Revision as of 04:41, 26 August 2011 editBomazi (talk | contribs)Extended confirmed users3,446 editsNo edit summary← Previous edit | Revision as of 04:56, 26 August 2011 edit undoBomazi (talk | contribs)Extended confirmed users3,446 editsNo edit summaryNext edit → | ||
Line 1: | Line 1: | ||
{{ |
{{Drugbox | ||
| name = Sulfalene | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = T6BL4ZC15G | |||
| verifiedrevid = 444121406 | |||
| IUPAC_name = 4-Amino-''N''-(3-methoxypyrazinyl)benzenesulfonamide | | IUPAC_name = 4-Amino-''N''-(3-methoxypyrazinyl)benzenesulfonamide | ||
| image = sulfalene.png | | image = sulfalene.png | ||
| width = | |||
| alt = | |||
| image2 = | |||
| width2 = | |||
| alt2 = | |||
| imagename = <!-- else may use drug_name --> | |||
| drug_name = <!-- else may use imagename --> | |||
| caption = | |||
<!--Clinical data--> | |||
| tradename = | |||
| Drugs.com = | |||
| MedlinePlus = | |||
| licence_EU = <!-- EMA requires brand name --> | |||
| licence_US = <!-- FDA may use generic name --> | |||
| DailyMedID = <!-- preference to licence_US --> | |||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | |||
| pregnancy_US = <!-- A / B / C / D / X --> | |||
| pregnancy_category= | |||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | |||
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM --> | |||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | |||
| legal_status = | |||
| dependency_liability = | |||
| routes_of_administration = Oral | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = | |||
| protein_bound = | |||
| metabolism = | |||
| elimination_half-life = | |||
| excretion = | |||
<!--Identifiers--> | |||
| CAS_number = 152-47-6 | |||
| CAS_supplemental = | |||
| ATCvet = | |||
| ATC_prefix = J01 | |||
| ATC_suffix = ED02 | |||
| ATC_supplemental = | |||
| PubChem = 9047 | |||
| PubChemSubstance = | |||
| IUPHAR_ligand = | |||
| DrugBank = DB00664 | |||
| ChemSpiderID = 8695 | |||
| UNII = T6BL4ZC15G | |||
| KEGG = D01216 | |||
| ChEBI = | |||
| ChEMBL = | |||
<!--Chemical data--> | |||
| C=11 | H=12 | N=4 | O=3 | S=1 | |||
| molecular_weight = 280.304 g/mol | |||
| smiles = O=S(=O)(Nc1nccnc1OC)c2ccc(N)cc2 | |||
| StdInChI = 1S/C11H12N4O3S/c1-18-11-10(13-6-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,15) | |||
| StdInChI_comment = | |||
| StdInChIKey = KXRZBTAEDBELFD-UHFFFAOYSA-N | |||
| synonyms = Sulfametopyrazine | |||
| density = | |||
| melting_point = | |||
| melting_high = | |||
| melting_notes = | |||
| boiling_point = | |||
| boiling_notes = | |||
| solubility = | |||
| specific_rotation = | |||
| sec_combustion = | |||
<!-- ? --> | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| verifiedrevid = 444121406 | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ||
| ChemSpiderID = 8695 | |||
| InChI = 1/C11H12N4O3S/c1-18-11-10(13-6-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,15) | | InChI = 1/C11H12N4O3S/c1-18-11-10(13-6-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,15) | ||
| InChIKey = KXRZBTAEDBELFD-UHFFFAOYAH | | InChIKey = KXRZBTAEDBELFD-UHFFFAOYAH | ||
| smiles = O=S(=O)(Nc1nccnc1OC)c2ccc(N)cc2 | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChI = 1S/C11H12N4O3S/c1-18-11-10(13-6-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,15) | |||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChIKey = KXRZBTAEDBELFD-UHFFFAOYSA-N | |||
| CAS_number = 152-47-6 | |||
| ATC_prefix = J01 | |||
| ATC_suffix = ED02 | |||
| PubChem = 9047 | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | ||
| DrugBank = DB00664 | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | | KEGG_Ref = {{keggcite|correct|kegg}} | ||
| KEGG = D01216 | |||
| C=11|H=12|N=4|O=3|S=1 | |||
| molecular_weight = 280.304 g/mol | |||
| bioavailability = | |||
| protein_bound = | |||
| metabolism = | |||
| elimination_half-life = | |||
| excretion = | |||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | |||
| pregnancy_US = <!-- A / B / C / D / X --> | |||
| pregnancy_category= | |||
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | |||
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | |||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | |||
| legal_status = | |||
| routes_of_administration = Oral | |||
}} | }} | ||
Revision as of 04:56, 26 August 2011
Pharmaceutical compoundClinical data | |
---|---|
Other names | Sulfametopyrazine |
Routes of administration | Oral |
ATC code | |
Identifiers | |
IUPAC name
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
CompTox Dashboard (EPA) | |
ECHA InfoCard | 100.005.278 |
Chemical and physical data | |
Formula | C11H12N4O3S |
Molar mass | 280.304 g/mol g·mol |
3D model (JSmol) | |
SMILES
| |
InChI
| |
(verify) |
Sulfalene is a sulfonamide antibacterial used for the treatment of chronic bronchitis, urinary tract infections and malaria.
References
Antibacterials that inhibit nucleic acid (J01E, J01M) | |||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Antifolates (inhibit bacterial purine metabolism, thereby inhibiting DNA and RNA synthesis) |
| ||||||||||||||||
Quinolones (inhibit bacterial topoisomerase and/or DNA gyrase, thereby inhibiting DNA replication) |
| ||||||||||||||||
Anaerobic DNA inhibitors |
| ||||||||||||||||
RNA synthesis |
| ||||||||||||||||
|
This systemic antibiotic-related article is a stub. You can help Misplaced Pages by expanding it. |