Misplaced Pages

Dimiracetam: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 19:58, 14 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia_talk:WikiProject_Che← Previous edit Revision as of 17:53, 7 October 2011 edit undoRjwilmsi (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers932,073 editsm Journal cites:, added 1 DOI, using AWB (7844)Next edit →
Line 50: Line 50:
}} }}


'''Dimiracetam''' is a ] drug of the ] family,<ref>{{cite journal | last1 = Pinza | first1 = M | last2 = Farina | first2 = C | last3 = Cerri | first3 = A | last4 = Pfeiffer | first4 = U | last5 = Riccaboni | first5 = MT | last6 = Banfi | first6 = S | last7 = Biagetti | first7 = R | last8 = Pozzi | first8 = O | last9 = Magnani | first9 = M | title = Synthesis and pharmacological activity of a series of dihydro-1H-pyrrolo1,2-aimidazole-2,5(3H,6H)-diones, a novel class of potent cognition enhancers | journal = Journal of medicinal chemistry | volume = 36 | issue = 26 | pages = 4214–20 | year = 1993 | pmid = 8277504 }}</ref> derivatives of which may have application in the treatment of ].<ref>{{cite journal | last1 = Farina | first1 = C | last2 = Gagliardi | first2 = S | last3 = Ghelardini | first3 = C | last4 = Martinelli | first4 = M | last5 = Norcini | first5 = M | last6 = Parini | first6 = C | last7 = Petrillo | first7 = P | last8 = Ronzoni | first8 = S | title = Synthesis and biological evaluation of novel dimiracetam derivatives useful for the treatment of neuropathic pain | journal = Bioorganic & medicinal chemistry | volume = 16 | issue = 6 | pages = 3224–32 | year = 2008 | pmid = 18171618 | doi = 10.1016/j.bmc.2007.12.015 }}</ref> '''Dimiracetam''' is a ] drug of the ] family,<ref>{{cite journal | last1 = Pinza | first1 = M | last2 = Farina | first2 = C | last3 = Cerri | first3 = A | last4 = Pfeiffer | first4 = U | last5 = Riccaboni | first5 = MT | last6 = Banfi | first6 = S | last7 = Biagetti | first7 = R | last8 = Pozzi | first8 = O | last9 = Magnani | first9 = M | title = Synthesis and pharmacological activity of a series of dihydro-1H-pyrrolo1,2-aimidazole-2,5(3H,6H)-diones, a novel class of potent cognition enhancers | journal = Journal of medicinal chemistry | volume = 36 | issue = 26 | pages = 4214–20 | year = 1993 | pmid = 8277504 | doi=10.1021/jm00078a011}}</ref> derivatives of which may have application in the treatment of ].<ref>{{cite journal | last1 = Farina | first1 = C | last2 = Gagliardi | first2 = S | last3 = Ghelardini | first3 = C | last4 = Martinelli | first4 = M | last5 = Norcini | first5 = M | last6 = Parini | first6 = C | last7 = Petrillo | first7 = P | last8 = Ronzoni | first8 = S | title = Synthesis and biological evaluation of novel dimiracetam derivatives useful for the treatment of neuropathic pain | journal = Bioorganic & medicinal chemistry | volume = 16 | issue = 6 | pages = 3224–32 | year = 2008 | pmid = 18171618 | doi = 10.1016/j.bmc.2007.12.015 }}</ref>


==References== ==References==

Revision as of 17:53, 7 October 2011

Dimiracetam
Names
IUPAC name (RS)-3,6,7,7a-tetrahydro-1H-pyrroloimidazole-2,5-dione
Identifiers
CAS Number
3D model (JSmol)
ChEMBL
ChemSpider
PubChem CID
CompTox Dashboard (EPA)
InChI
  • InChI=1S/C6H8N2O2/c9-5-3-8-4(7-5)1-2-6(8)10/h4H,1-3H2,(H,7,9)Key: XTXXOHPHLNROBN-UHFFFAOYSA-N
  • InChI=1/C6H8N2O2/c9-5-3-8-4(7-5)1-2-6(8)10/h4H,1-3H2,(H,7,9)Key: XTXXOHPHLNROBN-UHFFFAOYAX
SMILES
  • C1CC(=O)N2C1NC(=O)C2
  • O=C2NC1N(C(=O)CC1)C2
Properties
Chemical formula C6H8N2O2
Molar mass 140.140 g/mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkY verify (what is  ?) Infobox references
Chemical compound

Dimiracetam is a nootropic drug of the racetam family, derivatives of which may have application in the treatment of neuropathic pain.

References

  1. Pinza, M; Farina, C; Cerri, A; Pfeiffer, U; Riccaboni, MT; Banfi, S; Biagetti, R; Pozzi, O; Magnani, M (1993). "Synthesis and pharmacological activity of a series of dihydro-1H-pyrrolo1,2-aimidazole-2,5(3H,6H)-diones, a novel class of potent cognition enhancers". Journal of medicinal chemistry. 36 (26): 4214–20. doi:10.1021/jm00078a011. PMID 8277504.
  2. Farina, C; Gagliardi, S; Ghelardini, C; Martinelli, M; Norcini, M; Parini, C; Petrillo, P; Ronzoni, S (2008). "Synthesis and biological evaluation of novel dimiracetam derivatives useful for the treatment of neuropathic pain". Bioorganic & medicinal chemistry. 16 (6): 3224–32. doi:10.1016/j.bmc.2007.12.015. PMID 18171618.
Racetams
Racetams
Phenylpiracetams
Racetam-like


Stub icon

This drug article relating to the nervous system is a stub. You can help Misplaced Pages by expanding it.

Categories: