| Revision as of 05:50, 5 June 2017 editMesospheric (talk | contribs)Extended confirmed users1,536 editsm Changed formatting of IUPAC name with WBR tags← Previous edit | Revision as of 15:25, 11 September 2017 edit undoVerdy p (talk | contribs)Extended confirmed users13,388 edits no spaces in the IUPAC name, and "wbr" tag has no effect near ()-, punctuations where it is implicitTag: nowiki addedNext edit → | ||
| Line 7: | Line 7: | ||
| | ImageFile2 = Rafinosa-3D.png | | ImageFile2 = Rafinosa-3D.png | ||
| | ImageSize = 275px | | ImageSize = 275px | ||
| | IUPACName = <small>(''2R,3R,4S,5S,6R'')-2-oxy-6-oxymethyl] |
| IUPACName = <small>(''2R,3R,4S,5S,6R'')-2-oxy-6-oxymethyl]oxane-3,4,5-triol</small>| OtherNames = Melitose<br>Melitriose<br>Gossypose<br>α-D-Galactosylsucrose | ||
| |Section1={{Chembox Identifiers | |Section1={{Chembox Identifiers | ||
| | Abbreviations = | | Abbreviations = | ||
| | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
| | ChemSpiderID = 388379 | | ChemSpiderID = 388379 | ||
| | ChEMBL_Ref = {{ebicite|changed|EBI}} | | ChEMBL_Ref = {{ebicite|changed|EBI}} | ||
| | ChEMBL = 223844 | | ChEMBL = 223844 | ||
| | InChI = 1S/C18H32O16/c19-1-5-8(22)11(25)13(27)16(31-5)30-3-7-9(23)12(26)14(28)17(32-7)34-18(4-21)15(29)10(24)6(2-20)33-18/h5-17,19-29H,1-4H2/t5-,6-,7-,8+,9-,10-,11+,12+,13-,14-,15+,16+,17-,18+/m1/s1 | | InChI = 1S/C18H32O16/c19-1-5-8(22)11(25)13(27)16(31-5)30-3-7-9(23)12(26)14(28)17(32-7)34-18(4-21)15(29)10(24)6(2-20)33-18/h5-17,19-29H,1-4H2/t5-,6-,7-,8+,9-,10-,11+,12+,13-,14-,15+,16+,17-,18+/m1/s1 | ||
| | InChIKey = MUPFEKGTMRGPLJ-ZQSKZDJDBO | | InChIKey = MUPFEKGTMRGPLJ-ZQSKZDJDBO | ||
| | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| | StdInChI = 1S/C18H32O16/c19-1-5-8(22)11(25)13(27)16(31-5)30-3-7-9(23)12(26)14(28)17(32-7)34-18(4-21)15(29)10(24)6(2-20)33-18/h5-17,19-29H,1-4H2/t5-,6-,7-,8+,9-,10-,11+,12+,13-,14-,15+,16+,17-,18+/m1/s1 | | StdInChI = 1S/C18H32O16/c19-1-5-8(22)11(25)13(27)16(31-5)30-3-7-9(23)12(26)14(28)17(32-7)34-18(4-21)15(29)10(24)6(2-20)33-18/h5-17,19-29H,1-4H2/t5-,6-,7-,8+,9-,10-,11+,12+,13-,14-,15+,16+,17-,18+/m1/s1 | ||
| | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| | StdInChIKey = MUPFEKGTMRGPLJ-ZQSKZDJDSA-N | | StdInChIKey = MUPFEKGTMRGPLJ-ZQSKZDJDSA-N | ||
| | InChIKey1 = MUPFEKGTMRGPLJ-ZQSKZDJDSA-N | | InChIKey1 = MUPFEKGTMRGPLJ-ZQSKZDJDSA-N | ||
| | CASNo_Ref = {{cascite|correct|CAS}} | | CASNo_Ref = {{cascite|correct|CAS}} | ||
| | CASNo = 512-69-6 | | CASNo = 512-69-6 | ||
| | CASNo2_Ref = {{cascite|changed|??}} | | CASNo2_Ref = {{cascite|changed|??}} | ||
| | CASNo2 = 17629-30-0 | | CASNo2 = 17629-30-0 | ||
| | CASNo2_Comment = (pentahydrate) | | CASNo2_Comment = (pentahydrate) | ||
| | EINECS = | | EINECS = | ||
| | PubChem = 439242 | | PubChem = 439242 | ||
| | UNII_Ref = {{fdacite|correct|FDA}} | | UNII_Ref = {{fdacite|correct|FDA}} | ||
| | UNII = N5O3QU595M | | UNII = N5O3QU595M | ||
| | SMILES = C(1((((O1)OC2((((O2)O3((((O3)CO)O)O)CO)O)O)O)O)O)O)O | | SMILES = C(1((((O1)OC2((((O2)O3((((O3)CO)O)O)CO)O)O)O)O)O)O)O | ||
| | RTECS = | | RTECS = | ||
| | MeSHName = | | MeSHName = | ||
| | ChEBI_Ref = {{ebicite|correct|EBI}} | | ChEBI_Ref = {{ebicite|correct|EBI}} | ||
| | ChEBI = 16634 | | ChEBI = 16634 | ||
| | KEGG = | | KEGG = | ||
| }} | }} | ||
| |Section2={{Chembox Properties | |Section2={{Chembox Properties | ||
| | Formula = C<sub>18</sub>H<sub>32</sub>O<sub>16</sub> | | Formula = C<sub>18</sub>H<sub>32</sub>O<sub>16</sub> | ||
| | MolarMass = 504.42 g/mol | | MolarMass = 504.42 g/mol | ||
| | Appearance = | | Appearance = | ||
| | Density = | | Density = | ||
| | MeltingPt = 118 °C | | MeltingPt = 118 °C | ||
| | MeltingPt_notes = | | MeltingPt_notes = | ||
| | BoilingPt = | | BoilingPt = | ||
| | BoilingPt_notes = | | BoilingPt_notes = | ||
| | Solubility = | | Solubility = | ||
| | SolubleOther = | | SolubleOther = | ||
| | Solvent = | | Solvent = | ||
| | pKa = | | pKa = | ||
| | pKb = | | pKb = | ||
| }} | }} | ||
| |Section7={{Chembox Hazards | |Section7={{Chembox Hazards | ||
| | EUClass = | | EUClass = | ||
| | MainHazards = | | MainHazards = | ||
| | NFPA-H = | | NFPA-H = | ||
| | NFPA-F = | | NFPA-F = | ||
| | NFPA-R = | | NFPA-R = | ||
| | NFPA-S = | | NFPA-S = | ||
| | RPhrases = | | RPhrases = | ||
| | SPhrases = | | SPhrases = | ||
| | RSPhrases = | | RSPhrases = | ||
| | FlashPt = | | FlashPt = | ||
| | AutoignitionPt = | | AutoignitionPt = | ||
| | ExploLimits = | | ExploLimits = | ||
| | PEL = | | PEL = | ||
| }} | }} | ||
| }} | }} | ||
Revision as of 15:25, 11 September 2017
 | This article needs additional citations for verification. Please help improve this article by adding citations to reliable sources. Unsourced material may be challenged and removed. Find sources: "Raffinose" – news · newspapers · books · scholar · JSTOR (April 2015) (Learn how and when to remove this message) |
| |
| |
| Names | |
|---|---|
| IUPAC name (2R,3R,4S,5S,6R)-2-oxy-6-oxymethyl]oxane-3,4,5-triol | |
| Other names
Melitose Melitriose Gossypose α-D-Galactosylsucrose | |
| Identifiers | |
| CAS Number |
|
| 3D model (JSmol) | |
| ChEBI | |
| ChEMBL | |
| ChemSpider | |
| ECHA InfoCard | 100.007.407 
|
| PubChem CID | |
| UNII | |
| CompTox Dashboard (EPA) | |
InChI
| |
SMILES
| |
| Properties | |
| Chemical formula | C18H32O16 |
| Molar mass | 504.42 g/mol |
| Melting point | 118 °C |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa).
 N verify (what is ?)
Infobox references
| |
Raffinose is a trisaccharide composed of galactose, glucose, and fructose. It can be found in beans, cabbage, brussels sprouts, broccoli, asparagus, other vegetables, and whole grains. Raffinose can be hydrolyzed to D-galactose and sucrose by the enzyme α-galactosidase (α-GAL), an enzyme not found in the human digestive tract. α-GAL also hydrolyzes other α-galactosides such as stachyose, verbascose, and galactinol, if present. The enzyme does not cleave β-linked galactose, as in lactose.
The raffinose family of oligosaccharides (RFOs) are alpha-galactosyl derivatives of sucrose, and the most common are the trisaccharide raffinose, the tetrasaccharide stachyose, and the pentasaccharide verbascose. RFOs are almost ubiquitous in the plant kingdom, being found in a large variety of seeds from many different families, and they rank second only to sucrose in abundance as soluble carbohydrates.
Humans and other monogastric animals (pigs and poultry) do not possess the α-GAL enzyme to break down RFOs and these oligosaccharides pass undigested through the stomach and upper intestine. In the lower intestine, they are fermented by gas-producing bacteria that do possess the α-GAL enzyme and make carbon dioxide, methane or hydrogen—leading to the flatulence commonly associated with eating beans and other vegetables. α-GAL is present in digestive aids such as the product Beano.
Procedures concerning cryopreservation have used raffinose to provide hypertonicity for cell desiccation prior to freezing. Either raffinose or sucrose is used as a base substance for sucralose.
See also
References
- Storey B., Noiles, E., Thompson, K. (1998). "Comparison of Glycerol, Other Polyols, Trehalose, and Raffinose to Provide a Defined Cryoprotectant Medium for Mouse Sperm Cryopreservation". Cryobiology. 37 (1): 46–58. doi:10.1006/cryo.1998.2097. PMID 9698429.
{{cite journal}}: CS1 maint: multiple names: authors list (link)
| Types of carbohydrates | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| General | |||||||||||||||
| Geometry | |||||||||||||||
| Monosaccharides |
| ||||||||||||||
| Multiple |
| ||||||||||||||
