Revision as of 13:46, 27 October 2011 editMeodipt (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers, Rollbackers35,718 editsNo edit summary← Previous edit |
Latest revision as of 18:23, 21 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,127 edits removed Category:Phenols; added Category:Hydroxyarenes using HotCat |
(14 intermediate revisions by 13 users not shown) |
Line 1: |
Line 1: |
|
|
{{short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| verifiedrevid = 457799158 |
|
| IUPAC_name = |
|
| IUPAC_name = |
|
| image = SoRI-9409_structure.png |
|
| image = SoRI-9409 Structure.svg |
|
| width = 220 |
|
| width = |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
Line 13: |
Line 15: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = |
|
| CAS_number = |
|
| ATC_prefix = |
|
| ATC_prefix = |
|
| PubChem = 9805452 |
|
| PubChem = 9805452 |
|
|
| ChemSpiderID = 7981212 |
|
|
| ChEMBL = 610261 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=29 | H=27 | Cl=1 | N=2 | O=3 |
|
| C=29 | H=27 | Cl=1 | N=2 | O=3 |
|
|
| StdInChI=1S/C29H27ClN2O3/c30-21-6-3-17(4-7-21)20-11-19-13-29(34)23-12-18-5-8-22(33)26-24(18)28(29,27(35-26)25(19)31-14-20)9-10-32(23)15-16-1-2-16/h3-8,11,14,16,23,27,33-34H,1-2,9-10,12-13,15H2/t23-,27+,28+,29-/m1/s1 |
|
| molecular_weight = 486.988 g/mol |
|
|
|
| StdInChIKey = WRVDUHKCIPYGNZ-FQYQUSJJSA-N |
|
| smiles = C1CC1CN2CC345C6=C(C3(2CC7=C4C(=C(C=C7)O)O5)O)C=C(C=N6)C8=CC=C(C=C8)Cl |
|
| smiles = C1CC1CN2CC345C6=C(C3(2CC7=C4C(=C(C=C7)O)O5)O)C=C(C=N6)C8=CC=C(C=C8)Cl |
|
}} |
|
}} |
|
|
|
|
|
'''SoRI-9409''' is a mixed ] ] and ] ], used in biomedical research. It produces moderate analgesic effects without development of tolerance and with reduced withdrawal symptoms compared to standard opioid analgesics,<ref>Wells JL, Bartlett JL, Ananthan S, Bilsky EJ. In vivo pharmacological characterization of SoRI 9409, a nonpeptidic opioid mu-agonist/delta-antagonist that produces limited antinociceptive tolerance and attenuates morphine physical dependence. ''Journal of Pharmacology and Experimental Therapeutics''. 2001 May;297(2):597-605. PMID 11303048</ref> as well as showing anti-addictive effects that may be useful in the treatment of ].<ref>Nielsen CK, Simms JA, Pierson HB, Li R, Saini SK, Ananthan S, Bartlett SE. A novel delta opioid receptor antagonist, SoRI-9409, produces a selective and long-lasting decrease in ethanol consumption in heavy-drinking rats. ''Biological Psychiatry''. 2008 Dec 1;64(11):974-81. PMID 18774553</ref><ref>Nielsen CK, Simms JA, Bito-Onon JJ, Li R, Ananthan S, Bartlett SE. The delta opioid receptor antagonist, SoRI-9409, decreases yohimbine stress-induced reinstatement of ethanol-seeking. ''Addiction Biology. 2011 Feb 11. doi: 10.1111/j.1369-1600.2010.00295.x. PMID 21309957</ref> |
|
'''SoRI-9409''' is a mixed ] ] and ] ], used in biomedical research. It produces moderate analgesic effects without development of tolerance and with reduced withdrawal symptoms compared to standard opioid analgesics,<ref>{{cite journal | vauthors = Wells JL, Bartlett JL, Ananthan S, Bilsky EJ | title = In vivo pharmacological characterization of SoRI 9409, a nonpeptidic opioid mu-agonist/delta-antagonist that produces limited antinociceptive tolerance and attenuates morphine physical dependence | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 297 | issue = 2 | pages = 597–605 | date = May 2001 | pmid = 11303048 }}</ref> as well as showing anti-addictive effects that may be useful in the treatment of ].<ref>{{cite journal | vauthors = Nielsen CK, Simms JA, Pierson HB, Li R, Saini SK, Ananthan S, Bartlett SE | title = A novel delta opioid receptor antagonist, SoRI-9409, produces a selective and long-lasting decrease in ethanol consumption in heavy-drinking rats | journal = Biological Psychiatry | volume = 64 | issue = 11 | pages = 974–81 | date = December 2008 | pmid = 18774553 | pmc = 3888668 | doi = 10.1016/j.biopsych.2008.07.018 }}</ref><ref>{{cite journal | vauthors = Nielsen CK, Simms JA, Bito-Onon JJ, Li R, Ananthan S, Bartlett SE | title = The delta opioid receptor antagonist, SoRI-9409, decreases yohimbine stress-induced reinstatement of ethanol-seeking | journal = Addiction Biology | volume = 17 | issue = 2 | pages = 224–34 | date = March 2012 | pmid = 21309957 | pmc = 3906128 | doi = 10.1111/j.1369-1600.2010.00295.x }}</ref> |
|
|
|
|
|
==References== |
|
== References == |
|
|
{{Reflist}} |
|
<references /> |
|
|
|
|
|
|
|
{{Opioid receptor modulators}} |
⚫ |
] |
|
|
|
|
⚫ |
] |
|
|
] |
|
] |
|
⚫ |
] |
|
|
] |
|
⚫ |
] |
|
] |
|
] |