Revision as of 11:11, 17 February 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: UNII ChEMBL.← Previous edit | Revision as of 11:22, 17 February 2011 edit undoCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChEMBL_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoBNext edit → | ||
Line 1: | Line 1: | ||
{{Drugbox | {{Drugbox | ||
⚫ | | verifiedrevid = 414415965 | ||
| Verifiedfields = changed | |||
⚫ | | verifiedrevid = |
||
| IUPAC_name = (2S)-2-propanoic acid | | IUPAC_name = (2S)-2-propanoic acid | ||
| image = Dexibuprofen Structural Formulae V.1.svg | | image = Dexibuprofen Structural Formulae V.1.svg | ||
Line 13: | Line 12: | ||
| smiles = C(c1ccc(cc1)CC(C)C)C(=O)O | | smiles = C(c1ccc(cc1)CC(C)C)C(=O)O | ||
| InChIKey = HEFNNWSXXWATRW-JTQLQIEIBT | | InChIKey = HEFNNWSXXWATRW-JTQLQIEIBT | ||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | |||
| ChEMBL = 175 | | ChEMBL = 175 | ||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
Line 23: | Line 23: | ||
| PubChem = 39912 | | PubChem = 39912 | ||
| DrugBank = | | DrugBank = | ||
| KEGG_Ref = {{keggcite| |
| KEGG_Ref = {{keggcite|correct|kegg}} | ||
| KEGG = D03715 | | KEGG = D03715 | ||
| C=13|H=18|O=2 | | C=13|H=18|O=2 |
Revision as of 11:22, 17 February 2011
Pharmaceutical compoundClinical data | |
---|---|
Routes of administration | Oral, Other ROAs Unknown |
ATC code | |
Identifiers | |
IUPAC name
| |
CAS Number | |
PubChem CID | |
ChemSpider | |
UNII | |
KEGG | |
ChEMBL | |
CompTox Dashboard (EPA) | |
ECHA InfoCard | 100.106.960 |
Chemical and physical data | |
Formula | C13H18O2 |
Molar mass | 206.28082 g/mol g·mol |
3D model (JSmol) | |
SMILES
| |
InChI
| |
(verify) |
Dexibuprofen is a non-steroidal anti-inflammatory drug. It is the active dextrorotatory enantiomer of ibuprofen. Most ibuprofen formulations contain a racemic mixture of dexibuprofen and (−)-ibuprofen.
Non-steroidal anti-inflammatory drugs (NSAIDs) (primarily M01A and M02A, also N02BA) | |
---|---|
pyrazolones / pyrazolidines | |
salicylates | |
acetic acid derivatives and related substances | |
oxicams | |
propionic acid derivatives (profens) |
|
n-arylanthranilic acids (fenamates) | |
COX-2 inhibitors (coxibs) | |
other | |
NSAID combinations | |
Key: underline indicates initially developed first-in-class compound of specific group; WHO-Essential Medicines; withdrawn drugs; veterinary use. | |
Non-steroidal anti-inflammatory drugs (NSAIDs) (primarily M01A and M02A, also N02BA) | |
---|---|
pyrazolones / pyrazolidines | |
salicylates | |
acetic acid derivatives and related substances | |
oxicams | |
propionic acid derivatives (profens) |
|
n-arylanthranilic acids (fenamates) | |
COX-2 inhibitors (coxibs) | |
other | |
NSAID combinations | |
Key: underline indicates initially developed first-in-class compound of specific group; WHO-Essential Medicines; withdrawn drugs; veterinary use. | |
This drug article relating to the musculoskeletal system is a stub. You can help Misplaced Pages by expanding it. |