| Revision as of 17:08, 19 April 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 19:32, 20 December 2023 edit undoJJMC89 bot III (talk | contribs)Bots, Administrators3,684,692 editsm Moving Category:Eli Lilly and Company brands to Category:Drugs developed by Eli Lilly and Company per Misplaced Pages:Categories for discussion/Log/2023 December 9#Category:AstraZeneca brands |
| (26 intermediate revisions by 23 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
| ⚫ |
| verifiedrevid = 280823046 |
|
|
|
| Watchedfields = changed |
|
| IUPAC_name = |
|
|
⚫ |
| verifiedrevid = 424883636 |
|
| image = LY-344,545_structure.png |
|
|
|
| IUPAC_name = (αS)-α-Amino-α--9H-xanthene-9-propanoic acid |
| ⚫ |
| width = 160 |
|
|
|
| image = LY-344545 Structure.svg |
| ⚫ |
| CAS_number = |
|
|
⚫ |
| width = 160 |
| ⚫ |
| ATC_prefix = |
|
| ⚫ |
| ATC_suffix = |
|
|
| PubChem = |
|
| ⚫ |
| DrugBank = |
|
| ⚫ |
| C=20|H=19|N=1|O=5 |
|
|
| molecular_weight = 353.37 g/mol |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| ⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
| ⚫ |
}} |
|
|
|
|
|
|
|
<!--Clinical data--> |
| ⚫ |
'''LY-344,545''' is a research drug developed by the pharmaceutical company ], which acts as an ] for the ] subtype ]. It is an ] of another metabotropic glutamate receptor antagonist, the ]-selective ].<ref>Ornstein PL, Bleisch TJ, Arnold MB, Kennedy JH, Wright RA, Johnson BG, Tizzano JP, Helton DR, Kallman MJ, Schoepp DD, Hérin M. 2-substituted (2SR)-2-amino-2-((1SR,2SR)-2-carboxycycloprop-1-yl)glycines as potent and selective antagonists of group II metabotropic glutamate receptors. 2. Effects of aromatic substitution, pharmacological characterization, and bioavailability. ''Journal of Medicinal Chemistry''. 1998 Jan 29;41(3):358-78. PMID 9464367</ref><ref>Doherty AJ, Palmer MJ, Bortolotto ZA, Hargreaves A, Kingston AE, Ornstein PL, Schoepp DD, Lodge D, Collingridge GL. A novel, competitive mGlu(5) receptor antagonist (LY344545) blocks DHPG-induced potentiation of NMDA responses but not the induction of LTP in rat hippocampal slices. ''British Journal of Pharmacology''. 2000 Sep;131(2):239-44. PMID 10991916</ref> |
|
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 201851-20-9 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 9ZSQ1C4209 |
|
⚫ |
| ATC_prefix = |
|
⚫ |
| ATC_suffix = |
|
|
| PubChem = 10618042 |
|
|
| ChemSpiderID = 8793407 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
|
|
|
|
|
<!--Chemical data--> |
|
{{pharmacology-stub}} |
|
|
⚫ |
| C=20 | H=19 | N=1 | O=5 |
|
|
| smiles = c1ccc2c(c1)C(c3ccccc3O2)C(4C4C(=O)O)(C(=O)O)N |
|
|
| StdInChI = 1S/C20H19NO5/c21-20(19(24)25,15-9-13(15)18(22)23)10-14-11-5-1-3-7-16(11)26-17-8-4-2-6-12(14)17/h1-8,13-15H,9-10,21H2,(H,22,23)(H,24,25)/t13-,15-,20+/m1/s1 |
|
|
| StdInChIKey = VLZBRVJVCCNPRJ-RCDCFZSISA-N |
|
|
|
|
⚫ |
}} |
|
|
|
|
|
⚫ |
'''LY-344,545''' is a research drug developed by the pharmaceutical company ], which acts as an ] for the ] subtype ]. It is an ] of another metabotropic glutamate receptor antagonist, the ]-selective ].<ref>{{cite journal | vauthors = Ornstein PL, Bleisch TJ, Arnold MB, Kennedy JH, Wright RA, Johnson BG, Tizzano JP, Helton DR, Kallman MJ, Schoepp DD, Hérin M | display-authors = 6 | title = 2-substituted (2''SR'')-2-amino-2-((1''SR'',2''SR'')-2-carboxycycloprop-1-yl)glycines as potent and selective antagonists of group II metabotropic glutamate receptors. 2. Effects of aromatic substitution, pharmacological characterization, and bioavailability | journal = Journal of Medicinal Chemistry | volume = 41 | issue = 3 | pages = 358–78 | date = January 1998 | pmid = 9464367 | doi = 10.1021/jm970498o }}</ref><ref>{{cite journal | vauthors = Doherty AJ, Palmer MJ, Bortolotto ZA, Hargreaves A, Kingston AE, Ornstein PL, Schoepp DD, Lodge D, Collingridge GL | display-authors = 6 | title = A novel, competitive mGlu(5) receptor antagonist (LY344545) blocks DHPG-induced potentiation of NMDA responses but not the induction of LTP in rat hippocampal slices | journal = British Journal of Pharmacology | volume = 131 | issue = 2 | pages = 239–44 | date = September 2000 | pmid = 10991916 | pmc = 1572327 | doi = 10.1038/sj.bjp.0703574 }}</ref> |
|
|
|
|
|
== References == |
|
== References == |
|
|
{{Reflist|2}} |
|
<references/> |
|
|
|
|
|
|
|
{{Metabotropic glutamate receptor modulators}} |
|
|
|
|
|
|
] |
|
{{Glutamate_receptor_ligands}} |
|
|
] |
|
] |
|
|
] |
|
|
{{nervous-system-drug-stub}} |
