Mitoguazone: Difference between revisions

Browse history interactively ← Previous editContent deleted Content addedVisual WikitextInline

Revision as of 02:58, 14 August 2011 editCheMoBot (talk \| contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation ← Previous edit		Latest revision as of 23:32, 5 April 2023 edit undoEntranced98 (talk \| contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,831 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper
(10 intermediate revisions by 9 users not shown)
Line 1:		Line 1:
			{{Short description\|Chemical compound}}
	{{drugbox
			{{Drugbox
			\| Verifiedfields = changed
			\| Watchedfields = changed
		⚫	\| verifiedrevid = 444738923
		⚫	\| IUPAC_name = (2''E'',2<nowiki>'</nowiki>''E'')-2,2'-(1''E'',2''E'')-propane-1,2-diylidenedihydrazinecarboximidamide
		⚫	\| image = mitoguazone.png
		⚫	\| image2 = mitoguazone_sf.gif

			<!--Clinical data-->
			\| tradename =
		⚫	\| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
		⚫	\| pregnancy_US = <!-- A / B / C / D / X -->
		⚫	\| pregnancy_category =
		⚫	\| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
		⚫	\| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
		⚫	\| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
		⚫	\| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
		⚫	\| legal_status =
		⚫	\| routes_of_administration =

			<!--Pharmacokinetic data-->
		⚫	\| bioavailability =
		⚫	\| protein_bound =
		⚫	\| metabolism =
		⚫	\| elimination_half-life =
		⚫	\| excretion =

			<!--Identifiers-->
			\| CAS_number_Ref = {{cascite\|correct\|??}}
		⚫	\| CAS_number = 459-86-9
		⚫	\| ATC_prefix = L01
		⚫	\| ATC_suffix = XX16
		⚫	\| PubChem = 5351154
		⚫	\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
		⚫	\| DrugBank =
	\| UNII_Ref = {{fdacite\|correct\|FDA}}		\| UNII_Ref = {{fdacite\|correct\|FDA}}
	\| UNII = OD5Q0L447W		\| UNII = OD5Q0L447W
⚫	\| verifiedrevid = ~~443518984~~
⚫	\| IUPAC_name = (2''E'',2<nowiki>'</nowiki>''E'')-2,2'-(1''E'',2''E'')-propane-1,2-diylidenedihydrazinecarboximidamide
⚫	\|synonyms = <small>2-<nowiki>amino]guanidine</small>
⚫	\| image = mitoguazone.png
⚫	\| image2 = mitoguazone_sf.gif
⚫	\| CAS_number = 459-86-9
⚫	\| ATC_prefix = L01
⚫	\| ATC_suffix = XX16
⚫	\| PubChem = 5351154
⚫	\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
⚫	\| DrugBank =
	\| KEGG_Ref = {{keggcite\|correct\|kegg}}		\| KEGG_Ref = {{keggcite\|correct\|kegg}}
	\| KEGG = D07258		\| KEGG = D07258
			\| ChEBI_Ref = {{ebicite\|changed\|EBI}}
⚫	\| C=5\|H=12\|N=8
			\| ChEBI = 43996
	\| molecular_weight = 184.20 g/mol
			\| ChemSpiderID_Ref = {{chemspidercite\|changed\|chemspider}}
⚫	\| bioavailability =
			\| ChemSpiderID = 4508218
⚫	\| protein_bound =
⚫	\| metabolism =
⚫	\| elimination_half-life =
⚫	\| excretion =
⚫	\| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
⚫	\| pregnancy_US = <!-- A / B / C / D / X -->
⚫	\| pregnancy_category=
⚫	\| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
⚫	\| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
⚫	\| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
⚫	\| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
⚫	\| legal_status =
⚫	\| routes_of_administration =
⚫	}}

			<!--Chemical data-->
	'''Mitoguazone''' (also known as methylglyoxal bis(guanylhydrazone) or MGBG) is a drug used in ].
		⚫	\| C=5 \| H=12 \| N=8
		⚫	\| synonyms = <small>2-<nowiki>amino]guanidine</small>
			\| smiles = C\C(\C=N\NC(N)=N)=N/NC(N)=N
			\| StdInChI_Ref = {{stdinchicite\|changed\|chemspider}}
			\| StdInChI = 1S/C5H12N8/c1-3(11-13-5(8)9)2-10-12-4(6)7/h2H,1H3,(H4,6,7,12)(H4,8,9,13)/b10-2+,11-3+
			\| StdInChIKey_Ref = {{stdinchicite\|changed\|chemspider}}
			\| StdInChIKey = PKDBCJSWQUOKDO-UHFFFAOYSA-M
		⚫	}}

			'''Mitoguazone''' (also known as methylglyoxal bis(guanylhydrazone) or MGBG) is a drug used in ].<ref name="pmid2655552">{{cite journal \| vauthors = Hoffmann H, Gutsche W, Amlacher R, Schulze W, Werner W, Lenk H, Wohlrab W, Haupt E \| title = \| language = German \| journal = Archiv für Geschwulstforschung \| volume = 59 \| issue = 2 \| pages = 135–48 \| date = 1989 \| pmid = 2655552 \| doi = \| url = }}</ref>

			== References ==
			{{Reflist}}

	{{Chemotherapeutic agents}}		{{Chemotherapeutic agents}}

Latest revision as of 23:32, 5 April 2023

Chemical compound Pharmaceutical compound

Mitoguazone
Clinical data


Other names	2-amino]guanidine
ATC code	L01XX16 (WHO)
Identifiers
IUPAC name (2E,2'E)-2,2'-(1E,2E)-propane-1,2-diylidenedihydrazinecarboximidamide
CAS Number	459-86-9
PubChem CID	5351154
ChemSpider	4508218
UNII	OD5Q0L447W
KEGG	D07258
ChEBI	CHEBI:43996
CompTox Dashboard (EPA)	DTXSID70861943
ECHA InfoCard	100.121.515
Chemical and physical data
Formula	C₅H₁₂N₈
Molar mass	184.207 g·mol
3D model (JSmol)	Interactive image
SMILES C\C(\C=N\NC(N)=N)=N/NC(N)=N
InChI InChI=1S/C5H12N8/c1-3(11-13-5(8)9)2-10-12-4(6)7/h2H,1H3,(H4,6,7,12)(H4,8,9,13)/b10-2+,11-3+ Key:PKDBCJSWQUOKDO-UHFFFAOYSA-M
(what is this?) (verify)

Mitoguazone (also known as methylglyoxal bis(guanylhydrazone) or MGBG) is a drug used in chemotherapy.

References

Hoffmann H, Gutsche W, Amlacher R, Schulze W, Werner W, Lenk H, Wohlrab W, Haupt E (1989). "". Archiv für Geschwulstforschung (in German). 59 (2): 135–48. PMID 2655552.

Intracellular chemotherapeutic agents / antineoplastic agents (L01)

SPs/MIs
(M phase)

Block microtubule assembly	Vinca alkaloids (Vinblastine Vincristine Vindesine Vinflunine Vinorelbine)
Block microtubule disassembly	Taxanes (Cabazitaxel Docetaxel Larotaxel Ortataxel Paclitaxel Tesetaxel) Epothilones (Ixabepilone)

DNA replication
inhibitor

DNA precursors/
antimetabolites
(S phase)

Folic acid	Dihydrofolate reductase inhibitor (Aminopterin Methotrexate Pemetrexed Pralatrexate) Thymidylate synthase inhibitor (Pemetrexed Raltitrexed)
Purine	Adenosine deaminase inhibitor (Pentostatin) Halogenated/ribonucleotide reductase inhibitors (Cladribine Clofarabine Fludarabine) Nelarabine Rabacfosadine Thiopurine (Mercaptopurine Tioguanine)
Pyrimidine	Thymidylate synthase inhibitor (Capecitabine Carmofur Doxifluridine Floxuridine Fluorouracil Tegafur (+gimeracil/oteracil)) DNA polymerase inhibitor (Cytarabine +daunorubicin) Ribonucleotide reductase inhibitor (Gemcitabine) Hypomethylating agent (Azacitidine Decitabine)
Deoxyribonucleotide	Ribonucleotide reductase inhibitor (Hydroxycarbamide)

Topoisomerase inhibitors
(S phase)

I	Camptotheca (Belotecan Camptothecin Cositecan Etirinotecan pegol Exatecan Gimatecan Irinotecan Lurtotecan Rubitecan Silatecan Topotecan)
II	Podophyllum (Etoposide Teniposide)
II+Intercalation	Anthracyclines (Aclarubicin Amrubicin Daunorubicin (+cytarabine) Doxorubicin Epirubicin Idarubicin Pirarubicin Valrubicin Zorubicin) Anthracenediones (Losoxantrone Mitoxantrone Pixantrone) Amsacrine Bisantrene Crisnatol Menogaril

Crosslinking of DNA
(CCNS)

Alkylating	Nitrogen mustards: Bendamustine Chlormethine Cyclophosphamide (Ifosfamide Trofosfamide) Chlorambucil Melphalan (Melphalan flufenamide) Prednimustine Uramustine Nitrosoureas: Carmustine Fotemustine Lomustine (Semustine) Nimustine Ranimustine Streptozocin Alkyl sulfonates: Busulfan (Mannosulfan Treosulfan) Aziridines: Carboquone Thiotepa Triaziquone Triethylenemelamine
Platinum-based	Carboplatin Cisplatin Dicycloplatin Nedaplatin Oxaliplatin Satraplatin
Nonclassical	Altretamine Hydrazines (Procarbazine) Etoglucid Mitobronitol Pipobroman Triazenes (Dacarbazine Mitozolomide Temozolomide)
Intercalation	Streptomyces (Dactinomycin Bleomycin Mitomycins Plicamycin)

Photosensitizers/PDT

Other

Enzyme inhibitors	FI (Tipifarnib) CDK inhibitors (Abemaciclib Alvocidib Palbociclib Ribociclib Seliciclib) PrI Bortezomib Carfilzomib Oprozomib Ixazomib PhI (Anagrelide) IMPDI (Tiazofurin) LI (Masoprocol) PARP inhibitor (Fuzuloparib Niraparib +abiraterone acetate Olaparib Rucaparib) HDAC (Belinostat Entinostat Panobinostat Romidepsin Vorinostat) PIKI (Pi3K) (Alpelisib Copanlisib Duvelisib Idelalisib Inavolisib Umbralisib) IDH (Enasidenib Ivosidenib Olutasidenib Vorasidenib)
Receptor antagonists	ERA (Atrasentan) Retinoid X receptor (Bexarotene) Sex steroid (Testolactone)
Other/ungrouped	Adagrasib Aflibercept Arsenic trioxide Asparagine depleters (Asparaginase/Pegaspargase) Axicabtagene ciloleucel Belzutifan Bexarotene Brexucabtagene autoleucel Celecoxib Ciltacabtagene autoleucel Demecolcine Denileukin diftitox Eflornithine Elesclomol Elsamitrucin Epacadostat Eribulin Estramustine Glasdegib Idecabtagene vicleucel Imetelstat Lifileucel Lisocabtagene maraleucel Lonidamine Lucanthone Lurbinectedin Mitoguazone Mitotane Nadofaragene firadenovec Navitoclax Obecabtagene autoleucel Oblimersen Omacetaxine mepesuccinate Plitidepsin Tabelecleucel Retinoids (Alitretinoin Tretinoin) Selinexor Sitimagene ceradenovec Sotorasib Tagraxofusp Talimogene laherparepvec Tazemetostat Tebentafusp Tiazofurine Tigilanol tiglate Tisagenlecleucel Trabectedin Veliparib Venetoclax Verdinexor Vosaroxin

WHO-EM
Withdrawn from market
Clinical trials:
- Phase III
- Never to phase III

This antineoplastic or immunomodulatory drug article is a stub. You can help Misplaced Pages by expanding it.

Categories: