Evodia xanthoxyloides F.Muell. IV. The structures of Evoxine and Evoxoidine". Australian Journal of Chemistry. 7 (1): 87–98. doi:10.1071/CH9540087.
Waffo, AF; Coombes, PH; Crouch, NR; Mulholland, DA; El Amin, SM; Smith, PJ (2007). "Acridone and furoquinoline alkaloids from Teclea gerrardii (Rutaceae: Toddalioideae) of southern Africa". Phytochemistry. 68 (5): 663–7. Bibcode:2007PChem..68..663K. doi:10.1016/j.phytochem.2006.10.011. PMID 17174364.

Hypnotics/sedatives (N05C)

GABA_A

Alcohols	2M2B Chloralodol Ethanol (alcohol) Diethylpropanediol Ethchlorvynol Methylpentynol Trichloroethanol
Barbiturates	Allobarbital Amobarbital Aprobarbital Barbital Butabarbital Butobarbital Cyclobarbital Ethallobarbital Heptabarb Hexobarbital Mephobarbital Methohexital Narcobarbital Pentobarbital Phenallymal Phenobarbital Propylbarbital Proxibarbal Reposal Secobarbital Talbutal Thiamylal Thiopental Thiotetrabarbital Vinbarbital Vinylbital
Benzodiazepines	Brotizolam Cinolazepam Climazolam Clonazolam Doxefazepam Estazolam Flubromazolam Flunitrazolam Flunitrazepam Flurazepam Flutemazepam Flutoprazepam Loprazolam Lormetazepam Midazolam Nimetazepam Nitemazepam Nitrazepam Nitrazolam Quazepam Temazepam Triazolam
Carbamates	Carisoprodol Emylcamate Ethinamate Hexapropymate Meprobamate Methocarbamol Phenprobamate Procymate Tybamate
Imidazoles	Etomidate Metomidate Propoxate
Monoureides	Acecarbromal Apronal (apronalide) Bromisoval Capuride Carbromal Ectylurea
Neuroactive steroids	Acebrochol Allopregnanolone Alphadolone Alphaxolone Eltanolone Hydroxydione Minaxolone Progesterone
Nonbenzodiazepines	Eszopiclone Indiplon Lirequinil Necopidem Pazinaclone Saripidem Suproclone Suriclone Zaleplon Zolpidem Zopiclone
Phenols	Propofol
Piperidinediones	Glutethimide Methyprylon Pyrithyldione Piperidione
Quinazolinones	Afloqualone Cloroqualone Diproqualone Etaqualone Mebroqualone Mecloqualone Methaqualone Methylmethaqualone Nitromethaqualone SL-164
Others	Acetophenone Acetylglycinamide chloral hydrate Bromide compounds Lithium bromide Potassium bromide Sodium bromide Centalun Chloral betaine Chloral hydrate Chloralose Clomethiazole Dichloralphenazone Gaboxadol Kavalactones Loreclezole Paraldehyde Petrichloral Sulfonylalkanes Sulfonmethane (sulfonal) Tetronal Trional Triclofos Sesquiterpene Isovaleramide Isovaleric acid Valerenic acid

GABA_B

H₁

Antihistamines	Captodiame Cyproheptadine Diphenhydramine Doxylamine Hydroxyzine Methapyrilene Perlapine Pheniramine Promethazine Propiomazine
Antidepressants	Serotonin antagonists and reuptake inhibitors Etoperidone Nefazodone Trazodone Tricyclic antidepressants Amitriptyline Doxepin Trimipramine, etc. Tetracyclic antidepressants Mianserin Mirtazapine, etc.
Antipsychotics	Typical antipsychotics Chlorpromazine Thioridazine, etc. Atypical antipsychotics Olanzapine Quetiapine Risperidone, etc.

α₂-Adrenergic

5-HT_2A

Antidepressants	Trazodone Tricyclic antidepressants Amitriptyline Doxepin Trimipramine, etc. Tetracyclic antidepressants Mianserin Mirtazapine, etc.
Antipsychotics	Typical antipsychotics Chlorpromazine Thioridazine, etc. Atypical antipsychotics Olanzapine Quetiapine Risperidone, etc.
Others	Niaprazine

Melatonin

Orexin

α₂δ VDCC

Others

This sedative-related article is a stub. You can help Misplaced Pages by expanding it.

Categories: