| Revision as of 17:23, 5 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report ← Previous edit | Revision as of 15:59, 26 December 2013 edit undoAnypodetos (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers, Rollbackers39,350 edits Refs; SMILESNext edit → | ||
| Line 28: | Line 28: | ||
| | ATC_prefix = R05 | | ATC_prefix = R05 | ||
| | ATC_suffix = CB11 | | ATC_suffix = CB11 | ||
| ⚫ | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| ⚫ | | StdInChI = 1S/C10H11NO4S2/c1-6(9(14)11-5-8(12)13)17-10(15)7-3-2-4-16-7/h2-4,6H,5H2,1H3,(H,11,14)(H,12,13) | ||
| ⚫ | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| ⚫ | | StdInChIKey = JNYSEDHQJCOWQU-UHFFFAOYSA-N | ||
| | PubChem = 54120 | | PubChem = 54120 | ||
| | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | ||
| Line 45: | Line 41: | ||
| | C=10 | H=11 | N=1 | O=4 | S=2 | | C=10 | H=11 | N=1 | O=4 | S=2 | ||
| | molecular_weight = 273.331 g/mol | | molecular_weight = 273.331 g/mol | ||
| | smiles = CC(C(=O)NCC(=O)O)SC(=O)C1=CC=CS1 | |||
| ⚫ | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| ⚫ | | StdInChI = 1S/C10H11NO4S2/c1-6(9(14)11-5-8(12)13)17-10(15)7-3-2-4-16-7/h2-4,6H,5H2,1H3,(H,11,14)(H,12,13) | ||
| ⚫ | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| ⚫ | | StdInChIKey = JNYSEDHQJCOWQU-UHFFFAOYSA-N | ||
| }} | }} | ||
| '''Stepronin''' is a ]. | '''Stepronin''' is a ]<ref>{{pmid|3843171}}</ref> and ].<ref>{{pmid|8177972}}</ref> | ||
| ==References== | |||
| {{reflist}} | |||
| {{Cough and cold preparations}} | {{Cough and cold preparations}} | ||
Revision as of 15:59, 26 December 2013
{{Drugbox | verifiedrevid = 447817179 | IUPAC_name = N-{2-propanoyl}glycine | image = Stepronin.svg
| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CASNo_Ref = | CAS_number = 72324-18-6 | ATC_prefix = R05 | ATC_suffix = CB11 | PubChem = 54120 | DrugBank_Ref = | DrugBank = DB01423 | ChemSpiderID_Ref = | ChemSpiderID = 48889 | UNII_Ref = | UNII = 0NOY894QRB | KEGG_Ref = | KEGG = D07381
| C=10 | H=11 | N=1 | O=4 | S=2 | molecular_weight = 273.331 g/mol | smiles = CC(C(=O)NCC(=O)O)SC(=O)C1=CC=CS1 | StdInChI_Ref = | StdInChI = 1S/C10H11NO4S2/c1-6(9(14)11-5-8(12)13)17-10(15)7-3-2-4-16-7/h2-4,6H,5H2,1H3,(H,11,14)(H,12,13) | StdInChIKey_Ref = | StdInChIKey = JNYSEDHQJCOWQU-UHFFFAOYSA-N }} Stepronin is a mucolytic and expectorant.
References
 | This drug article relating to the respiratory system is a stub. You can help Misplaced Pages by expanding it. |