Revision as of 09:11, 28 December 2024 editBoghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,799 edits consistent citation formatting← Previous edit | Revision as of 09:23, 28 December 2024 edit undoBoghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,799 edits corrected stereochemistry and added missing data to infoboxTag: nowiki addedNext edit → | ||
Line 5: | Line 5: | ||
{{one source|date=March 2021}} | {{one source|date=March 2021}} | ||
}} | }} | ||
{{Infobox drug | |||
{{Drugbox | |||
| drug_name = | |||
| Watchedfields = changed | |||
| INN = | |||
| verifiedrevid = 443791079 | |||
| type = <!-- empty --> | |||
| IUPAC_name = 2-(diethylamino)-1-methylethyl (1''S'')-1-hydroxy-1,1'-bi(cyclohexyl)-2-carboxylate | |||
| image = Rociverine. |
| image = Rociverine.svg | ||
| width = | |||
| alt = | |||
| caption = | |||
| image2 = | |||
| width2 = | |||
| alt2 = | |||
| caption2 = | |||
| imageL = | |||
| widthL = | |||
| altL = | |||
| imageR = | |||
| widthR = | |||
| altR = | |||
| captionLR = | |||
<!--Clinical data--> | <!-- Clinical data --> | ||
| |
| pronounce = | ||
| tradename = | |||
| Drugs.com = {{drugs.com|international|rociverine}} | |||
| |
| Drugs.com = | ||
| MedlinePlus = | |||
| pregnancy_US = <!-- A / B / C / D / X --> | |||
| licence_CA = | |||
| pregnancy_category = | |||
| licence_EU = | |||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | |||
| DailyMedID = | |||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| licence_US = | |||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | |||
| pregnancy_AU = | |||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | |||
| pregnancy_AU_comment = | |||
| legal_status = | |||
| pregnancy_category= | |||
| routes_of_administration = | |||
| dependency_liability = | |||
| addiction_liability = | |||
<!--Pharmacokinetic data--> | |||
| routes_of_administration = | |||
| bioavailability = | |||
| class = | |||
| protein_bound = | |||
| ATCvet = | |||
| metabolism = | |||
| elimination_half-life = | |||
| excretion = | |||
<!--Identifiers--> | |||
| CAS_number = 53716-44-2 | |||
| ATC_prefix = A03 | | ATC_prefix = A03 | ||
| ATC_suffix = AA06 | | ATC_suffix = AA06 | ||
| ATC_supplemental = | |||
| PubChem = 68705 | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
<!-- Legal status --> | |||
| DrugBank = | |||
| legal_AU = | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| legal_AU_comment = | |||
| UNII = VI08KS44V0 | |||
| legal_BR = | |||
| legal_BR_comment = | |||
| legal_CA = | |||
| legal_CA_comment = | |||
| legal_DE = | |||
| legal_DE_comment = | |||
| legal_NZ = | |||
| legal_NZ_comment = | |||
| legal_UK = | |||
| legal_UK_comment = | |||
| legal_US = | |||
| legal_US_comment = | |||
| legal_EU = | |||
| legal_EU_comment = | |||
| legal_UN = | |||
| legal_UN_comment = | |||
| legal_status = | |||
<!-- Pharmacokinetic data --> | |||
| bioavailability = | |||
| protein_bound = | |||
| metabolism = | |||
| metabolites = | |||
| onset = | |||
| elimination_half-life = | |||
| duration_of_action= | |||
| excretion = | |||
<!-- Identifiers --> | |||
| CAS_number = 53716-44-2 | |||
| CAS_supplemental = | |||
| PubChem = 24892842 | |||
| PubChemSubstance = | |||
| IUPHAR_ligand = | |||
| DrugBank = DB13581 | |||
| ChemSpiderID = | |||
| UNII = VI08KS44V0 | |||
| KEGG = D07078 | |||
| ChEBI = 135440 | |||
| ChEMBL = 4755537 | |||
| NIAID_ChemDB = | |||
| PDB_ligand = | |||
| synonyms = | |||
<!--Chemical data--> | <!-- Chemical and physical data --> | ||
| IUPAC_name = <nowiki>1-(diethylamino)propan-2-yl (1S,2S)-2-cyclohexyl-2-hydroxycyclohexane-1-carboxylate</nowiki> | |||
| C=20 | H=37 | N=1 | O=3 | |||
| C=20 | H=37 | N=1 | O=3 | |||
| synonyms = <small>(1''S'')-1-(diethylamino)propan-2-yl 1-hydroxybi(cyclohexane)-2-carboxylate</small> | |||
| molecular_weight = | |||
| SMILES = CCN(CC)CC(C)OC(=O)1CCCC1(C2CCCCC2)O | |||
| Jmol = | |||
| StdInChI = InChI=1S/C20H37NO3/c1-4-21(5-2)15-16(3)24-19(22)18-13-9-10-14-20(18,23)17-11-7-6-8-12-17/h16-18,23H,4-15H2,1-3H3/t16?,18-,20+/m1/s1 | |||
| StdInChI_comment = | |||
| StdInChIKey = XPYLKZZOBVLVHB-QDKIRNHSSA-N | |||
| density = | |||
| density_notes = | |||
| melting_point = | |||
| melting_high = | |||
| melting_notes = | |||
| boiling_point = | |||
| boiling_notes = | |||
| solubility = | |||
| sol_units = | |||
| specific_rotation = | |||
}} | }} | ||
Revision as of 09:23, 28 December 2024
Chemical compound
This article has multiple issues. Please help improve it or discuss these issues on the talk page. (Learn how and when to remove these messages)
|
Clinical data | |
---|---|
ATC code | |
Identifiers | |
IUPAC name
| |
CAS Number | |
PubChem CID | |
DrugBank | |
UNII | |
KEGG | |
ChEBI | |
ChEMBL | |
CompTox Dashboard (EPA) | |
ECHA InfoCard | 100.053.356 |
Chemical and physical data | |
Formula | C20H37NO3 |
Molar mass | 339.520 g·mol |
3D model (JSmol) | |
SMILES
| |
InChI
|
Rociverine is an antispasmodic drug used to treat urinary, gastrointestinal and biliary spasms. It is antimuscarinic drug.
The (1R,2R) compound showed 240-fold greater affinity for the muscarinic receptor, but the (1S,2S) compound showed the best selectivity.
References
- "Rociverine".
- Toson G, Schiantarelli P, Murmann W (1978). "Rociverine, a new antispasmodic agent with balanced neurotropic and myotropic activity". Arzneimittel-Forschung. 28 (7): 1130–42. PMID 582702.
- Barbier P, Renzetti AR, Turbanti L, Di Bugno C, Fornai F, Vaglini F, et al. (July 1995). "Stereoselective inhibition of muscarinic receptor subtypes by the eight stereoisomers related to rociverine". European Journal of Pharmacology. 290 (2): 125–132. doi:10.1016/0922-4106(95)90024-1. PMID 8575526.
Drugs for functional gastrointestinal disorders (A03) | |||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Drugs for functional bowel disorders |
| ||||||||||||
Belladonna and derivatives (antimuscarinics) |
| ||||||||||||
Propulsives |
This drug article relating to the gastrointestinal system is a stub. You can help Misplaced Pages by expanding it. |