Revision as of 22:52, 10 November 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'UNII', 'CAS_number').← Previous edit | Revision as of 22:53, 10 November 2011 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: '').Next edit → | ||
Line 25: | Line 25: | ||
<!--Identifiers--> | <!--Identifiers--> | ||
| CAS_number_Ref = {{cascite|correct|??}} | | CAS_number_Ref = {{cascite|correct|??}} | ||
| CAS_number = |
| CAS_number = 17449-96-6 | ||
| ATC_prefix = M02 | | ATC_prefix = M02 | ||
| ATC_suffix = AA03 | | ATC_suffix = AA03 | ||
Line 35: | Line 35: | ||
| ChemSpiderID = 4938775 | | ChemSpiderID = 4938775 | ||
| UNII_Ref = {{fdacite|changed|FDA}} | | UNII_Ref = {{fdacite|changed|FDA}} | ||
| UNII = |
| UNII = 5RB28NE79Y | ||
<!--Chemical data--> | |||
| smiles = O=C(NCCN(CC)CC)COc1ccc(Cl)cc1.O=C2N(c1ccccc1)N(C(=O)C2CCCC)c3ccccc3 | | smiles = O=C(NCCN(CC)CC)COc1ccc(Cl)cc1.O=C2N(c1ccccc1)N(C(=O)C2CCCC)c3ccccc3 | ||
| InChI = 1/C19H20N2O2.C14H21ClN2O2/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16;1-3-17(4-2)10-9-16-14(18)11-19-13-7-5-12(15)6-8-13/h4-13,17H,2-3,14H2,1H3;5-8H,3-4,9-11H2,1-2H3,(H,16,18) | | InChI = 1/C19H20N2O2.C14H21ClN2O2/c1-2-3-14-17-18(22)20(15-10-6-4-7-11-15)21(19(17)23)16-12-8-5-9-13-16;1-3-17(4-2)10-9-16-14(18)11-19-13-7-5-12(15)6-8-13/h4-13,17H,2-3,14H2,1H3;5-8H,3-4,9-11H2,1-2H3,(H,16,18) |
Revision as of 22:53, 10 November 2011
Pharmaceutical compoundCombination of | |
---|---|
Clofexamide | ? Class |
Phenylbutazone | Non-steroidal anti-inflammatory drug |
Clinical data | |
Routes of administration | Oral, rectal, topical |
ATC code | |
Identifiers | |
CAS Number | |
PubChem CID | |
ChemSpider | |
UNII | |
CompTox Dashboard (EPA) | |
ECHA InfoCard | 100.037.681 |
Chemical and physical data | |
3D model (JSmol) | |
SMILES
| |
InChI
| |
(what is this?) (verify) |
Clofezone is a drug used for joint and muscular pain. It is a combination of clofexamide and phenylbutazone.
Non-steroidal anti-inflammatory drugs (NSAIDs) (primarily M01A and M02A, also N02BA) | |
---|---|
pyrazolones / pyrazolidines | |
salicylates | |
acetic acid derivatives and related substances | |
oxicams | |
propionic acid derivatives (profens) |
|
n-arylanthranilic acids (fenamates) | |
COX-2 inhibitors (coxibs) | |
other | |
NSAID combinations | |
Key: underline indicates initially developed first-in-class compound of specific group; WHO-Essential Medicines; withdrawn drugs; veterinary use. | |
Non-steroidal anti-inflammatory drugs (NSAIDs) (primarily M01A and M02A, also N02BA) | |
---|---|
pyrazolones / pyrazolidines | |
salicylates | |
acetic acid derivatives and related substances | |
oxicams | |
propionic acid derivatives (profens) |
|
n-arylanthranilic acids (fenamates) | |
COX-2 inhibitors (coxibs) | |
other | |
NSAID combinations | |
Key: underline indicates initially developed first-in-class compound of specific group; WHO-Essential Medicines; withdrawn drugs; veterinary use. | |
Topical products for joint and muscular pain (M02) | |||||||
---|---|---|---|---|---|---|---|
Anti-inflammatory preparations, non-steroids |
| ||||||
Capsaicin derivatives | |||||||
Other |
This drug article relating to the musculoskeletal system is a stub. You can help Misplaced Pages by expanding it. |