Revision as of 14:11, 12 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_P← Previous edit |
Latest revision as of 11:21, 23 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers173,284 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
(21 intermediate revisions by 16 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Missing information|everything|date=January 2017}} |
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
{{Drugbox |
⚫ |
| UNII = 0S9SLS3L93 |
|
|
| verifiedrevid = 437132997 |
|
| verifiedrevid = 447821444 |
|
| IUPAC_name = 3-(dimethylcarbamoyl)propyl 2-(4-chlorophenoxy)-2-methylpropanoate |
|
| IUPAC_name = 3-(dimethylcarbamoyl)propyl 2-(4-chlorophenoxy)-2-methylpropanoate |
|
| image = Clofibride.svg |
|
| image = Clofibride.svg |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = ] to ]; ] ] |
|
⚫ |
| elimination_half-life = 12 hours (clofibric acid) |
|
⚫ |
| excretion = ] (mostly) and fecal |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = 26717-47-5 |
|
⚫ |
| ATC_prefix = C10 |
|
⚫ |
| ATC_suffix = AB10 |
|
⚫ |
| PubChem = 160134 |
|
|
| ChEMBL = 1697831 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 140758 |
|
| ChemSpiderID = 140758 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| InChI = 1/C16H22ClNO4/c1-16(2,22-13-9-7-12(17)8-10-13)15(20)21-11-5-6-14(19)18(3)4/h7-10H,5-6,11H2,1-4H3 |
|
|
⚫ |
| UNII = 0S9SLS3L93 |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = D07188 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=16 | H=22 | Cl=1 | N=1 | O=4 |
|
| smiles = Clc1ccc(OC(C(=O)OCCCC(=O)N(C)C)(C)C)cc1 |
|
| smiles = Clc1ccc(OC(C(=O)OCCCC(=O)N(C)C)(C)C)cc1 |
|
| InChIKey = CXQGFLBVUNUQIA-UHFFFAOYAF |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C16H22ClNO4/c1-16(2,22-13-9-7-12(17)8-10-13)15(20)21-11-5-6-14(19)18(3)4/h7-10H,5-6,11H2,1-4H3 |
|
| StdInChI = 1S/C16H22ClNO4/c1-16(2,22-13-9-7-12(17)8-10-13)15(20)21-11-5-6-14(19)18(3)4/h7-10H,5-6,11H2,1-4H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = CXQGFLBVUNUQIA-UHFFFAOYSA-N |
|
| StdInChIKey = CXQGFLBVUNUQIA-UHFFFAOYSA-N |
⚫ |
| CAS_number = 26717-47-5 |
|
⚫ |
| ATC_prefix = C10 |
|
⚫ |
| ATC_suffix = AB10 |
|
⚫ |
| PubChem = 160134 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = D07188 |
|
⚫ |
| C=16|H=22|Cl=1|N=1|O=4 |
|
|
| molecular_weight = 327.803 g/mol |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = ] to clofibric acid; ] ] |
|
⚫ |
| elimination_half-life = 12 hours (clofibric acid) |
|
⚫ |
| excretion = ] (mostly) and fecal |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category= |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
'''Clofibride''' is a ]. |
|
|
|
'''Clofibride''' is a ]. Clofibride is a derivative of ]. In the body it is converted into 4-chlorophenoxyisobutyric acid (]),<ref>{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/160134|title=Clofibride}}</ref> which is the true ].<ref name="römpp">{{RömppOnline|Name=Clofibrat |Datum=06. Mai 2020 |ID=RD-03-02073 }}</ref> So clofibride, just like clofibrate is a ] of clofibric acid. |
|
|
|
|
|
==References== |
|
|
{{Reflist|2}} |
|
|
|
|
|
{{Lipid modifying agents}} |
|
{{Lipid modifying agents}} |
|
|
{{PPAR modulators}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
|
|
{{cardiovascular-drug-stub}} |
|
{{cardiovascular-drug-stub}} |
|
|
|
|
] |
|